Henneberg Quarry, Weitisberga, Wurzbach, Saale-Orla District, Thuringia, Germanyi
| Regional Level Types | |
|---|---|
| Henneberg Quarry | Quarry (Active) |
| Weitisberga | Village |
| Wurzbach | Municipality |
| Saale-Orla District | District |
| Thuringia | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 29' 59'' North , 11° 30' 24'' East
Latitude & Longitude (decimal):
Type:
Quarry (Active) - last checked 2024
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Wurzbach | 3,864 (2015) | 4.6km |
| Leutenberg | 2,521 (2015) | 7.9km |
| Ludwigsstadt | 3,790 (2013) | 8.6km |
| Probstzella | 3,122 (2011) | 9.5km |
| Bad Lobenstein | 6,164 (2015) | 10.8km |
Other Languages:
German:
Steinbruch Henneberg (Granitwerk Fischer), Weitisberga, Wurzbach, Saale-Orla-Kreis, Thüringen, Deutschland
Quarry in Henneberg granite, a post-variscian intrusion complex including both pegmatitic-pneumatolytic and hydrothermal mineralisations.
Located east of Weitisberga near Wurzbach.
Owned by 'Granitwerk Fischer GmbH & Co. KG'.
Located east of Weitisberga near Wurzbach.
Owned by 'Granitwerk Fischer GmbH & Co. KG'.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
68 valid minerals.
Detailed Mineral List:
| ⓘ Aeschynite-(Ce) Formula: Ce(TiNb)O6 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 |
| ⓘ Berthierine Formula: (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ Covellite Formula: CuS |
| ⓘ Dewindtite Formula: H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O |
| ⓘ Harmotome Formula: Ba2(Si12Al4)O32 · 12H2O |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S References: In Collection of Martin Slamaex Jürgen Graf collection |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Heulandite-Ca Formula: (Ca,Na)5(Si27Al9)O72 · 26H2O |
| ⓘ Hydrocerussite ? Formula: Pb3(CO3)2(OH)2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Laumontite Formula: CaAl2Si4O12 · 4H2O |
| ⓘ 'Limonite' |
| ⓘ Linarite Formula: PbCu(SO4)(OH)2 |
| ⓘ Manjiroite Formula: Na(Mn4+7Mn3+)O16 References: ex-coll. G.Hoffmann (Jena), now Steffen Michalski CollectionIdentification: Dealer/Collection Label, XRD, SEM-EDS |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nacrite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Parsonsite Formula: Pb2(UO2)(PO4)2 |
| ⓘ Phosphuranylite Formula: KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| ⓘ Plumbogummite Formula: PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS References: ex-coll. G.Hoffmann (Jena), now Steffen Michalski CollectionIdentification: Visual Identification, Dealer/Collection Label |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ Ramsdellite Formula: Mn4+O2 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ 'Wolframite Group' |
| ⓘ Wulfenite Formula: Pb(MoO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Ramsdellite | 4.DB.15a | Mn4+O2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Aeschynite-(Ce) | 4.DF.05 | Ce(TiNb)O6 |
| ⓘ | Manjiroite | 4.DK.05a | Na(Mn4+7Mn3+)O16 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Hydrocerussite ? | 5.BE.10 | Pb3(CO3)2(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Linarite | 7.BC.65 | PbCu(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Plumbogummite | 8.BL.10 | PbAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Parsonsite | 8.EA.10 | Pb2(UO2)(PO4)2 |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Dewindtite | 8.EC.10 | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| ⓘ | Phosphuranylite | 8.EC.10 | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Nacrite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Berthierine | 9.ED.15 | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| ⓘ | Laumontite | 9.GB.10 | CaAl2Si4O12 · 4H2O |
| ⓘ | Harmotome | 9.GC.10 | Ba2(Si12Al4)O32 · 12H2O |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Heulandite-Ca | 9.GE.05 | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Dewindtite | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| H | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| H | ⓘ Linarite | PbCu(SO4)(OH)2 |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| H | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Dewindtite | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| O | ⓘ Linarite | PbCu(SO4)(OH)2 |
| O | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| O | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| O | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsdellite | Mn4+O2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Na | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nacrite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Dewindtite | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| P | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| P | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Linarite | PbCu(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Laumontite | CaAl2Si4O12 · 4H2O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ca | ⓘ Heulandite-Ca | (Ca,Na)5(Si27Al9)O72 · 26H2O |
| Ti | Titanium | |
| Ti | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Mn | ⓘ Manjiroite | Na(Mn74+Mn3+)O16 |
| Mn | ⓘ Ramsdellite | Mn4+O2 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierine | (Fe2+,Fe3+,Al)3(Si,Al)2O5(OH)4 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Siderite | FeCO3 |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Nb | Niobium | |
| Nb | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Harmotome | Ba2(Si12Al4)O32 · 12H2O |
| Ce | Cerium | |
| Ce | ⓘ Aeschynite-(Ce) | Ce(TiNb)O6 |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Dewindtite | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hydrocerussite | Pb3(CO3)2(OH)2 |
| Pb | ⓘ Linarite | PbCu(SO4)(OH)2 |
| Pb | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| Pb | ⓘ Plumbogummite | PbAl3(PO4)(PO3OH)(OH)6 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Dewindtite | H2Pb3(UO2)6O4(PO4)4 · 12H2O |
| U | ⓘ Parsonsite | Pb2(UO2)(PO4)2 |
| U | ⓘ Phosphuranylite | KCa(H3O)3(UO2)7(PO4)4O4 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Geochronology
Mineralization age: Carboniferous : 301 Ma to 300 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||
| Paleozoic | ||||||||||
| Carboniferous | ||||||||||
| Pennsylvanian |
| |||||||||
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Henneberg Quarry, Weitisberga, Wurzbach, Saale-Orla District, Thuringia, Germany