Trumbull Peak, Clearing House, Clearing House Mining District, East Belt, Mariposa County, California, USAi
| Regional Level Types | |
|---|---|
| Trumbull Peak | Peak |
| Clearing House | - not defined - |
| Clearing House Mining District | Mining District |
| East Belt | - not defined - |
| Mariposa County | County |
| California | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
37° 41' 16'' North , 119° 51' 41'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| El Portal | 474 (2011) | 7.0km |
| Midpines | 1,204 (2011) | 16.8km |
| Mariposa | 2,173 (2017) | 24.4km |
| Greeley Hill | 915 (2011) | 24.4km |
| Wawona | 169 (2011) | 24.6km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Mariposa Gem & Mineral Club | Mariposa, California | 24km |
A summit located 2.6 km (8,500 feet) NNE of Clearing House.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities34 valid minerals. 3 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Alforsite Formula: Ba5(PO4)3Cl Description: “Alforsite is.05 mm or smaller grains disseminated in fine-grained metamorphic sanbornite-quartz rock. The alforsite-bearing samples are massive gray rocks with gneissic banding due primarily to segregations of quartz. In prominent bands of pink gillespite, alforsite is associated with sanbornite, witherite, and celsian in quartz-rich and gillespite-rich bands. Fresnoite, walstromite, tourmaline, and pyrite, though less abundant, are disseminated throughout the rock. |
| ⓘ Anandite Formula: (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Benitoite Formula: BaTi(Si3O9) |
| ⓘ Bigcreekite Formula: BaSi2O5 · 4H2O |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Celsian Formula: Ba(Al2Si2O8) Description: Occurs in veins in quartzite. References: Rogers, Austin F. (1932) Sanbornite, a new barium silicate mineral from Mariposa County, California. American Mineralogist, 17 (5) 161-172 Newberry, Nancy G., Essene, Eric J., Peacor, and Donald R. (1981) Alforsite, a new member of the apatite group: the barium analogue of chlorapatite. American Mineralogist, 66 (9-10) 1050-1053 |
| ⓘ Cerchiaraite-(Fe) Formula: Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl References: |
| ⓘ Devitoite Formula: Ba4Ba2Fe2+7Fe3+2[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Esquireite Formula: BaSi6O13 · 7H2O |
| ⓘ Fencooperite (TL) Formula: Ba6Fe3+3Si8O23(CO3)2Cl3 · H2O Type Locality: Habit: None Colour: Black Fluorescence: None |
| ⓘ Ferroericssonite Formula: BaFe2+2 Fe3+(Si2O7)O(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fresnoite Formula: Ba2Ti(Si2O7)O |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gillespite Formula: BaFe2+Si4O10 References: Rogers, Austin F. (1932) Sanbornite, a new barium silicate mineral from Mariposa County, California. American Mineralogist, 17 (5) 161-172 Newberry, Nancy G., Essene, Eric J., Peacor, and Donald R. (1981) Alforsite, a new member of the apatite group: the barium analogue of chlorapatite. American Mineralogist, 66 (9-10) 1050-1053 |
| ⓘ Kinoshitalite Formula: (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ Krauskopfite Formula: BaSi2O5 · 3H2O |
| ⓘ Macdonaldite Formula: BaCa4Si16O36(OH)2 · 10H2O |
| ⓘ Pellyite Formula: Ba2CaFe2+2Si6O17 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Sanbornite (TL) Formula: BaSi2O5 Type Locality: References: Rogers, Austin F. (1932) Sanbornite, a new barium silicate mineral from Mariposa County, California. American Mineralogist, 17 (5) 161-172 Newberry, Nancy G., Essene, Eric J., Peacor, and Donald R. (1981) Alforsite, a new member of the apatite group: the barium analogue of chlorapatite. American Mineralogist, 66 (9-10) 1050-1053 |
| ⓘ Scheelite Formula: Ca(WO4) Description: Occurs in a limestone pendant. References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Titantaramellite (TL) Formula: Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx Type Locality: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Walstromite Formula: BaCa2(Si3O9) |
| ⓘ Witherite Formula: BaCO3 References: Rogers, Austin F. (1932) Sanbornite, a new barium silicate mineral from Mariposa County, California. American Mineralogist, 17 (5) 161-172 Newberry, Nancy G., Essene, Eric J., Peacor, and Donald R. (1981) Alforsite, a new member of the apatite group: the barium analogue of chlorapatite. American Mineralogist, 66 (9-10) 1050-1053 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Alforsite | 8.BN.05 | Ba5(PO4)3Cl |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Ferroericssonite | 9.00. | BaFe2+2 Fe3+(Si2O7)O(OH) |
| ⓘ | Fresnoite | 9.BE.15 | Ba2Ti(Si2O7)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Fencooperite (TL) | 9.BH.20 | Ba6Fe3+3Si8O23(CO3)2Cl3 · H2O |
| ⓘ | Benitoite | 9.CA.05 | BaTi(Si3O9) |
| ⓘ | Walstromite | 9.CA.25 | BaCa2(Si3O9) |
| ⓘ | Titantaramellite (TL) | 9.CE.20 | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| ⓘ | Cerchiaraite-(Fe) | 9.CF.25 | Ba4Fe3+4O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Devitoite | 9.DC.05 | Ba4Ba2Fe2+7Fe3+2[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Bigcreekite | 9.DF.30 | BaSi2O5 · 4H2O |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Krauskopfite | 9.DH.30 | BaSi2O5 · 3H2O |
| ⓘ | Pellyite | 9.DO.10 | Ba2CaFe2+2Si6O17 |
| ⓘ | Esquireite | 9.DP.50 | BaSi6O13 · 7H2O |
| ⓘ | Gillespite | 9.EA.05 | BaFe2+Si4O10 |
| ⓘ | Macdonaldite | 9.EB.05 | BaCa4Si16O36(OH)2 · 10H2O |
| ⓘ | Anandite | 9.EC.35 | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| ⓘ | Kinoshitalite | 9.EC.35 | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| ⓘ | Sanbornite (TL) | 9.EF.10 | BaSi2O5 |
| ⓘ | Celsian | 9.FA.30 | Ba(Al2Si2O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| H | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| H | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| H | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| H | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| H | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| H | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| H | ⓘ Esquireite | BaSi6O13 · 7H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Witherite | BaCO3 |
| C | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| C | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| O | Oxygen | |
| O | ⓘ Alforsite | Ba5(PO4)3Cl |
| O | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Benitoite | BaTi(Si3O9) |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Celsian | Ba(Al2Si2O8) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| O | ⓘ Gillespite | BaFe2+Si4O10 |
| O | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| O | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| O | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| O | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Sanbornite | BaSi2O5 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Walstromite | BaCa2(Si3O9) |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| O | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| O | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| O | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| O | ⓘ Esquireite | BaSi6O13 · 7H2O |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Mg | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Celsian | Ba(Al2Si2O8) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | Silicon | |
| Si | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Si | ⓘ Benitoite | BaTi(Si3O9) |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Celsian | Ba(Al2Si2O8) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Si | ⓘ Gillespite | BaFe2+Si4O10 |
| Si | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Si | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Si | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Si | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sanbornite | BaSi2O5 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Walstromite | BaCa2(Si3O9) |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Si | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Si | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Si | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Si | ⓘ Esquireite | BaSi6O13 · 7H2O |
| P | Phosphorus | |
| P | ⓘ Alforsite | Ba5(PO4)3Cl |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| S | Sulfur | |
| S | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Alforsite | Ba5(PO4)3Cl |
| Cl | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Cl | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Cl | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| K | Potassium | |
| K | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Ca | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Walstromite | BaCa2(Si3O9) |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ti | Titanium | |
| Ti | ⓘ Benitoite | BaTi(Si3O9) |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ti | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Mn | Manganese | |
| Mn | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Gillespite | BaFe2+Si4O10 |
| Fe | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Fe | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Fe | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Fe | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Ba | Barium | |
| Ba | ⓘ Alforsite | Ba5(PO4)3Cl |
| Ba | ⓘ Anandite | (Ba,K)(Fe2+,Mg)3((Si,Al,Fe)4O10)(S,OH)2 |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Benitoite | BaTi(Si3O9) |
| Ba | ⓘ Celsian | Ba(Al2Si2O8) |
| Ba | ⓘ Fresnoite | Ba2Ti(Si2O7)O |
| Ba | ⓘ Gillespite | BaFe2+Si4O10 |
| Ba | ⓘ Krauskopfite | BaSi2O5 · 3H2O |
| Ba | ⓘ Kinoshitalite | (Ba,K)(Mg,Mn2+,Al)3(Al2Si2O10)(OH)2 |
| Ba | ⓘ Macdonaldite | BaCa4Si16O36(OH)2 · 10H2O |
| Ba | ⓘ Pellyite | Ba2CaFe22+Si6O17 |
| Ba | ⓘ Sanbornite | BaSi2O5 |
| Ba | ⓘ Titantaramellite | Ba4(Ti,Fe3+,Fe2+,Mg)4(B2Si8O27)O2Clx |
| Ba | ⓘ Walstromite | BaCa2(Si3O9) |
| Ba | ⓘ Witherite | BaCO3 |
| Ba | ⓘ Bigcreekite | BaSi2O5 · 4H2O |
| Ba | ⓘ Fencooperite | Ba6Fe33+Si8O23(CO3)2Cl3 · H2O |
| Ba | ⓘ Devitoite | Ba4Ba2Fe72+Fe23+[Si4O12]2[PO4]2[CO3]O2(OH)4◻2 |
| Ba | ⓘ Ferroericssonite | BaFe22+ Fe3+(Si2O7)O(OH) |
| Ba | ⓘ Cerchiaraite-(Fe) | Ba4Fe43+O3(OH)3(Si4O12)[Si2O3(OH)4]Cl |
| Ba | ⓘ Esquireite | BaSi6O13 · 7H2O |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
Localities in this Region
- California
- Mariposa County
- East Belt
- Clearing House Mining District
- Clearing House
- Clearing House Mining District
- East Belt
- Mariposa County
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Shoofly-Olds Ferry DomainDomain
- Sierra Nevada BatholithVolcanic Arc
USA
- Sierra NevadaMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Trumbull Peak Ba-silicate deposit, Trumbull Peak, Clearing House, Clearing House Mining District, East Belt, Mariposa County, California, USA