Shizhuang Village, Tangdan Town, Dongchuan District, Kunming, Yunnan, Chinai
| Regional Level Types | |
|---|---|
| Shizhuang Village | Village |
| Tangdan Town | Town |
| Dongchuan District | District |
| Kunming | Prefecture-level City |
| Yunnan | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Other Languages:
Simplified Chinese:
石庄村 汤丹镇 东川区 昆明市 云南省 中国, 汤丹镇 东川区 昆明市 云南省 中国, 东川区, 昆明市, 云南省, 中国
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities46 valid minerals. 5 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) References: |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 References: |
| ⓘ Argentotetrahedrite-(Zn) Formula: Ag6(Cu4Zn2)Sb4S12S References: |
| ⓘ Arsendescloizite Formula: PbZn(AsO4)(OH) |
| ⓘ Arsenoveszelyite (TL) Formula: Cu2Zn(AsO4)(OH)3 · 2H2O Type Locality: |
| ⓘ Aurichalcite Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Bayldonite Formula: PbCu3(AsO4)2(OH)2 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 References: |
| ⓘ Calcite Formula: CaCO3 References: Daniel Hummer CollectionIdentified by Daniel Hummer: XRD |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O References: |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Cornubite Formula: Cu5(AsO4)2(OH)4 References: |
| ⓘ Covellite Formula: CuS References: |
| ⓘ Cuprodongchuanite (TL) Formula: Pb4CuZn2(PO4)4(OH)2 Localities: |
| ⓘ Cuprozheshengite (TL) Formula: Pb4CuZn2(AsO4)2(PO4)2(OH)2 Type Locality: |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Dongchuanite (TL) Formula: Pb4ZnZn2(PO4)4(OH)2 Localities: |
| ⓘ 'Dongchuanite Group' Formula: A4 ⅥBⅣB2[(T1)O4]2[(T2)O4]2Y2 |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Evansite Formula: Al3(PO4)(OH)6 · 6H2O References: |
| ⓘ Galena Formula: PbS |
| ⓘ Goldhillite Formula: Cu5Zn(AsO4)2(OH)6 · H2O References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O References: |
| ⓘ Hematite Formula: Fe2O3 References: Daniel Hummer CollectionIdentified by Daniel Hummer: XRD |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Kipushite Formula: (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 References: |
| ⓘ Philipsburgite Formula: Cu5Zn(AsO4)(PO4)(OH)6 · H2O References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ 'Pyrobitumen' References: |
| ⓘ 'Pyrobitumen var. Shungite (1)' References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: Daniel Hummer CollectionIdentified by Daniel Hummer: XRD |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Scholzite Formula: CaZn2(PO4)2 · 2H2O References: |
| ⓘ Smithsonite Formula: ZnCO3 References: |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tangdanite Formula: Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S |
| ⓘ Tetrahedrite-(Zn) Formula: Cu6(Cu4Zn2)Sb4S12S References: |
| ⓘ Theisite Formula: Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ Tsumebite Formula: Pb2Cu(PO4)(SO4)(OH) References: |
| ⓘ Tyrolite Formula: Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ Veszelyite Formula: (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ Zheshengite (TL) Formula: Pb4ZnZn2(AsO4)2(PO4)2(OH)2 Type Locality: |
| ⓘ Ziesite Formula: β-Cu2(V2O7) References: Daniel Hummer CollectionIdentified by Daniel Hummer: XRD |
| ⓘ Zincolibethenite Formula: CuZn(PO4)(OH) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Argentotetrahedrite-(Zn) | 2.GB. | Ag6(Cu4Zn2)Sb4S12S |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Tetrahedrite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Aurichalcite | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Zincolibethenite | 8.BB.30 | CuZn(PO4)(OH) |
| ⓘ | Cornubite | 8.BD.30 | Cu5(AsO4)2(OH)4 |
| ⓘ | Theisite | 8.BE.75 | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| ⓘ | Dongchuanite (TL) | 8.BG. | Pb4ZnZn2(PO4)4(OH)2 |
| ⓘ | Cuprodongchuanite (TL) | 8.BG. | Pb4CuZn2(PO4)4(OH)2 |
| ⓘ | Tsumebite | 8.BG.05 | Pb2Cu(PO4)(SO4)(OH) |
| ⓘ | Cuprozheshengite (TL) | 8.BH. | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| ⓘ | Zheshengite (TL) | 8.BH. | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| ⓘ | Arsendescloizite | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Bayldonite | 8.BH.45 | PbCu3(AsO4)2(OH)2 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Scholzite | 8.CA.45 | CaZn2(PO4)2 · 2H2O |
| ⓘ | Kipushite | 8.DE. | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| ⓘ | Goldhillite | 8.DE. | Cu5Zn(AsO4)2(OH)6 · H2O |
| ⓘ | Arsenoveszelyite (TL) | 8.DE. | Cu2Zn(AsO4)(OH)3 · 2H2O |
| ⓘ | Veszelyite | 8.DE.30 | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| ⓘ | Philipsburgite | 8.DE.35 | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| ⓘ | Evansite | 8.DF.10 | Al3(PO4)(OH)6 · 6H2O |
| ⓘ | Tyrolite | 8.DM.10 | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| ⓘ | Tangdanite | 8.DM.10 | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| ⓘ | Ziesite | 8.FA.10 | β-Cu2(V2O7) |
| Group 9 - Silicates | |||
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Pyrobitumen var. Shungite (1)' | - | |
| ⓘ | '' | - | |
| ⓘ | 'Dongchuanite Group' | - | A4 ⅥBⅣB2[(T1)O4]2[(T2)O4]2Y2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| H | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| H | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| H | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| H | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| H | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| H | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| H | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| H | ⓘ Goldhillite | Cu5Zn(AsO4)2(OH)6 · H2O |
| H | ⓘ Dongchuanite | Pb4ZnZn2(PO4)4(OH)2 |
| H | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| H | ⓘ Arsenoveszelyite | Cu2Zn(AsO4)(OH)3 · 2H2O |
| H | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| H | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| C | Carbon | |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| C | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| O | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| O | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| O | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| O | ⓘ Ziesite | β-Cu2(V2O7) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| O | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| O | ⓘ Goldhillite | Cu5Zn(AsO4)2(OH)6 · H2O |
| O | ⓘ Dongchuanite | Pb4ZnZn2(PO4)4(OH)2 |
| O | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| O | ⓘ Arsenoveszelyite | Cu2Zn(AsO4)(OH)3 · 2H2O |
| O | ⓘ Dongchuanite Group | A4 ⅥBⅣB2[(T1)O4]2[(T2)O4]2Y2 |
| O | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| O | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Evansite | Al3(PO4)(OH)6 · 6H2O |
| P | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| P | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| P | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| P | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| P | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| P | ⓘ Dongchuanite | Pb4ZnZn2(PO4)4(OH)2 |
| P | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| P | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| P | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| S | Sulfur | |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| S | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| S | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| S | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| Ca | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ca | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| V | Vanadium | |
| V | ⓘ Ziesite | β-Cu2(V2O7) |
| Fe | Iron | |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Cu | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Cu | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Cu | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| Cu | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Cu | ⓘ Ziesite | β-Cu2(V2O7) |
| Cu | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| Cu | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Cu | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Cu | ⓘ Goldhillite | Cu5Zn(AsO4)2(OH)6 · H2O |
| Cu | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| Cu | ⓘ Arsenoveszelyite | Cu2Zn(AsO4)(OH)3 · 2H2O |
| Cu | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Kipushite | (Cu,Zn)5Zn(PO4)2(OH)6 · H2O |
| Zn | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| Zn | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Zn | ⓘ Veszelyite | (Cu,Zn)2Zn(PO4)(OH)3 · 2H2O |
| Zn | ⓘ Zincolibethenite | CuZn(PO4)(OH) |
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| Zn | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Zn | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Zn | ⓘ Goldhillite | Cu5Zn(AsO4)2(OH)6 · H2O |
| Zn | ⓘ Dongchuanite | Pb4ZnZn2(PO4)4(OH)2 |
| Zn | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| Zn | ⓘ Arsenoveszelyite | Cu2Zn(AsO4)(OH)3 · 2H2O |
| Zn | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Zn | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| As | Arsenic | |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| As | ⓘ Cornubite | Cu5(AsO4)2(OH)4 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Philipsburgite | Cu5Zn(AsO4)(PO4)(OH)6 · H2O |
| As | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| As | ⓘ Tyrolite | Ca2Cu9(AsO4)4(CO3)(OH)8 · 11H2O |
| As | ⓘ Tangdanite | Ca2Cu9(AsO4)4(SO4)0.5(OH)9 · 9H2O |
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
| As | ⓘ Goldhillite | Cu5Zn(AsO4)2(OH)6 · H2O |
| As | ⓘ Arsenoveszelyite | Cu2Zn(AsO4)(OH)3 · 2H2O |
| As | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| As | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
| Ag | Silver | |
| Ag | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Sb | Antimony | |
| Sb | ⓘ Theisite | Cu5Zn5(AsO4,SbO4)2(OH)14 |
| Sb | ⓘ Tetrahedrite-(Zn) | Cu6(Cu4Zn2)Sb4S12S |
| Sb | ⓘ Argentotetrahedrite-(Zn) | Ag6(Cu4Zn2)Sb4S12S |
| Pb | Lead | |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Bayldonite | PbCu3(AsO4)2(OH)2 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Tsumebite | Pb2Cu(PO4)(SO4)(OH) |
| Pb | ⓘ Dongchuanite | Pb4ZnZn2(PO4)4(OH)2 |
| Pb | ⓘ Cuprodongchuanite | Pb4CuZn2(PO4)4(OH)2 |
| Pb | ⓘ Cuprozheshengite | Pb4CuZn2(AsO4)2(PO4)2(OH)2 |
| Pb | ⓘ Zheshengite | Pb4ZnZn2(AsO4)2(PO4)2(OH)2 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Yunnan
- Kunming
- Dongchuan District
- Tangdan Town
- Shizhuang Village
- Tangdan Town
- Dongchuan District
- Kunming
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Sanguozhuang, Shizhuang Village, Tangdan Town, Dongchuan District, Kunming, Yunnan, China