Kyauk-sin (Rock Elephant), Kyatpyin North, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmari
| Regional Level Types | |
|---|---|
| Kyauk-sin (Rock Elephant) | - not defined - |
| Kyatpyin North | - not defined - |
| Mogok Township | Township |
| Pyin-Oo-Lwin District | District |
| Mandalay Region | Region |
| Myanmar | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
22° 57' 28'' North , 96° 25' 55'' East
Latitude & Longitude (decimal):
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mogok | 90,843 (2016) | 9.1km |
Other/historical names associated with this locality:
Burma
The area is characterized by karst topography. Pink-purplish spinels and rubies are found in different types of marble. Sapphires, moonstone associated with nepheline, taaffeite, jeremejevite, poudretteite, chrysoberyl and other gems are recovered from the skarns and contact zones. In the alluvium rubies and sapphires are often found together with quartz, schorl, topaz and others. Alexandrite and orange-pink (padparadsha-type) sapphires are also reported. Dependent on the season and type of deposit, gem mining takes place using open-pit, letkya-dwin, inbyae, lebin and myaw-dwin methods. - Ted Themelis (2008) Gems and Mines of Mogok
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Chrysoberyl var. Alexandrite Formula: BeAl2O4 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Corundum var. Ruby Formula: Al2O3 |
| ⓘ Corundum var. Sapphire Formula: Al2O3 Colour: Yellow |
| ⓘ Diaspore Formula: AlO(OH) References: |
| ⓘ Jeremejevite Formula: Al6(BO3)5(F,OH)3 |
| ⓘ Magnesiotaaffeite-2N’2S Formula: Mg3Al8BeO16 |
| ⓘ Poudretteite Formula: K◻2Na2B3[Si12O30] |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Chrysoberyl var. Alexandrite | 4.BA.05 | BeAl2O4 |
| ⓘ | 4.BA.05 | BeAl2O4 | |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | var. Ruby | 4.CB.05 | Al2O3 |
| ⓘ | var. Sapphire | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Magnesiotaaffeite-2N’2S | 4.FC.25 | Mg3Al8BeO16 |
| ⓘ | Diaspore | 4.FD.10 | AlO(OH) |
| Group 6 - Borates | |||
| ⓘ | Jeremejevite | 6.AB.15 | Al6(BO3)5(F,OH)3 |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Poudretteite | 9.CM.05 | K◻2Na2B3[Si12O30] |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Diaspore | AlO(OH) |
| H | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| Be | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| B | Boron | |
| B | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| B | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | Oxygen | |
| O | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Diaspore | AlO(OH) |
| O | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| O | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Corundum var. Ruby | Al2O3 |
| O | ⓘ Corundum var. Sapphire | Al2O3 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | Fluorine | |
| F | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Al | Aluminium | |
| Al | ⓘ Chrysoberyl var. Alexandrite | BeAl2O4 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Diaspore | AlO(OH) |
| Al | ⓘ Jeremejevite | Al6(BO3)5(F,OH)3 |
| Al | ⓘ Corundum var. Ruby | Al2O3 |
| Al | ⓘ Corundum var. Sapphire | Al2O3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Magnesiotaaffeite-2N’2S | Mg3Al8BeO16 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| K | Potassium | |
| K | ⓘ Poudretteite | K◻2Na2B3[Si12O30] |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Kyauk-sin, Kyatpyin North, Mogok Township, Pyin-Oo-Lwin District, Mandalay Region, Myanmar