Vincios, Gondomar, Pontevedra, Galicia, Spaini
| Regional Level Types | |
|---|---|
| Vincios | - not defined - |
| Gondomar | Municipality |
| Pontevedra | Province |
| Galicia | Autonomous Community |
| Spain | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° North , 8° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~8km
Köppen climate type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities42 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Aegirine Formula: NaFe3+Si2O6 References: |
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) References: |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Astrophyllite Formula: K2NaFe2+7Ti2[Si4O12]2O2(OH)4F References: |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O References: |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F References: |
| ⓘ Beraunite Formula: Fe3+6(PO4)4O(OH)4 · 6H2O References: |
| ⓘ Beryl Formula: Be3Al2(Si6O18) References: |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ 'Fergusonite' References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorite Formula: CaF2 References: |
| ⓘ Gahnite Formula: ZnAl2O4 |
| ⓘ Graftonite Formula: Fe2+Fe2+2(PO4)2 |
| ⓘ Hureaulite Formula: Mn2+5(PO3OH)2(PO4)2 · 4H2O References: |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 References: |
| ⓘ Meta-autunite Formula: Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ 'Mica Group var. Lepidomelane' References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Paravauxite Formula: Fe2+Al2(PO4)2(OH)2 · 8H2O |
| ⓘ Phosphophyllite Formula: Zn2Fe 2+(PO4)2 · 4H2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z References: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Riebeckite Formula: ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 References: |
| ⓘ Rittmannite Formula: {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O References: |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 References: |
| ⓘ Sarcopside Formula: Fe2+3(PO4)2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Strengite Formula: FePO4 · 2H2O References: |
| ⓘ Strunzite Formula: Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ Triphylite Formula: LiFe2+PO4 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O References: |
| ⓘ 'Xenotime' References: |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | Gahnite | 4.BB.05 | ZnAl2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Triphylite | 8.AB.10 | LiFe2+PO4 |
| ⓘ | Sarcopside | 8.AB.15 | Fe2+3(PO4)2 |
| ⓘ | Graftonite | 8.AB.20 | Fe2+Fe2+2(PO4)2 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Phosphophyllite | 8.CA.40 | Zn2Fe 2+(PO4)2 · 4H2O |
| ⓘ | Hureaulite | 8.CB.10 | Mn2+5(PO3OH)2(PO4)2 · 4H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ | Strunzite | 8.DC.25 | Mn2+Fe3+2(PO4)2(OH)2 · 6H2O |
| ⓘ | Beraunite | 8.DC.27 | Fe3+6(PO4)4O(OH)4 · 6H2O |
| ⓘ | Paravauxite | 8.DC.30 | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ | Rittmannite | 8.DH.15 | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| ⓘ | Meta-autunite | 8.EB.10 | Ca(UO2)2(PO4)2 · 6H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | Riebeckite | 9.DE.25 | ◻[Na2][Fe2+3Fe3+2]Si8O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Mica Group var. Lepidomelane' | - | |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| H | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Paravauxite | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| H | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| H | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| Li | Lithium | |
| Li | ⓘ Triphylite | LiFe2+PO4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| O | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Paravauxite | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| O | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| O | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Sarcopside | Fe32+(PO4)2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Triphylite | LiFe2+PO4 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Paravauxite | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| Al | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| P | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| P | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Paravauxite | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| P | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| P | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Sarcopside | Fe32+(PO4)2 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Triphylite | LiFe2+PO4 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| Ca | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Hureaulite | Mn52+(PO3OH)2(PO4)2 · 4H2O |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| Mn | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Beraunite | Fe63+(PO4)4O(OH)4 · 6H2O |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Graftonite | Fe2+Fe22+(PO4)2 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Paravauxite | Fe2+Al2(PO4)2(OH)2 · 8H2O |
| Fe | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Riebeckite | ◻[Na2][Fe32+Fe23+]Si8O22(OH)2 |
| Fe | ⓘ Rittmannite | {(Mn2+,Ca)}{Mn2+}{(Fe2+,Mn2+,Mg)2}{(Al,Fe3+)2}(PO4)4(OH)2 · 8H2O |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Sarcopside | Fe32+(PO4)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Strunzite | Mn2+Fe23+(PO4)2(OH)2 · 6H2O |
| Fe | ⓘ Triphylite | LiFe2+PO4 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Phosphophyllite | Zn2Fe 2+(PO4)2 · 4H2O |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Meta-autunite | Ca(UO2)2(PO4)2 · 6H2O |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Neoproterozoic to Permian : 544 ± 16 Ma to 277 ± 14 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Localities in this Region
- Galicia
- Pontevedra
- Gondomar
- Vincios
- Gondomar
- Pontevedra
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Santa Marina Mine, Galiñeiro Complex, Vincios, Gondomar, Pontevedra, Galicia, Spain