Kunar, Afghanistani
| Regional Level Types | |
|---|---|
| Kunar | Province |
| Afghanistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Konar; Konarh; Konarha
Other Languages:
Farsi/Persian:
ولایت کنر, افغانستان
French:
Kounar, Afghanistan
German:
Kunar, Afghanistan
Italian:
Konar, Afghanistan
Pashto:
کونړ ولايت, افغانستان
Russian:
Кунар, Афганистан
Simplified Chinese:
库纳尔省, 阿富汗
Spanish:
Provincia de Kunar, Afganistán
Arabic:
ولاية كنر, أفغانستان
Asturian:
Kunar, Afganistán
Azeri:
Künər vilayəti, Əfqanıstan
Basque:
Kunar probintzia, Afganistan
Belarusian:
Кунар, Афганістан
Belarusian (Tarashkevitsa):
Кунар, Аўганістан
Bengali:
কুনার প্রদেশ, আফগানিস্তান
Bulgarian:
Конар, Афганистан
Catalan:
Província de Kunar, Afganistan
Cebuano:
Wilāyat-e Kunaṟ, Apganistan
Central Kurdish/Sorani:
پارێزگای کونەر, ئەفغانستان
Czech:
Kúnar, Afghánistán
Danish:
Konar, Afghanistan
Dutch:
Kunar, Afghanistan
Esperanto:
Provinco Kunar, Afganio
Estonian:
Konarhā provints, Afganistan
Finnish:
Konarin maakunta, Afganistan
Georgian:
ქუნარის პროვინცია, ავღანეთი
Greek:
Κουνάρ, Αφγανιστάν
Gujarati:
કુનાર, અફઘાનિસ્તાન
Hindi:
कुनर प्रान्त, अफ़ग़ानिस्तान
Indonesian:
Provinsi Kunar, Afganistan
Japanese:
クナル州, アフガニスタン
Kannada:
ಕುನಾರ್, ಅಫ್ಘಾನಿಸ್ತಾನ
Korean:
쿠나르 주, 아프가니스탄
Latvian:
Kunāra, Afganistāna
Lithuanian:
Kunaro provincija, Afganistanas
Luri:
آستوٙن کونأر, ٱفغانستان
Malay:
Wilayah Kunar, Afghanistan
Marathi:
कुनार, अफगाणिस्तान
Minnan / Hokkien-Taiwanese:
Kunar Séng, Afghanistan
Mongolian:
Кунар аймаг, Афганистан
Newar / Nepal Bhasa:
कोनर प्रान्त, अफगानिस्तान
Norwegian:
Konar, Afghanistan
Polish:
Kunar, Afganistan
Portuguese:
Kunar, Afeganistão
Punjabi:
ਕੁਨਰ ਸੂਬਾ, ਅਫ਼ਗ਼ਾਨਿਸਤਾਨ
Romanian:
Provincia Kunar, Afganistan
Scots:
Kunar Province, Afghanistan
Serbian:
Провинција Кунар, Авганистан
Serbo-Croatian:
Kunarska pokrajina, Afganistan
Sinhalese:
කුනාර්, ඇෆ්ගනිස්ථානය
South Azerbaijani:
کنر ویلایت, افغانیستان
Sundanese:
Propinsi Kunar, Apganistan
Swedish:
Konar, Afghanistan
Tagalog:
Lalawigan ng Kunar, Afghanistan
Tajik (Cyrillic Script):
Вилояти Кунар, Афғонистон
Tamil:
குனர் மாகாணம், ஆப்கானித்தான்
Telugu:
కునార్, ఆఫ్ఘనిస్తాన్
Thai:
จังหวัดโกนาร์, ประเทศอัฟกานิสถาน
Traditional Chinese:
庫納爾省, 阿富汗
Turkish:
Kunar, Afganistan
Ukrainian:
Кунар, Афганістан
Urdu:
صوبہ کنڑ, افغانستان
Uyghur:
كۇنار ۋىلايىتى, ئافغانىستان
Vietnamese:
Kunar, Afghanistan
Waray:
Kunar, Afganistan
Western Punjabi:
صوبہ کنڑ, افغانستان
Zazaki:
Kıner, Efğanıstan
NOTE: Nuristan province sensu stricto (http://www.mindat.org/loc-135473.html) became officially recognised in 2001 (Wikipedia) or 2004 (statoids.com), but was already known for 10 years. It was formed from the northern parts of Laghman Province and Konar (Kunar) Province.
Note, however, that "Nuristan" is also the traditional name for the region that encompasses these three current provinces (i.e., NE Afghanistan) and the name is still often used in that fashion.
Konar Province covers most of the Afghan part of the Konar valley, and most of the valleys of its confluences. Only a small part of the lower valley, a few kilometers upstream of its confluence with the Kabul river near Jalalabad, belongs to Nangarhar Province. Depending on which confluences are considered an integral part of the valley, the area referred to as "Konar Valley" may cover anything between about two thirds and all of Konar Province, making it not only a rather vague but also an ill-defined locality description. Therefore, photos of specimens labelled as coming from Konar Valley should be placed under Konar Province.
Note, however, that "Nuristan" is also the traditional name for the region that encompasses these three current provinces (i.e., NE Afghanistan) and the name is still often used in that fashion.
Konar Province covers most of the Afghan part of the Konar valley, and most of the valleys of its confluences. Only a small part of the lower valley, a few kilometers upstream of its confluence with the Kabul river near Jalalabad, belongs to Nangarhar Province. Depending on which confluences are considered an integral part of the valley, the area referred to as "Konar Valley" may cover anything between about two thirds and all of Konar Province, making it not only a rather vague but also an ill-defined locality description. Therefore, photos of specimens labelled as coming from Konar Valley should be placed under Konar Province.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities37 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Localities: Reported from at least 8 localities in this region. |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 References: |
| ⓘ Bavenite Formula: Ca4Be2Al2Si9O26(OH)2 References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Reported from at least 11 localities in this region. |
| ⓘ Beryl var. Aquamarine |
| ⓘ Beryl var. Emerald Formula: Be3Al2(Si6O18) |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) References: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) References: |
| ⓘ Beryl var. Morganite Formula: Be3Al2(Si6O18) |
| ⓘ Beryllonite Formula: NaBePO4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Chloritoid Formula: Fe2+Al2O(SiO4)(OH)2 Description: Microprobed fragment: (Fe2+1.55Mg0.43Mn0.02)Σ=2(Al3.93Fe3+0.07)Σ=4Si2.00O10(OH)4 |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 References: |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 References: |
| ⓘ 'Columbite-Tantalite' Localities: Chawkay pegmatite field, Chawkay District, Kunar, Afghanistan Dara-e-Pech pegmatite field, Dara-e-Pech District, Kunar, Afghanistan Ghursalak Mine, Chapa Dara District, Kunar, Afghanistan Vora Desh, Dara-e-Pech pegmatite field, Dara-e-Pech District, Kunar, Afghanistan Gursaisk pegmatite, Dara-e-Pech pegmatite field, Dara-e-Pech District, Kunar, Afghanistan |
| ⓘ Diopside Formula: CaMgSi2O6 References: |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Description: The RI values were 1.631–1.633 for a birefringence (Δn) of 0.002. When viewed using a dichroscope, the purple samples showed weak–moderate pleochroism from pastel to light pinkish purple. All of the samples reacted to the long-wave UV light with a moderate pinkish purple fluorescence reaction and were inert to short-wave UV. |
| ⓘ Fluornatromicrolite Formula: (Na1.5Bi0.5)Ta2O6F |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Grossular var. Tsavorite Formula: Ca3Al2(SiO4)3 Localities: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hydroxylherderite Formula: CaBe(PO4)(OH) References: |
| ⓘ Ishikawaite Formula: U4+Fe2+Nb2O8 |
| ⓘ 'Lepidolite' |
| ⓘ 'Limonite' References: |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Pezzottaite-(Cs) Formula: Cs(Be2Li)Al2(Si6O18) References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 References: |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ 'Scapolite' References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Spodumene Formula: LiAlSi2O6 Localities: Reported from at least 8 localities in this region. |
| ⓘ Spodumene var. Kunzite Formula: LiAlSi2O6 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 |
| ⓘ Tantalowodginite Formula: (Mn2+0.5◻0.5)TaTa2O8 References: MIM Museum collectionIdentified by Kevin Conroy: Visual Identification |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'Tourmaline var. Achroite' References: |
| ⓘ 'Tourmaline var. Indicolite' |
| ⓘ 'Tourmaline var. Rubellite' |
| ⓘ Tungstibite Formula: Sb3+2WO6 |
| ⓘ Viitaniemiite Formula: Na(Ca,Mn2+)Al(PO4)(F,OH)3 References: |
| ⓘ Wodginite Formula: Mn2+Sn4+Ta2O8 References: MIM Museum collectionIdentification: Dealer/Collection Label |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Ishikawaite | 4.DB.25 | U4+Fe2+Nb2O8 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Wodginite | 4.DB.40 | Mn2+Sn4+Ta2O8 |
| ⓘ | Tantalowodginite | 4.DB.40 | (Mn2+0.5◻0.5)TaTa2O8 |
| ⓘ | Tungstibite | 4.DE.15 | Sb3+2WO6 |
| ⓘ | Fluornatromicrolite | 4.DH.15 | (Na1.5Bi0.5)Ta2O6F |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beryllonite | 8.AA.10 | NaBePO4 |
| ⓘ | Hydroxylherderite | 8.BA.10 | CaBe(PO4)(OH) |
| ⓘ | Viitaniemiite | 8.BL.15 | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Grossular var. Tsavorite | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Chloritoid | 9.AF.85 | Fe2+Al2O(SiO4)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Emerald | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Pezzottaite-(Cs) | 9.CJ.60 | Cs(Be2Li)Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Spodumene var. Kunzite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | 9.DA.30 | LiAlSi2O6 | |
| ⓘ | Bavenite | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Tourmaline var. Achroite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Tourmaline var. Indicolite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline var. Rubellite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Be | Beryllium | |
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Be | ⓘ Beryllonite | NaBePO4 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Be | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Be | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Tourmaline var. Achroite | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Indicolite | |
| B | ⓘ Tourmaline var. Rubellite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Tourmaline var. Achroite | |
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| O | ⓘ Beryllonite | NaBePO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| O | ⓘ Tourmaline var. Indicolite | |
| O | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| O | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tungstibite | Sb23+WO6 |
| O | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| O | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| O | ⓘ Tantalowodginite | (Mn2+0.5◻0.5)TaTa2O8 |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Grossular var. Tsavorite | Ca3Al2(SiO4)3 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| F | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Beryllonite | NaBePO4 |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Na | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Grossular var. Tsavorite | Ca3Al2(SiO4)3 |
| Al | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Beryl var. Emerald | Be3Al2(Si6O18) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Grossular var. Tsavorite | Ca3Al2(SiO4)3 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Beryllonite | NaBePO4 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| P | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Hydroxylherderite | CaBe(PO4)(OH) |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Ca | ⓘ Grossular var. Tsavorite | Ca3Al2(SiO4)3 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Viitaniemiite | Na(Ca,Mn2+)Al(PO4)(F,OH)3 |
| Mn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Mn | ⓘ Tantalowodginite | (Mn2+0.5◻0.5)TaTa2O8 |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chloritoid | Fe2+Al2O(SiO4)(OH)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Sb | Antimony | |
| Sb | ⓘ Tungstibite | Sb23+WO6 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Cs | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Wodginite | Mn2+Sn4+Ta2O8 |
| Ta | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| Ta | ⓘ Tantalowodginite | (Mn2+0.5◻0.5)TaTa2O8 |
| W | Tungsten | |
| W | ⓘ Tungstibite | Sb23+WO6 |
| Bi | Bismuth | |
| Bi | ⓘ Fluornatromicrolite | (Na1.5Bi0.5)Ta2O6F |
| U | Uranium | |
| U | ⓘ Ishikawaite | U4+Fe2+Nb2O8 |
Fossils
There are 1 fossil locality from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 1 |
|---|---|
| Youngest Fossil Listed | 331 Ma (Carboniferous) |
| Oldest Fossil Listed | 347 Ma (Carboniferous) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Kunar_Province |
|---|---|
| Wikidata ID: | Q188147 |
| GeoNames ID: | 1135702 |
Localities in this Region
- Kunar
Other Regions, Features and Areas that Intersect
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
- Tibetan PlateauPlateau
Eurasian PlateTectonic Plate
- Kohistan ArcVolcanic Arc
- Lhasa
- Karakoram ProvinceVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Dara-e-Pech pegmatite field, Dara-e-Pech District, Kunar, Afghanistan