Srebrenica, Republika Srpska, Bosnia and Herzegovinai
| Regional Level Types | |
|---|---|
| Srebrenica | Municipality |
| Republika Srpska | Entity |
| Bosnia and Herzegovina | - not defined - |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Srebrenica | 2,862 (2016) |
Other Languages:
Bosnian:
Općina Srebrenica, Republika Srpska, Bosna i Hercegovina
Croatian:
Općina Srebrenica, Republika Srpska, Bosna i Hercegovina
German:
Gemeinde Srebrenica, Republika Srpska, Bosnien und Herzegowina
Russian:
Сребреница , Республика Сербская, Босния и Герцеговина
Serbian:
Општина Сребреница, Република Српска, Босна и Херцеговина
Armenian:
Սրեբրենիցա , Սերբական Հանրապետություն, Բոսնիա և Հերցեգովինա
Bulgarian:
Сребреница, Република Сръбска, Босна и Херцеговина
Polish:
Gmina Srebrenica, Republika Serbska, Bośnia i Hercegowina
Romanian:
Srebrenica, Republika Srpska, Bosnia și Herțegovina
Serbian (Latin Script):
Opština Srebrenica, Republika Srpska, Bosna i Hercegovina
Serbo-Croatian:
Opština Srebrenica, Republika Srpska, Bosna i Hercegovina
Ukrainian:
Сребрениця, Республіка Сербська, Боснія і Герцеговина
Upper Sorbian:
Gmejna Srebrenica, Republika Srpska, Bosniska a Hercegowina
Welsh:
Bwrdeistref Srebrenica, Bosnia a Hercegovina
pneumatolytic-hydrothermal and hydrothermal (from high- to low-temperature) stage.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities66 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Argyrodite | 2.BA.70 | Ag8GeS6 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Ferrokësterite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gudmundite | 2.EB.20 | FeSbS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | 'var. Silver-bearing Tetrahedrite' | 2.GB.05 | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Polybasite | 2.GB.15 | [Ag6Sb2S7][Ag9CuS4] |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Kobellite | 2.HB.10a | Pb22Cu4(Bi,Sb)30S69 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Twinnite | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Semseyite | 2.HC.10d | Pb9Sb8S21 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Fizélyite | 2.JB.40a | Ag5Pb14Sb21S48 |
| ⓘ | Petrukite | 2.KA.05 | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Siderite var. Manganese-bearing Siderite | 5.AB.05 | (Fe,Mn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Goslarite | 7.CB.40 | ZnSO4 · 7H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Ludlamite | 8.CD.20 | Fe2+3(PO4)2 · 4H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Vauxite | 8.DC.35 | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Andorite' | - | AgPbSb3S6 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goslarite | ZnSO4 · 7H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goslarite | ZnSO4 · 7H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| P | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Andorite | AgPbSb3S6 |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Argyrodite | Ag8GeS6 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Ferrokësterite | Cu2FeSnS4 |
| S | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Goslarite | ZnSO4 · 7H2O |
| S | ⓘ Gudmundite | FeSbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Semseyite | Pb9Sb8S21 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Gudmundite | FeSbS |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Ludlamite | Fe32+(PO4)2 · 4H2O |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Vauxite | Fe2+Al2(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Siderite var. Manganese-bearing Siderite | (Fe,Mn)CO3 |
| Fe | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Co | Cobalt | |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Cu | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Cu | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Zn | Zinc | |
| Zn | ⓘ Goslarite | ZnSO4 · 7H2O |
| Zn | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ge | Germanium | |
| Ge | ⓘ Argyrodite | Ag8GeS6 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Andorite | AgPbSb3S6 |
| Ag | ⓘ Argyrodite | Ag8GeS6 |
| Ag | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Ag | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Ag | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Ag | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| In | Indium | |
| In | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Ferrokësterite | Cu2FeSnS4 |
| Sn | ⓘ Petrukite | (Cu,Fe,Zn,Ag)3(Sn,In)S4 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Andorite | AgPbSb3S6 |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Gudmundite | FeSbS |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Polybasite | [Ag6Sb2S7][Ag9CuS4] |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Semseyite | Pb9Sb8S21 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Tetrahedrite Subgroup var. Silver-bearing Tetrahedrite | (Cu,Ag)6[Cu4(Fe,Zn)2]Sb4S13 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Tl | Thallium | |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | Lead | |
| Pb | ⓘ Andorite | AgPbSb3S6 |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Fizélyite | Ag5Pb14Sb21S48 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Semseyite | Pb9Sb8S21 |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Bi | Bismuth | |
| Bi | ⓘ Kobellite | Pb22Cu4(Bi,Sb)30S69 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikidata ID: | Q18361499 |
|---|
Localities in this Region
- Republika Srpska
Other Regions, Features and Areas that Intersect
Croatia
- Dinaric AlpsMountain Range
Eurasian PlateTectonic Plate
- DinaridesAccretionary Complex
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences

Gross Mine, Srebrenica, Republika Srpska, Bosnia and Herzegovina