Bolton, Worcester County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Bolton | Town |
| Worcester County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Bolton | 4,220 (2017) |
Other Languages:
French:
Bolton, comté de Worcester, Massachusetts, États-Unis
German:
Bolton, Worcester County, Massachusetts, Vereinigte Staaten
Italian:
Bolton, contea di Worcester, Massachusetts, Stati Uniti d'America
Spanish:
Bolton, Condado de Worcester, Massachusetts, Estados Unidos
Basque:
Bolton , Worcester konderria, Massachusetts
Catalan:
Bolton, Massachusetts, Estats Units d’Amèrica
Cebuano:
Bolton, Worcester County, Massachusetts
Chechen:
Болтон , Массачусетс, Америкин Цхьаьнатоьхна Штаташ
Dutch:
Bolton, Worcester County, Massachusetts, Verenigde Staten
Farsi/Persian:
بولتون، ماساچوست, شهرستان ووستر، ماساچوست, ماساچوست, ایالات متحده آمریکا
Haitian:
Bolton, Masachosèt, Etazini
Hungarian:
Bolton, Worcester megye, Massachusetts, Amerikai Egyesült Államok
Kazakh (Cyrillic Script):
Болтон, Массачусетс, Америка Құрама Штаттары
Kyrgyz:
Болтон, Массачусетс, Америка Кошмо Штаттары
Polish:
Bolton, Hrabstwo Worcester, Massachusetts, Stany Zjednoczone
Portuguese:
Bolton , Condado de Worcester, Massachusetts, Estados Unidos
South Azerbaijani:
بولتون، ماساچوست, ماساچوست ایالتی, آمریکا بیرلشمیش ایالتلری
Swedish:
Bolton, Worcester County, Massachusetts, USA
Tatar:
Болтон , Массачусетс, Америка Кушма Штатлары
Turkish:
Bolton, Worcester County, Massachusetts, Amerika Birleşik Devletleri
Ukrainian:
Болтон, Вустер, Массачусетс, Сполучені Штати Америки
Volapük:
Bolton, Massachusetts, Lamerikän
Welsh:
Bolton, Massachusetts, Unol Daleithiau America
Bolton was incorporated as a town in 1738.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities42 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Andesine Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Description: "The first discovery of this rare mineral in the United States was by Dr. Jackson, in the limestone at Bolton, Mass., accompanying petalite. It has since been found by Prof. Hitchcock at Athol, Mass., occurring in gneiss. The prisms are rarely two inches long and a quarter of an inch thick, truncated upon the lateral edges, so as in fact to become six-sided prisms; but they present no distinct terminations. The fracture is resinous, and all the external characters of the mineral correspond with Allanite from Greenland."
- William Phillips, Robert Allan, Francis Alger (1844). An Elementary Treatise on Mineralogy, p.418. |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Augite Formula: (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 |
| ⓘ Clinohumite Formula: Mg9(SiO4)4F2 References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite ? Formula: CaF2 |
| ⓘ Formula: (Ca,Y,Ce)F2+x Locality: Bolton Lime Quarries (Bolton Quarry; Whitcomb Quarry; Hildreth Quarry), Bolton, Worcester County, Massachusetts, USA - erroneously reported Description: Properly identified yttrocerite contains some yttria. However, a common practice in the nineteenth century was to call all dark purple fluorite by the name "yttrocerite". No chemical analyses of this mineral are known from Bolton and it is uncertain if it were found in the marble or in pegmatite float boulders and the name seems to be incorrectly used. |
| ⓘ Forsterite Formula: Mg2(SiO4) Description: Boltonite was once thought to be a new mineral but it was later proven to be forsterite. Hitchock (1835), p.309: "At Bolton, also, a new mineral has been discovered, which Dr. Thomson has denominated from its chemical composition, Bilsilicate of Magnesia; and Mr. Shephard, with reference to its locality, calls it Boltonite. It occurs in foliated masses in the limestone." |
| ⓘ 'Gadolinite' ? Localities: Description: Gadolinite is a mineral characteristic of rare-earth rich granite pegmatites or alpine veins. No data have been published on the identification and efforts to locate any example, verified or not have been fruitless. The mineral may have been found in erratic pegmatite boulders, but certainly not in the marble. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Graphite Formula: C |
| ⓘ Grossular ? Formula: Ca3Al2(SiO4)3 |
| ⓘ 'Lepidolite' ? |
| ⓘ Magnesio-hornblende Formula: ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 Habit: crystals Colour: brown References: |
| ⓘ Magnesite Formula: MgCO3 Habit: Dana (1854), p. 441: "indistinctly fibrous masses, traversing the limestone." References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Meionite Formula: Ca4Al6Si6O24CO3 References: Sherriff, B. L.; Sokolova, E. V.; Kabalov, Y. K.; Jenkins, D. M.; Kunath-Fandrei, G.; Goetz, S.; Jager, C.; Schneider, J. (2000) Meionite: Rietveld structure-refinement 29Si MAS and 27Al SATRAS NMR spectroscopy, and comments on the marialite-meionite series. The Canadian Mineralogist, 38 (5). 1201-1213 doi:10.2113/gscanmin.38.5.1201 |
| ⓘ Meionite var. Nuttallite Formula: Ca4Al6Si6O24CO3 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Opal Formula: SiO2 · nH2O Habit: coatings |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Habit: coatings |
| ⓘ Pargasite Formula: NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ Petalite Formula: LiAl(Si4O10) Localities: Fluorescence: blue Description: Palache (1923) says that it is probable that the petalite reported by Dana was found in an erratic boulder, and not the quarry proper. Petalite was commonly reported in New England in the nineteenth century and into the twentieth. An unverified petalite specimen from this locality (YPM 6887) is in the Yale Peabody Museum. This locality is an unbelievable report from a marble! See Bolton Pegmatite Float Boulder Occurrence.
Records for Yale Peabody Museum specimen YPM MIN026887 only specify Bolton, Mass. for the locality; no reference is made to "Bolton Limestone quarry." The specimen is labeled as an A. E. Foote specimen, and was donated to the museum in 1957. |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Habit: small prisms Description: Dana, J. D. (1839): " The scapolite...contains, also, exceedingly minute zircons, scarcely 1/40 inch long, and also very small prisms of rutile." |
| ⓘ 'Scapolite' Fluorescence: Magenta-pink-fluorescing Description: "C.T. Jackson found 1.58 pr. cnt. lithia and 2 pr. cnt. oxides of cerium and lanthanum in the pink skapolite [sic], from Bolton, Massachusetts; but C. Hartshorne found neiher of these constituents in that mineral from the same locality." -- Booth, James C. (1862). The Enclopedia of Chemistry, Practical and Theoretical, 2nd ed. |
| ⓘ 'Scapolite var. Wernerite' Fluorescence: pink Description: A "pink cut stone, one polished specimen" listed in Kunz (1889). |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ 'Serpentine Subgroup' Formula: D3[Si2O5](OH)4 |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 Fluorescence: yellowish-fluorescing talc |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O Habit: micaceous Colour: gray Description: Originally and informally introduced as a new mineral name later identified as vermiculite-related phyllosilicate. See Clark (1993), Hey's Mineral Index, third edition, p. 92. |
| ⓘ Zircon Formula: Zr(SiO4) Habit: Dana, J. D. (1839): The zircons are square prisms, having the lateral edges truncated, and pyramidally terminated at each extremity..." Description: Dana, J. D. (1839): " The scapolite...contains, also, exceedingly minute zircons, scarcely 1/40 inch long, and also very small prisms of rutile." |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite ? | 3.AB.25 | CaF2 |
| ⓘ | var. Yttrocerite ? | 3.AB.25 | (Ca,Y,Ce)F2+x |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2(SiO4) |
| ⓘ | Grossular ? | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Clinohumite | 9.AF.55 | Mg9(SiO4)4F2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Augite | 9.DA.15 | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Pargasite | 9.DE.15 | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Petalite | 9.EF.05 | LiAl(Si4O10) |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Andesine | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | Meionite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| ⓘ | var. Nuttallite | 9.FB.15 | Ca4Al6Si6O24CO3 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Lepidolite' ? | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Scapolite var. Wernerite' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Gadolinite' ? | - | |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Petalite | LiAl(Si4O10) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| C | ⓘ Scapolite var. Wernerite | |
| C | ⓘ Meionite var. Nuttallite | Ca4Al6Si6O24CO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Forsterite | Mg2(SiO4) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| O | ⓘ Petalite | LiAl(Si4O10) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Scapolite var. Wernerite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Meionite var. Nuttallite | Ca4Al6Si6O24CO3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Fluorite var. Yttrocerite | (Ca,Y,Ce)F2+x |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Scapolite var. Wernerite | |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Forsterite | Mg2(SiO4) |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Al | ⓘ Petalite | LiAl(Si4O10) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Scapolite var. Wernerite | |
| Al | ⓘ Meionite var. Nuttallite | Ca4Al6Si6O24CO3 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Clinohumite | Mg9(SiO4)4F2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Forsterite | Mg2(SiO4) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Si | ⓘ Petalite | LiAl(Si4O10) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Scapolite var. Wernerite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Meionite var. Nuttallite | Ca4Al6Si6O24CO3 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Scapolite var. Wernerite | |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Albite var. Andesine | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Meionite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Pargasite | NaCa2(Mg4Al)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Scapolite var. Wernerite | |
| Ca | ⓘ Fluorite var. Yttrocerite | (Ca,Y,Ce)F2+x |
| Ca | ⓘ Meionite var. Nuttallite | Ca4Al6Si6O24CO3 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Augite | (CaxMgyFez)(Mgy1Fez1)Si2O6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Fluorite var. Yttrocerite | (Ca,Y,Ce)F2+x |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Fluorite var. Yttrocerite | (Ca,Y,Ce)F2+x |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Bolton,_Massachusetts |
|---|---|
| Wikidata ID: | Q2560271 |
| GeoNames ID: | 4930907 |
Localities in this Region
- Massachusetts
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions




Bolton Lime Quarries, Bolton, Worcester County, Massachusetts, USA