Kyatpyin North, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmari
| Regional Level Types | |
|---|---|
| Kyatpyin North | - not defined - |
| Mogok Township | Township |
| Pyin-Oo-Lwin District | District |
| Mandalay Region | Region |
| Myanmar | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
22° North , 96° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~31km
Köppen climate type:
Other/historical names associated with this locality:
Burma
Several pegmatites have been found in the area and very limited geological studies indicate the potential of mineral wealth.
Several mining sites are situated at the banks of Nam-peik-chaung, north of Nam-peik village. Gem mining takes place seasonally where low-to-medium quality rubies and sapphires of assorted sizes are recovered using myaw-dwin mining method. Many of the blue sapphires are silky and suitable for heat-treatment. Star rubies and star sapphires of low-to-medium quality usually between 1-2ct are frequently recovered. - Ted Themelis (2008) Gems and Mines of Mogok.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities29 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chrysoberyl var. Alexandrite | 4.BA.05 | BeAl2O4 |
| ⓘ | 4.BA.05 | BeAl2O4 | |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Corundum var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Magnesiotaaffeite-2N’2S | 4.FC.25 | Mg3Al8BeO16 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Böhmite ? | 4.FE.15 | AlO(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 6 - Borates | |||
| ⓘ | Jeremejevite | 6.AB.15 | Al6(BO3)5(F,OH)3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Herderite | 8.BA.10 | CaBe(PO4)F |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Poudretteite | 9.CM.05 | K◻2Na2B3[Si12O30] |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | 9.FA.30 | K(AlSi3O8) | |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Sodalite | 9.FB.10 | Na4(Si3Al3)O12Cl |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Moonstone' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'K Feldspar' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Böhmite | AlO(OH) |
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Herderite | CaBe(PO4)F |
| Be | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| B | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Böhmite | AlO(OH) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Herderite | CaBe(PO4)F |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Herderite | CaBe(PO4)F |
| F | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Böhmite | AlO(OH) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Herderite | CaBe(PO4)F |
| Cl | Chlorine | |
| Cl | ⓘ Sodalite | Na4(Si3Al3)O12Cl |
| K | Potassium | |
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Herderite | CaBe(PO4)F |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
Localities in this Region
- Mandalay Region
- Pyin-Oo-Lwin District
- Mogok Township
- Kyatpyin North
- Mogok Township
- Pyin-Oo-Lwin District
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Bawmar, Kyatpyin North, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmar