Pizzo dell'Arzo, Cavagnöö Glacier (Cavagnoli Glacier; Cavagnöö area; Cavagnoli area), Robièi (Alpe di Robièi; Lake Robièi area), Bavona Valley, Cevio, Vallemaggia, Ticino, Switzerlandi
| Regional Level Types | |
|---|---|
| Pizzo dell'Arzo | - not defined - |
| Cavagnöö Glacier (Cavagnoli Glacier; Cavagnöö area; Cavagnoli area) | Mountain Area |
| Robièi (Alpe di Robièi; Lake Robièi area) | - not defined - |
| Bavona Valley | Valley |
| Cevio | Municipality |
| Vallemaggia | District |
| Ticino | Canton |
| Switzerland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 26' 46'' North , 8° 29' 34'' East
Latitude & Longitude (decimal):
Köppen climate type:
Name(s) in local language(s):
Pizzo dell'Arzo, Ghiacciaio dei Cavagnoli (Ghiacciaio dei Cavagnöö), Val Bavona, Valle Maggia, Ticino (Tessin), Svizzera (Schweiz; Suisse)
The area limited in the south by the watershed ridge Pizzo dei Matörgn (2903 m) - Pizzo dell'Arzo (2755 m, Swiss coordinates: 681'020 / 144'410), in the west by the ridge descending northeastwards from Pizzo dei Matörgn to Lake Cavagnoli, in the north by the same lake, and in the east by Cresta dell'Arzo (the ridge descending northeastwards from Pizzo dell'Arzo to Lake Cavagnoli) is extraordinarily rich in mineralised clefts.
Well-known mineral areas are:
- the so-called Fianca d'Arzo, which in the 1960s was still covered by a branch of Ghiacciaio dei Cavagnöö, located to the west of Pizzo dell'Arzo between Lake Cavagnoli and the newly formed glacial lake at 2450 m below the lower glacial cirque;
- the area to the west of Pizzo dell'Arzo between the lower and the upper glacial cirque;
- the so-called Mezzalingua, an already ice-free area in the 1960s, where in 1965 the "strahler" Gilberto Leonardi made an extraordinary find of quartz and adularia crystals;
- the north slope of Pizzo dell'Arzo between 2450 and 2750 m;
- the northeast slope of Pizzo dell'Arzo with the euclase-bearing cleft system;
- the Cresta dell'Arzo ridge.
Well-known mineral areas are:
- the so-called Fianca d'Arzo, which in the 1960s was still covered by a branch of Ghiacciaio dei Cavagnöö, located to the west of Pizzo dell'Arzo between Lake Cavagnoli and the newly formed glacial lake at 2450 m below the lower glacial cirque;
- the area to the west of Pizzo dell'Arzo between the lower and the upper glacial cirque;
- the so-called Mezzalingua, an already ice-free area in the 1960s, where in 1965 the "strahler" Gilberto Leonardi made an extraordinary find of quartz and adularia crystals;
- the north slope of Pizzo dell'Arzo between 2450 and 2750 m;
- the northeast slope of Pizzo dell'Arzo with the euclase-bearing cleft system;
- the Cresta dell'Arzo ridge.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities20 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Hematite var. Iron Rose | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | var. Sceptre Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | var. Sagenite (of Saussure) | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| Group 9 - Silicates | |||
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Pericline | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Dravite-Schorl Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Dravite-Schorl Series | |
| Be | Beryllium | |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Dravite-Schorl Series | |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brookite | TiO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Albite var. Pericline | Na(AlSi3O8) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| O | ⓘ Dravite-Schorl Series | |
| O | ⓘ Hematite var. Iron Rose | Fe2O3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Pericline | Na(AlSi3O8) |
| Na | ⓘ Dravite-Schorl Series | |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dravite-Schorl Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Albite var. Pericline | Na(AlSi3O8) |
| Al | ⓘ Dravite-Schorl Series | |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Albite var. Pericline | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Quartz var. Sceptre Quartz | SiO2 |
| Si | ⓘ Dravite-Schorl Series | |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Brookite | TiO2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Rutile var. Sagenite (of Saussure) | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Dravite-Schorl Series | |
| Fe | ⓘ Hematite var. Iron Rose | Fe2O3 |
Localities in this Region
- Ticino
- Vallemaggia
- Cevio
- Bavona Valley
- Robièi (Alpe di Robièi; Lake Robièi area)
- Cavagnöö Glacier (Cavagnoli Glacier; Cavagnöö area; Cavagnoli area)
- Pizzo dell'Arzo
- Cavagnöö Glacier (Cavagnoli Glacier; Cavagnöö area; Cavagnoli area)
- Robièi (Alpe di Robièi; Lake Robièi area)
- Bavona Valley
- Cevio
- Vallemaggia
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Pizzo dell'Arzo, Cavagnöö Glacier, Robièi, Bavona Valley, Cevio, Vallemaggia, Ticino, Switzerland