Betts Manganese Mines, Plainfield, Hampshire County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Betts Manganese Mines | Mine (Flooded) |
| Plainfield | Town |
| Hampshire County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 29' 45'' North , 72° 56' 46'' West
Latitude & Longitude (decimal):
Type:
Mine (Flooded) - last checked 2025
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Cummington | 995 (2017) | 5.7km |
| Windsor | 890 (2017) | 9.3km |
| Hawley | 342 (2017) | 9.4km |
| Savoy | 717 (2017) | 10.4km |
| Peru | 835 (2017) | 10.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Northern Berkshire Mineral Club | North Adams, Massachusetts | 26km |
Other/historical names associated with this locality:
Anson Betts Mine; Plainfield Manganese Mines; Taconic Manganese Mines
According to Jordan et al (2019):
The Betts mine is often erroneously listed as being in either Cummington or West Cummington.
The deposit was said by Emerson (1898) to have been worked extensively in 1848 before being abandoned due to the "California gold excitement." The mine was acquired in 1925 by the metallurgist and inventor, Anson Gardner Betts (b. 1876, Lansingburgh, NY; d. 1976), who operated it under the name Taconic Manganese Mines. The most active mining period was 1939-1942 (Quinn, 1945). His son Anson Ketchum Betts (b. 1924, Kinderhook NY; d. 2013) also worked for the family mining business.
The mine and tailings are now under the ownership of EarthDance. As of 2025, the daily cost of mining there was $20 per person and only one 5-gallon bucket of material may be removed per trip/day. Info is available here: https://www.earthdance.net/mineral-collecting/
The Betts mine is divided into several sections with slightly different minerals.
The former Betts Mine is in the Hawley Formation, a sequence of lower Paleozoic units on the eastern flank of the Berkshire Mountains. The Hawley formation consists of deformed and polymetamorphosed shale, graywacke and volcanic rocks (Hickmott 1982; Hickmott et al. 1983). The Betts Mine occurred within a carbonaceous metasedimentary unit of the Hawley formation, consisting of quartz–muscovite–biotite–garnet–chlorite phyllite and fine-grained quartzite interbedded with feldspathic schist and bands of amphibolite.
The Betts mine is often erroneously listed as being in either Cummington or West Cummington.
The deposit was said by Emerson (1898) to have been worked extensively in 1848 before being abandoned due to the "California gold excitement." The mine was acquired in 1925 by the metallurgist and inventor, Anson Gardner Betts (b. 1876, Lansingburgh, NY; d. 1976), who operated it under the name Taconic Manganese Mines. The most active mining period was 1939-1942 (Quinn, 1945). His son Anson Ketchum Betts (b. 1924, Kinderhook NY; d. 2013) also worked for the family mining business.
The mine and tailings are now under the ownership of EarthDance. As of 2025, the daily cost of mining there was $20 per person and only one 5-gallon bucket of material may be removed per trip/day. Info is available here: https://www.earthdance.net/mineral-collecting/
The Betts mine is divided into several sections with slightly different minerals.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
52 valid minerals.
Detailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Alabandite Formula: MnS |
| ⓘ Alleghanyite Formula: Mn2+5(SiO4)2(OH)2 |
| ✪ 'Almandine-Spessartine Series' Habit: trapezohedral Colour: burgundy to orange-brown Description: Probably the best "species" to list most crystals under that have not been analyzed as they cannot be reliably differentiated visually. References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Bafertisite Formula: Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 Description: No data in the source reference. Is there a reference that proves this species? |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bementite Formula: Mn7Si6O15(OH)8 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Birnessite ? Formula: (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O Description: Kim (1991) re-investigated a mineral originally described as birnessite by Frondel et. al (1960) and determined it to be takaelite.
Ref.: Kim, Soo Jin (1991). New characterization of takanelite (American Mineralogist, Volume 76, pages 1426-1430) |
| ⓘ Calcite Formula: CaCO3 Description: https://worcestermineralclub.org/wp-content/uploads/2022/10/A-Guide-to-the-Betts-Manganese-Mine.pdf |
| ⓘ Caryopilite Formula: Mn2+3Si2O5(OH)4 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chloritoid ? Formula: Fe2+Al2O(SiO4)(OH)2 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ✪ Ferro-hornblende Formula: ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 Habit: radiating, bladed aggregates Colour: black Fluorescence: none Description: radiating, bladed aggregates reaching over 5 cm |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Grunerite Formula: ◻Fe2+2Fe2+5(Si8O22)(OH)2 References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jacobsite Formula: Mn2+Fe3+2O4 |
| ⓘ Kutnohorite Formula: CaMn2+(CO3)2 |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au Description: No specifics in reference. Is the gold from nearby alluvium? |
| ⓘ Native Silver Formula: Ag |
| ⓘ Neotocite Formula: (Mn,Fe)SiO3 · H2O (?) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ 'Psilomelane' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrolusite Formula: Mn4+O2 |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Ranciéite Formula: (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ✪ Rhodonite Formula: CaMn3Mn[Si5O15] Habit: Massive Colour: Pink Description: Frequently found on the dumps as rocks with a black coating of manganese oxide and pink rhodonite on the inside, mainly found by digging in holes. |
| ⓘ Rutile Formula: TiO2 Description: Rutile from the Betts mine is found as small, black, straited crystals found with garnet. |
| ⓘ Schallerite Formula: Mn2+16As3Si12O36(OH)17 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Sonolite Formula: Mn2+9(SiO4)4(OH)2 |
| ✪ Spessartine Formula: Mn2+3Al2(SiO4)3 Description: Sesspartine usually found as small, gemmy red to orange crystals around 1-2 mm small. Frequently associated with quartz and rutile. |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Takanelite Formula: (Mn,Ca)Mn4O9 · H2O |
| ⓘ Tephroite Formula: Mn2+2(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Alabandite | 2.CD.10 | MnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Jacobsite | 4.BB.05 | Mn2+Fe3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Ranciéite | 4.FL.40 | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| ⓘ | Takanelite | 4.FL.40 | (Mn,Ca)Mn4O9 · H2O |
| ⓘ | Birnessite ? | 4.FL.45 | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Kutnohorite | 5.AB.10 | CaMn2+(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Tephroite | 9.AC.05 | Mn2+2(SiO4) |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Alleghanyite | 9.AF.45 | Mn2+5(SiO4)2(OH)2 |
| ⓘ | Sonolite | 9.AF.55 | Mn2+9(SiO4)4(OH)2 |
| ⓘ | Chloritoid ? | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Bafertisite | 9.BE.55 | Ba2Fe2+4Ti2(Si2O7)2O2(OH)2F2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Grunerite | 9.DE.05 | ◻Fe2+2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Caryopilite | 9.ED.15 | Mn2+3Si2O5(OH)4 |
| ⓘ | Neotocite | 9.ED.20 | (Mn,Fe)SiO3 · H2O (?) |
| ⓘ | Bementite | 9.EE.05 | Mn7Si6O15(OH)8 |
| ⓘ | Schallerite | 9.EE.15 | Mn2+16As3Si12O36(OH)17 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| H | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| H | ⓘ Bementite | Mn7Si6O15(OH)8 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| H | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| H | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| H | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| H | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| H | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| O | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bementite | Mn7Si6O15(OH)8 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jacobsite | Mn2+Fe23+O4 |
| O | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| O | ⓘ Tephroite | Mn22+(SiO4) |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| F | Fluorine | |
| F | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Almandine-Spessartine Series | |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Si | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Si | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Si | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Tephroite | Mn22+(SiO4) |
| Si | ⓘ Almandine-Spessartine Series | |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Alabandite | MnS |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Ca | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ti | Titanium | |
| Ti | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Alabandite | MnS |
| Mn | ⓘ Alleghanyite | Mn52+(SiO4)2(OH)2 |
| Mn | ⓘ Bementite | Mn7Si6O15(OH)8 |
| Mn | ⓘ Birnessite | (Na,Ca)0.5(Mn4+,Mn3+)2O4 · 1.5H2O |
| Mn | ⓘ Caryopilite | Mn32+Si2O5(OH)4 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Mn | ⓘ Kutnohorite | CaMn2+(CO3)2 |
| Mn | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Ranciéite | (Ca,Mn2+)0.2(Mn4+,Mn3+)O2 · 0.6H2O |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Mn | ⓘ Sonolite | Mn92+(SiO4)4(OH)2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Takanelite | (Mn,Ca)Mn4O9 · H2O |
| Mn | ⓘ Tephroite | Mn22+(SiO4) |
| Mn | ⓘ Almandine-Spessartine Series | |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Grunerite | ◻Fe22+Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jacobsite | Mn2+Fe23+O4 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Neotocite | (Mn,Fe)SiO3 · H2O (?) |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Almandine-Spessartine Series | |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Schallerite | Mn162+As3Si12O36(OH)17 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Ba | Barium | |
| Ba | ⓘ Bafertisite | Ba2Fe42+Ti2(Si2O7)2O2(OH)2F2 |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Piedmontia DomainDomain
- Taconic ArcVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.






Betts Manganese Mines, Plainfield, Hampshire County, Massachusetts, USA