Dattaw-taung (Dattaw hill), Mogok Valley, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmari
| Regional Level Types | |
|---|---|
| Dattaw-taung (Dattaw hill) | Hill |
| Mogok Valley | Valley |
| Mogok Township | Township |
| Pyin-Oo-Lwin District | District |
| Mandalay Region | Region |
| Myanmar | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
22° 57' 25'' North , 96° 31' 0'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mogok | 90,843 (2016) | 4.5km |
Other/historical names associated with this locality:
Burma
The foothills of the general mining area at Dattaw are located about 3 km NE of downtown Mogôk in the direction of Momeik. Dattaw is one of the most important areas in Mogôk where a multitude of gems and other minerals are found.
This area is characterized by alluvial, pegmatite, skarn, contact zone, and marble deposits, all integrated into one mass, resulting in a very complicated geology. The rocks of Dattaw are leucogranite, scapolite marble, ruby-bearing marble, diopside marble, apatite-phlogopite-diopside marble, pure marble, graphite marble, graphite-phlogopite marble, phlogopite-forsterite marble, and gneiss. — Ted Themelis (2008) Gems and Mines of Mogok.
Note: The grid reference is centered on the summit of Dattaw Hill.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities19 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | var. Star Ruby | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Danburite | 9.FA.65 | CaB2Si2O8 |
| ⓘ | Sodalite var. Hackmanite | 9.FB.10 | Na8Al6Si6O24Cl2 |
| ⓘ | 9.FB.10 | Na4(Si3Al3)O12Cl | |
| Unclassified | |||
| ⓘ | 'Moonstone' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Danburite | CaB2Si2O8 |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Danburite | CaB2Si2O8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sodalite var. Hackmanite | Na8Al6Si6O24Cl2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Corundum var. Star Ruby | Al2O3 |
| F | Fluorine | |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite var. Hackmanite | Na8Al6Si6O24Cl2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Mg | Magnesium | |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sodalite var. Hackmanite | Na8Al6Si6O24Cl2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Corundum var. Star Ruby | Al2O3 |
| Si | Silicon | |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Danburite | CaB2Si2O8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sodalite var. Hackmanite | Na8Al6Si6O24Cl2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Sodalite var. Hackmanite | Na8Al6Si6O24Cl2 |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Danburite | CaB2Si2O8 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
Localities in this Region
- Mandalay Region
- Pyin-Oo-Lwin District
- Mogok Township
- Mogok Valley
- Dattaw-taung (Dattaw hill)
- Mogok Valley
- Mogok Township
- Pyin-Oo-Lwin District
Other Regions, Features and Areas containing this locality
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
Eurasian PlateTectonic Plate
- Sibumasu TerranePassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Dattaw-taung, Mogok Valley, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmar