Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, Francei
| Regional Level Types | |
|---|---|
| Allemond | Commune |
| Grenoble | Arrondissement |
| Isère | Department |
| Auvergne-Rhône-Alpes | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Allemond | 827 (2016) |
Other/historical names associated with this locality:
Allemont
Other Languages:
French:
Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, France
German:
Allemond, Arrondissement Grenoble, Département Isère, Auvergne-Rhône-Alpes, Frankreich
Italian:
Allemond, arrondissement di Grenoble, Isère, Alvernia-Rodano-Alpi, Francia
Russian:
Аллемон, Гренобль, Изер, Овернь — Рона — Альпы, Франция
Simplified Chinese:
阿莱蒙, 格勒诺布尔区, 伊泽尔省, 奥弗涅-罗讷-阿尔卑斯大区, 法国
Spanish:
Allemond, distrito de Grenoble, Isère, Región de Auvernia-Ródano-Alpes, Francia
Afrikaans:
Allemond, Isère, Auvergne-Rhône-Alpes, Frankryk
Aragonese:
Allemond, destrito de Grenoble, Isèra, Auvernia-Roine-Alpes, Francia
Asturian:
Allemond, Isère, Auvernia-Ródano-Alpes, Francia
Azeri:
Almon , Qrenobl , İzer , Overn-Rona-Alp, Fransa
Bambara:
Allemond, Faransi
Basque:
Allemond, Grenobleko barrutia, Isère, Auvernia-Rhône-Alpeak, Frantzia
Bavarian:
Allemond, Département Isère, Auvergne-Rhône-Alpes, Frankreich
Breton:
Allemond, arondisamant Grenoble, Isèra, Auvergne-Rhône-Alpes, Bro-C'hall
Catalan:
Allemond, districte de Grenoble, Isèra, Alvèrnia-Roine-Alps, França
Cebuano:
Allemond, Arrondissement de Grenoble, Isère, Auvergne-Rhône-Alpes, Pransiya
Chechen:
Альмон , Франци
Corsican:
Allemond, Alvernia è Rodanu è Alpi, Francia
Croatian:
Allemond, Francuska
Czech:
Allemond, Arrondissement Grenoble, Isère, Auvergne-Rhône-Alpes, Francie
Danish:
Allemond, Isère, Auvergne-Rhône-Alpes, Frankrig
Dutch:
Allemond, Arrondissement Grenoble, Isère, Auvergne-Rhône-Alpes, Frankrijk
Dutch Low Saxon:
Allemond, Frankriek
Esperanto:
Allemond, Arondismento Grenoble, Isère, Aŭvernjo-Rodano-Alpoj, Francio
Estonian:
Allemond, Isère'i departemang, Auvergne-Rhône-Alpes, Prantsusmaa
Faroese:
Allemond, Frakland
Farsi/Persian:
الیموند, بخش گرونوبل, ایزر, اوورنی-رون-آلپ, فرانسه
Finnish:
Allemond, Isère, Auvergne-Rhône-Alpes, Ranska
Franco-Provençal:
Allemond, Isera, Ôvèrgne-Rôno-Ârpes, France
Friulian:
Allemond, France
Galician:
Allemond, Isère, Auvernia-Ródano-Alpes, Francia
Greenlandic:
Allemond, Franskit Nunaat
Hungarian:
Allemond, Isère, Auvergne-Rhône-Alpes, Franciaország
Icelandic:
Allemond, Auvergne-Rhône-Alpes, Frakkland
Ido:
Allemond, Arvernia-Rodano-Alpi, Francia
Indonesian:
Allemond, Arondisemen Grenoble, Isère, Auvergne-Rhône-Alpes, Perancis
Interlingua:
Allemond, Departimento Isere, Auvernia-Rhodano-Alpes, Francia
Interlingue:
Allemond, Département Isère, Francia
Irish Gaelic:
Allemond, An Fhrainc
Jamaican Patois:
Allemond, Frans
Kabyle:
Allemond, Fransa
Kongo:
Allemond, Isère, Fwalansa
Latin:
Allemond, Isara, Arvernia Rhodanus Alpesque, Francia
Latvian:
Allemond, Izēra, Overņa-Rona-Alpi, Francija
Ligurian:
Allemond, Fransa
Limburgian:
Allemond, Isère, Auvergne-Rhône-Alpes, Frankriek
Lithuanian:
Allemond, Grenoblis, Izeras, Overnė-Rona-Alpės, Prancūzija
Lombard:
Allemond, Isère, Alvernia-Roden-Alp, Frància
Low Saxon/Low German:
Allemond, Isère, Frankriek
Luxembourgish:
Allemond, Arrondissement Grenobel, Departement Isère, Auvergne-Rhône-Alpes, Frankräich
Malagasy:
Allemond, Isère, Frantsa
Malay:
Allemond, Isère, Perancis
Minangkabau:
Allemond, Parancih
Minnan / Hokkien-Taiwanese:
Allemond, Grenoble Kūn, Isère, Auvergne-Rhône-Alpes, Hoat-kok
Narom:
Allemond, Âovergne-Rhône-Alpes, France
Neapolitan:
Allemond, Franza
Norwegian:
Allemond, Isère, Auvergne-Rhône-Alpes, Frankrike
Norwegian (Nynorsk):
Allemond, Isère, Frankrike
Occitan:
Allemond, arrondiment de Grenòble, Isèra, Auvèrnhe Ròse Aups, França
Papiamento:
Allemond, Fransia
Picard:
Allemond, Franche
Piedmontese:
Allemond, Dipartiment ëd l'Isère, Alvernia-Ròno-Alp, Fransa
Polish:
Allemond, Okręg Grenoble, Isère, Owernia-Rodan-Alpy, Francja
Portuguese:
Allemond, Isère, Auvérnia-Ródano-Alpes, França
Romanian:
Allemond, Arondismentul Grenoble, Isère, Auverge-Ron-Alpi, Franța
Romansh:
Allemond, Frantscha
Sardinian:
Allemond, Frantza
Scots:
Allemond, Isère, Auvergne-Rhône-Alpes, Fraunce
Scottish Gaelic:
Allemond, Isère, Auvergne-Rhône-Alpes, An Fhraing
Serbian:
Алмон, Изер, Оверња-Рона-Алпи, Француска
Serbo-Croatian:
Allemond, Isère, Francuska
Sicilian:
Allemond, Alvernia-Rudanu-Alpi, Francia
Slovak:
Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, Francúzsko
Swahili:
Allemond, Isère, Auvergne-Rhône-Alpes, Ufaransa
Swedish:
Allemond, Isère, Auvergne-Rhône-Alpes, Frankrike
Traditional Chinese:
阿萊蒙, 伊澤爾, 奧文尼－隆河－阿爾卑斯, 法國
Turkish:
Allemond, Isère, Auvergne-Rhône-Alpes, Fransa
Ukrainian:
Аллемон, Ізер, Овернь-Рона-Альпи, Франція
Uzbek (Latin Script):
Allemond, Fransiya
Venetian:
Allemond, Arrondissement de Grenoble, Isère, Alvergna-Rodano-Alpe, Fransa
Vietnamese:
Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, Pháp
Volapük:
Allemond, Isère, Fransän
Walloon:
Allemond, France
Waray:
Allemond, Isère, Auvergne-Rhône-Alpes, Fransya
Welsh:
Allemond, Isère, Auvergne-Rhône-Alpes, Ffrainc
West Flemish:
Allemond, Auvergne-Rhône-Alpes, Vrankryk
Wolof:
Allemond, Faraas
Zulu:
Allemond, IFulansi
Old mining area (Ag, Pb, Cu + As, Sb).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities54 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Annabergite Formula: Ni3(AsO4)2 · 8H2O |
| ⓘ Argentojarosite Formula: AgFe3+3(SO4)2(OH)6 |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O Description: Associated with Annabergite. |
| ⓘ 'Axinite Group' |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bieberite Formula: Co2+(H2O)6(SO4) · H2O References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Cervantite Formula: Sb3+Sb5+O4 |
| ⓘ 'Chabazite' References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chlorargyrite Formula: AgCl Description: Small cubic crystals. |
| ⓘ 'Chlorite Group' |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dolomite var. Iron-bearing Dolomite Formula: Ca(Mg,Fe)(CO3)2 |
| ⓘ Dyscrasite Formula: Ag3Sb |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O Description: Earthy material. References: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite ? Formula: Fe3+O(OH) References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: Bruno Ducluzaux CollectionIdentified by Bruno Ducluzaux: SEM-EDS |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Miargyrite ? Formula: AgSbS2 References: Patrice Queneau CollectionIdentified by Patrice Queneau: Visual Identification |
| ⓘ Moschellandsbergite Formula: Ag2Hg3 References: |
| ⓘ Native Antimony Formula: Sb |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi Description: in association with antimony. |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Native Silver var. Amalgam Formula: (Ag,Hg) |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nickeline Formula: NiAs |
| ⓘ Proustite Formula: Ag3AsS3 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 Description: in association with antimony and stibarsen References: |
| ⓘ Schachnerite Formula: Ag1.1Hg0.9 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Senarmontite Formula: Sb2O3 Description: in association with valentinite and antimony. |
| ⓘ Skutterudite Formula: CoAs3 Description: Fine crystals (0.5 centimeters). |
| ⓘ Stibarsen Formula: AsSb |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tučekite Formula: Ni9Sb2S8 Description: Symplectic associations with nickelite, from periphery towards the core, with evolution to ullmannite. |
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite (TL) Formula: Sb2O3 Type Locality: |
| ⓘ Wulfenite Formula: Pb(MoO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver var. Amalgam | 1.AA.05 | (Ag,Hg) |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Schachnerite | 1.AD.15a | Ag1.1Hg0.9 |
| ⓘ | Moschellandsbergite | 1.AD.15d | Ag2Hg3 |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Stibarsen | 1.CA.05 | AsSb |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Dyscrasite | 2.AA.35 | Ag3Sb |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Tučekite | 2.BB.10 | Ni9Sb2S8 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Miargyrite ? | 2.HA.10 | AgSbS2 |
| Group 3 - Halides | |||
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite ? | 4.00. | Fe3+O(OH) |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite (TL) | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cervantite | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | var. Iron-bearing Dolomite | 5.AB.10 | Ca(Mg,Fe)(CO3)2 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Argentojarosite | 7.BC.10 | AgFe3+3(SO4)2(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Bieberite | 7.CB.35 | Co2+(H2O)6(SO4) · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Annabergite | 8.CE.40 | Ni3(AsO4)2 · 8H2O |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| Unclassified | |||
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| H | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Bieberite | Co2+(H2O)6(SO4) · H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| O | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bieberite | Co2+(H2O)6(SO4) · H2O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bieberite | Co2+(H2O)6(SO4) · H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Miargyrite | AgSbS2 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Tučekite | Ni9Sb2S8 |
| S | ⓘ Ullmannite | NiSbS |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Dolomite var. Iron-bearing Dolomite | Ca(Mg,Fe)(CO3)2 |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Bieberite | Co2+(H2O)6(SO4) · H2O |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Ni | ⓘ Tučekite | Ni9Sb2S8 |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| As | Arsenic | |
| As | ⓘ Annabergite | Ni3(AsO4)2 · 8H2O |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Nickeline | NiAs |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Stibarsen | AsSb |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Ag | ⓘ Argentojarosite | AgFe33+(SO4)2(OH)6 |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Dyscrasite | Ag3Sb |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Ag | ⓘ Moschellandsbergite | Ag2Hg3 |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Dyscrasite | Ag3Sb |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibarsen | AsSb |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tučekite | Ni9Sb2S8 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Native Silver var. Amalgam | (Ag,Hg) |
| Hg | ⓘ Cinnabar | HgS |
| Hg | ⓘ Moschellandsbergite | Ag2Hg3 |
| Hg | ⓘ Schachnerite | Ag1.1Hg0.9 |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
Fossils
There are 4 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 4 |
|---|---|
| Youngest Fossil Listed | 113 Ma (Early/Lower Cretaceous) |
| Oldest Fossil Listed | 125 Ma (Early/Lower Cretaceous) |
| Fossils from Region | Click here to show the list. |
| Fossil Localities | Click to show 1 fossil locality |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Allemond |
|---|---|
| Wikidata ID: | Q1075880 |
| GeoNames ID: | 6616646 |
Localities in this Region
- Auvergne-Rhône-Alpes
- Isère
- Grenoble
- Allemond
- Grenoble
- Isère
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
France
- Auvergne-Rhône-Alpes
- Savoie
- Belledonne massifMassif
- Savoie
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Les Chalanches Mine, Allemond, Grenoble, Isère, Auvergne-Rhône-Alpes, France