Clearing House Mining District, East Belt, Mariposa County, California, USAi
| Regional Level Types | |
|---|---|
| Clearing House Mining District | Mining District |
| East Belt | - not defined - |
| Mariposa County | County |
| California | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
37° North , 119° West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~1km
Type:
Köppen climate type:
Location and history: Clearinghouse is in central Mariposa County a few miles west of El Portal and Yosemite National Park. It was named for the Clearinghouse mine, the largest source of gold in the district. The Merced River, which flows through the area, was extensively placer-mined during the gold rush. The Clearinghouse mine was discovered in 1860 and worked on a fairly large scale until about 1880. There was mining activity again during the early 1900s and 1930s, and there has been intermittent prospecting and development work since. Substantial quantities of limestone and barite and some tungsten are found here. At one time the Yosemite Valley Railroad extended through the area to El Portal, the line's eastern terminus. From El Portal, passengers were taken by stage to Yosemite Valley.
Geology and ore deposits: The principal rocks underlying the district are graphitic schist, slate, quartzite, and hornfels of the Calaveras Formation (Carboniferous to Permian). There are some granitic dikes, and the main mass of the Sierra Nevada granitic batholith is a few miles to the east.The gold deposits occur in north-striking quartz veins that usually range from one to five feet in thickness. The ore contains free gold and often abundant sulfides. Appreciable amounts of high-grade ore have
been found here, and milling-grade ore commonly contained one ounce or more of gold per ton. Several of the veins have been developed to inclined depths of about 1 200 feet.
Mines: Clearinghouse ($3.35 million), Gold Star, Old Timer, Rutheford and Cranberry, South Cranberry, Uncle Jim, West Rutherford.
Geology and ore deposits: The principal rocks underlying the district are graphitic schist, slate, quartzite, and hornfels of the Calaveras Formation (Carboniferous to Permian). There are some granitic dikes, and the main mass of the Sierra Nevada granitic batholith is a few miles to the east.The gold deposits occur in north-striking quartz veins that usually range from one to five feet in thickness. The ore contains free gold and often abundant sulfides. Appreciable amounts of high-grade ore have
been found here, and milling-grade ore commonly contained one ounce or more of gold per ton. Several of the veins have been developed to inclined depths of about 1 200 feet.
Mines: Clearinghouse ($3.35 million), Gold Star, Old Timer, Rutheford and Cranberry, South Cranberry, Uncle Jim, West Rutherford.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities39 valid minerals. 3 (TL) - type locality of valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Alforsite | 8.BN.05 | Ba5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Ferroericssonite | 9.00. | BaFe2+2 Fe3+(Si2O7)O(OH) |
| ⓘ | Fresnoite | 9.BE.15 | Ba2Ti(Si2O7)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Fencooperite (TL) | 9.BH.20 | Ba6Fe3+3Si8O23(CO3)2Cl3 · H2O |
| ⓘ | Benitoite | 9.CA.05 | BaTi(Si3O9) |
| ⓘ | Walstromite | 9.CA.25 | BaCa2(Si3O9) |
| ⓘ | Titantaramellite (TL) | 9.CE.20 | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ | Cerchiaraite-(Fe) | 9.CF.25 | Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Devitoite | 9.DC.05 | Ba4Ba2Fe2+7Fe3+2[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bigcreekite | 9.DF.30 | BaSi2O5 · 4H2O |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Krauskopfite | 9.DH.30 | BaSi2O5 · 3H2O |
| ⓘ | Pellyite | 9.DO.10 | Ba2CaFe2+2Si6O17 |
| ⓘ | Esquireite | 9.DP.50 | BaSi6O13 · 7H2O |
| ⓘ | Gillespite | 9.EA.05 | BaFe2+Si4O10 |
| ⓘ | Macdonaldite | 9.EB.05 | BaCa4Si16O36(OH)2 · 10H2O |
| ⓘ | Anandite | 9.EC.35 | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Sanbornite (TL) | 9.EF.10 | BaSi2O5 |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| H | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| H | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| H | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| H | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Esquireite | BaSi6O13 · 7H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| C | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| O | Oxygen | |
| O | ⓘ Alforsite | Ba5(PO4)3Cl |
| O | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Benitoite | BaTi(Si3O9) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| O | ⓘ Gillespite | BaFe2+Si4O10 |
| O | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| O | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Sanbornite | BaSi2O5 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Walstromite | BaCa2(Si3O9) |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| O | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| O | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| O | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Esquireite | BaSi6O13 · 7H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | Silicon | |
| Si | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Si | ⓘ Benitoite | BaTi(Si3O9) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Si | ⓘ Gillespite | BaFe2+Si4O10 |
| Si | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Si | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sanbornite | BaSi2O5 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Walstromite | BaCa2(Si3O9) |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Si | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Si | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Si | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Esquireite | BaSi6O13 · 7H2O |
| P | Phosphorus | |
| P | ⓘ Alforsite | Ba5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| S | Sulfur | |
| S | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Alforsite | Ba5(PO4)3Cl |
| Cl | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Cl | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Cl | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| K | Potassium | |
| K | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Ca | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Walstromite | BaCa2(Si3O9) |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ti | Titanium | |
| Ti | ⓘ Benitoite | BaTi(Si3O9) |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ti | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mn | Manganese | |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Gillespite | BaFe2+Si4O10 |
| Fe | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Fe | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Fe | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Fe | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Ba | Barium | |
| Ba | ⓘ Alforsite | Ba5(PO4)3Cl |
| Ba | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benitoite | BaTi(Si3O9) |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ba | ⓘ Gillespite | BaFe2+Si4O10 |
| Ba | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Ba | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ba | ⓘ Sanbornite | BaSi2O5 |
| Ba | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ba | ⓘ Walstromite | BaCa2(Si3O9) |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| Ba | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Ba | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Ba | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Ba | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Esquireite | BaSi6O13 · 7H2O |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Localities in this Region
- California
- Mariposa County
- East Belt
- Clearing House Mining District
- Clearing House
- Alma Quartz Mine
- Big Grizzly group
- Camanchero Mine
- Clearinghouse Mine (Golden Rule claim; Golden Rule No. 2 claim; Anderson I claim; North Extension of the Anderson claim; Moonstone claim; Moonstone No. 2 claim; El Portal claim; Ferguson Original claim; Original No. 2 claim; South Original Extension claim)
- El Capitan group (El Portal group)
- Hudson Lode Mine
- Jenkins Hill Mine (Jenkens Hill Mine)
- Jenkins Hillemory Quarry (Richardson; Timertone; Emery; Rosemite Cement; Yosemite Cement)
- Mildred and Abbie Mine
- Old Timer Mine
- Old Timers Club Mine
- Red Garnett Mine (Red Carnett South Extension Mine)
- Rutherford & Cranberry Mines
- Troy Lode Mine
- Clearing House
- Clearing House Mining District
- East Belt
- Mariposa County
- California
- Mariposa County
- East Belt
- Clearing House Mining District
- Clearing House
- Incline
- Clearing House Mining District
- East Belt
- Mariposa County
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Shoofly-Olds Ferry DomainDomain
- Sierra Nevada BatholithVolcanic Arc
USA
- Sierra NevadaMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Trumbull Peak Ba-silicate deposit, Trumbull Peak, Clearing House, Clearing House Mining District, East Belt, Mariposa County, California, USA