Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourgi
| Regional Level Types | |
|---|---|
| Goesdorf antimony mine | Mine (Abandoned) |
| Goesdorf | Commune |
| Canton Wiltz | Canton |
| Luxembourg | Country |
Goesdorf antimony mine, Ardennes Mountains, Europe
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
49° 55' 19'' North , 5° 57' 27'' East
Latitude & Longitude (decimal):
Type:
Mine (Abandoned) - last checked 2020
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Goesdorf | 251 (2017) | 0.6km |
| Esch-sur-Sûre | 333 (2017) | 1.9km |
| Buderscheid | 126 (2017) | 2.0km |
| Dahl | 246 (2017) | 2.0km |
| Nocher | 233 (2017) | 3.0km |
Name(s) in local language(s):
Mine d'antimoine, Goesdorf, Commune de Goesdorf, Luxembourg
Note: Since June 2006 an excavation has been underway at Goesdorf as part of an archaeological-mineralogical project of the National History Museum of Luxembourg, and it is not allowed to look for minerals there anymore (source: strahlen.org).
Old Sb mine, which started in the 14th century (or even Roman times), closed in 1938 (1944 according to Filella et al., 2009). Located 1 km west of the village of Goesdorf on a hill called Weissenstein ('white stone').
New data based on the Lapis article by Bakker & Kolitsch (2009) and Philippo & Hatert (2018). The first evaluation of the Goesdorf deposit was published in 2007 in Ferrantia, number 49. This study was based on samples collected from mine dumps. In 2018, Philippo & Hatert investigated three antimony veins located directly inside the mine; these analyses allow us to better understand the mineralogy and genesis of this ore deposit. Mineralogical analyses indicate the presence of Pb-Sb-sulfosalts (fülöppite, plagionite, robinsonite, and geocronite) and ullmannite, as well as secondary Sb minerals (brandholzite, coquandite, klebelsbergite, and peretaite).
Old Sb mine, which started in the 14th century (or even Roman times), closed in 1938 (1944 according to Filella et al., 2009). Located 1 km west of the village of Goesdorf on a hill called Weissenstein ('white stone').
New data based on the Lapis article by Bakker & Kolitsch (2009) and Philippo & Hatert (2018). The first evaluation of the Goesdorf deposit was published in 2007 in Ferrantia, number 49. This study was based on samples collected from mine dumps. In 2018, Philippo & Hatert investigated three antimony veins located directly inside the mine; these analyses allow us to better understand the mineralogy and genesis of this ore deposit. Mineralogical analyses indicate the presence of Pb-Sb-sulfosalts (fülöppite, plagionite, robinsonite, and geocronite) and ullmannite, as well as secondary Sb minerals (brandholzite, coquandite, klebelsbergite, and peretaite).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
59 valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 Description: See, however, remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Azurite ? Formula: Cu3(CO3)2(OH)2 Description:
|
| ⓘ Berthierite Formula: FeSb2S4 References: |
| ⓘ Bindheimite Formula: Pb2Sb2O6O |
| ⓘ Brandholzite Formula: MgSb2(OH)12 · 6H2O References: |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cervantite ? Formula: Sb3+Sb5+O4 Description: See remarks in http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50 |
| ⓘ Cetineite Formula: (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Chalcostibite Formula: CuSbS2 References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 Description: Fe-variety (see http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50)
References: |
| ⓘ Coquandite Formula: Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ Cualstibite Formula: Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ Delafossite ? Formula: Cu+Fe3+O2 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Fülöppite Formula: Pb3Sb8S15 |
| ⓘ Gahnite ? Formula: ZnAl2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
|
| ⓘ Galena Formula: PbS |
| ⓘ Geocronite Formula: Pb14Sb6S23 |
| ⓘ Gibbsite ? Formula: Al(OH)3 Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Kermesite Formula: Sb2S2O |
| ⓘ Klebelsbergite Formula: Sb4O4(SO4)(OH)2 |
| ⓘ 'Limonite' |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ 'Manganese Oxides' |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Metastibnite Formula: Sb2S3 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 References: |
| ⓘ Native Antimony Formula: Sb References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Peretaite Formula: Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| ⓘ Plagionite Formula: Pb5Sb8S17 References: |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Ramsbeckite ? Formula: (Cu,Zn)15(SO4)4(OH)22 · 6H2O Description: "Not verified yet" (Activity report).
Considered questionable by PHILIPPO, S. & HANSON, A. (2007) La minéralisation en antimoine de Goesdorf. Ferrantia 49, 111-146. |
| ⓘ Robinsonite Formula: Pb4Sb6S13 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schafarzikite Formula: Fe2+Sb3+2O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed in Philippo & Hatert 2018 (p36) - analysed by Meisser (Lausanne) and By Philippo (Luxembourg) on a second sample
|
| ⓘ Senarmontite Formula: Sb2O3 References: |
| ⓘ Siderite Formula: FeCO3 Description: eds and xrd analysis (see Philippo & Hatert 2018) References: |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) References: |
| ⓘ Stibnite Formula: Sb2S3 References: |
| ⓘ Todorokite Formula: (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ Tripuhyite Formula: Fe3+Sb5+O4 Description: see remarks here
http://www.mnhn.lu/recherche/ferrantia/liste_detail.asp?ID=50
Confirmed by eds, wds and xrd analysis in Philippo & Hatert 2018
|
| ⓘ Ullmannite Formula: NiSbS |
| ⓘ Valentinite Formula: Sb2O3 References: |
| ⓘ 'Wad' |
| ⓘ Zinkenite Formula: Pb9Sb22S42 References: |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Antimony | 1.CA.05 | Sb |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Metastibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Ullmannite | 2.EB.25 | NiSbS |
| ⓘ | Kermesite | 2.FD.05 | Sb2S2O |
| ⓘ | Chalcostibite | 2.HA.05 | CuSbS2 |
| ⓘ | Berthierite | 2.HA.20 | FeSb2S4 |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Fülöppite | 2.HC.10a | Pb3Sb8S15 |
| ⓘ | Plagionite | 2.HC.10b | Pb5Sb8S17 |
| ⓘ | Robinsonite | 2.HC.20 | Pb4Sb6S13 |
| ⓘ | Geocronite | 2.JB.30a | Pb14Sb6S23 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Cetineite | 2.MA.05 | (K,Na)6Sb3+12(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Delafossite ? | 4.AB.15 | Cu+Fe3+O2 |
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Gahnite ? | 4.BB.05 | ZnAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Senarmontite | 4.CB.50 | Sb2O3 |
| ⓘ | Valentinite | 4.CB.55 | Sb2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Tripuhyite | 4.DB.05 | Fe3+Sb5+O4 |
| ⓘ | Cervantite ? | 4.DE.30 | Sb3+Sb5+O4 |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Todorokite | 4.DK.10 | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| ⓘ | Cualstibite | 4.FB.10 | Cu2Al(OH)6[Sb5+(OH)6] |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| ⓘ | Gibbsite ? | 4.FE.10 | Al(OH)3 |
| ⓘ | Brandholzite | 4.FH.05 | MgSb2(OH)12 · 6H2O |
| ⓘ | Schafarzikite | 4.JA.20 | Fe2+Sb3+2O4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Azurite ? | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Klebelsbergite | 7.BB.35 | Sb4O4(SO4)(OH)2 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Ramsbeckite ? | 7.DD.60 | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| ⓘ | Coquandite | 7.DE.35 | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| ⓘ | Peretaite | 7.DF.45 | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Wad' | - | |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| H | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Gibbsite | Al(OH)3 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| H | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| H | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cervantite | Sb3+Sb5+O4 |
| O | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| O | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| O | ⓘ Delafossite | Cu+Fe3+O2 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Gahnite | ZnAl2O4 |
| O | ⓘ Gibbsite | Al(OH)3 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Kermesite | Sb2S2O |
| O | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| O | ⓘ Senarmontite | Sb2O3 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| O | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| O | ⓘ Valentinite | Sb2O3 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| Na | Sodium | |
| Na | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Na | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Mg | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Al | Aluminium | |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Gahnite | ZnAl2O4 |
| Al | ⓘ Gibbsite | Al(OH)3 |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Si | Silicon | |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Berthierite | FeSb2S4 |
| S | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcostibite | CuSbS2 |
| S | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| S | ⓘ Fülöppite | Pb3Sb8S15 |
| S | ⓘ Galena | PbS |
| S | ⓘ Geocronite | Pb14Sb6S23 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kermesite | Sb2S2O |
| S | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Metastibnite | Sb2S3 |
| S | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| S | ⓘ Plagionite | Pb5Sb8S17 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| S | ⓘ Robinsonite | Pb4Sb6S13 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Ullmannite | NiSbS |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Ca | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Mn | Manganese | |
| Mn | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Berthierite | FeSb2S4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Delafossite | Cu+Fe3+O2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Ni | Nickel | |
| Ni | ⓘ Ullmannite | NiSbS |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcostibite | CuSbS2 |
| Cu | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Cu | ⓘ Delafossite | Cu+Fe3+O2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | Zinc | |
| Zn | ⓘ Gahnite | ZnAl2O4 |
| Zn | ⓘ Ramsbeckite | (Cu,Zn)15(SO4)4(OH)22 · 6H2O |
| Zn | ⓘ Sphalerite | ZnS |
| Sr | Strontium | |
| Sr | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sb | Antimony | |
| Sb | ⓘ Native Antimony | Sb |
| Sb | ⓘ Berthierite | FeSb2S4 |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Cervantite | Sb3+Sb5+O4 |
| Sb | ⓘ Cetineite | (K,Na)6Sb123+(Sb3+S3)2O18(OH)0.5 · 5,5H2O |
| Sb | ⓘ Chalcostibite | CuSbS2 |
| Sb | ⓘ Coquandite | Sb6+xO8+x(SO4)(OH)x(H2O)1- x (x = 0.3) |
| Sb | ⓘ Cualstibite | Cu2Al(OH)6[Sb5+(OH)6] |
| Sb | ⓘ Fülöppite | Pb3Sb8S15 |
| Sb | ⓘ Geocronite | Pb14Sb6S23 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Kermesite | Sb2S2O |
| Sb | ⓘ Klebelsbergite | Sb4O4(SO4)(OH)2 |
| Sb | ⓘ Metastibnite | Sb2S3 |
| Sb | ⓘ Peretaite | Ca(SbO)4(SO4)2(OH)2 · 2H2O |
| Sb | ⓘ Plagionite | Pb5Sb8S17 |
| Sb | ⓘ Robinsonite | Pb4Sb6S13 |
| Sb | ⓘ Schafarzikite | Fe2+Sb23+O4 |
| Sb | ⓘ Senarmontite | Sb2O3 |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tripuhyite | Fe3+Sb5+O4 |
| Sb | ⓘ Ullmannite | NiSbS |
| Sb | ⓘ Valentinite | Sb2O3 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Sb | ⓘ Brandholzite | MgSb2(OH)12 · 6H2O |
| Ba | Barium | |
| Ba | ⓘ Todorokite | (Na,Ca,K,Ba,Sr)1-x(Mn,Mg,Al)6O12 · 3-4H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Fülöppite | Pb3Sb8S15 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Geocronite | Pb14Sb6S23 |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Plagionite | Pb5Sb8S17 |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Robinsonite | Pb4Sb6S13 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
- Ardennes MountainsMountain Range
- Rhenish MassifMassif
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Goesdorf antimony mine, Goesdorf, Canton Wiltz, Luxembourg