This page is currently not sponsored. Click here to sponsor this page.
Type:
Other/historical names associated with this locality:
Gjerrestad
Other Languages:
French:
Gjerstad, Agder, Norvège
German:
Gjerstad, Agder, Norwegen
Italian:
Gjerstad, Agder, Norvegia
Norwegian:
Gjerstad, Agder, Norge
Russian:
Ерстад, Эуст-Агдер, Норвегия
Simplified Chinese:
耶爾斯塔, 阿格德爾, 挪威
Spanish:
Gjerstad, Reino de Agder, Noruega
Albanian:
Gjerstad, Aust-Agder, Norvegjia
Asturian:
Gjerstad, Agder, Noruega
Basque:
Gjerstad, Aust-Agder, Norvegia
Bavarian:
Gjerstad, Aust-Agder, Norwegn
Bishnupriya Manipuri:
জিজেরস্টাড, ঔস্ট-অগ্দের, নরৱে
Catalan:
Gjerstad, Aust-Agder, Noruega
Cebuano:
Gjerstad, Aust-Agder fylke, Norway
Danish:
Gjerstad, Agder, Norge
Dutch:
Gjerstad, Agder, Noorwegen
Esperanto:
Gjerstad, Aust-Agder, Norvegio
Estonian:
Gjerstadi vald, Agder, Norra
Finnish:
Gjerstad, Agder, Norja
Hungarian:
Gjerstad, Aust-Agder megye, Norvégia
Javanese:
Gjerstad, Norwégia
Latin:
Gjerstad, Aust-Agder, Norvegia
Limburgian:
Gjerstad, Aust-Agder, Noorwege
Low Saxon/Low German:
Kommun Gjerstad, Agder, Norwegen
Malay:
Gjerstad, Vest-Agder, Norway
Minnan / Hokkien-Taiwanese:
Gjerstad, Aust-Agder, Lo̍k-ui
Northern Sami:
Gjerstad, Nuorta-Agdera fylka, Norga
Norwegian (Nynorsk):
Gjerstad, Agder, Noreg
Occitan:
Gjerstad, Aust-Agder, Norvègia
Polish:
Gjerstad, Agder, Norwegia
Portuguese:
Gjerstad, Aust-Agder, Noruega
Romanian:
Gjerstad, Aust-Agder, Norvegia
Slovenian:
Gjerstad, Aust-Agder, Norveška
Swahili:
Gjerstad, Aust-Agder, Norwei
Swedish:
Gjerstad, Agder, Norge
Vietnamese:
Gjerstad, Aust-Agder, Na Uy
Waray:
Gjerstad, Aust-Agder, Noruega
From Wikipedia:
"Gjerstad is a municipality in Agder county, Norway. It is located in the traditional region of Sørlandet, in the southeastern part of the county, along the border with Telemark county. The administrative centre of the municipality is the village of Gjerstad. Other villages in the municipality include Ausland, Eikeland, Fiane, Gryting, Østerholt, Rød, Sundebru, and Vestøl."
"Gjerstad is a municipality in Agder county, Norway. It is located in the traditional region of Sørlandet, in the southeastern part of the county, along the border with Telemark county. The administrative centre of the municipality is the village of Gjerstad. Other villages in the municipality include Ausland, Eikeland, Fiane, Gryting, Østerholt, Rød, Sundebru, and Vestøl."
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities37 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase-Albite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Locality: Fone, Gjerstad, Agder, Norway |
| ⓘ 'Almandine-Pyrope Series' Description: Garnet porphyroblasts are common at the locality, forming porphyroblasts up to (and perhaps exceeding) 5 cm. Crude crystals up to about 2-2.5cm could also be found associated with quartz. The garnet is inferred as a almandine-pyrope series based on the geological environment ( upper amphibolite to granulite facies meta-sediments), color ( rose-pink) and specific gravity (~3.9). References: |
| ⓘ 'Almandine-Pyrope Series var. Rhodolite' Formula: Mg3Al2(SiO4)3 |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chernovite-(Y) Formula: Y(AsO4) Description: As inclusion in titanite from a pegmatite References: Hawthorne, Frank C., Groat, Lee A., Raudsepp, Mati, Ball, Neil A., Kimata, Mitsuyoshi, Spike, Felix D., Gaba, G, Halden, Norman M., Lumpkin, Gregory R., Ewing, Rodney C., Greego, Robert B., Lytle, F. W., Ercit, T. Scott, Rossman, George R., Wicks, Frederick J., Ramik, Robert A., Sherriff, Barbara L., Fleet, Michael E., McCammo, Catherine (1991) Alpha-decay damage in titanite. American Mineralogist, 76 (3-4) 370-396 |
| ⓘ Chlorapatite Formula: Ca5(PO4)3Cl Locality: Østerholt, Gjerstad, Agder, Norway |
| ⓘ 'Chlorite Group' |
| ⓘ Clarkeite Formula: (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| ⓘ 'Clinopyroxene Subgroup' |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Cummingtonite Formula: ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ Curite Formula: Pb3(H2O)2[(UO2)4O4(OH)3]2 Locality: Fone, Gjerstad, Agder, Norway Description: One sample of curite labelled "Fone in Gjerstad" are kept in the collections of British Museum (National History). |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ 'Feldspar Group' Localities: Reported from at least 11 localities in this region. |
| ⓘ 'Feldspar Group var. Perthite' |
| ⓘ 'Fergusonite' Description: as inclusion in titanite from a pegmatite |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Fergusonite-(Y) var. Risörite Formula: (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O Description: Identified at the x-ray laboratory of the natural history Museum ,Oslo 1978. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Graphite Formula: C |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ Kasolite Formula: Pb(UO2)(SiO4) · H2O |
| ⓘ 'K Feldspar' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n Habit: lenseshaped nodules and ill-defined crystals Description: about 1 mm in diameter |
| ⓘ Molybdenite Formula: MoS2 Locality: Morka, Gjerstad, Agder, Norway References: |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 9 localities in this region. |
| ⓘ Native Sulphur Formula: S8 Description: Found in a pegmatite |
| ⓘ 'Orthopyroxene Subgroup' |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 References: |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ 'Pyrochlore Group' Formula: A2Nb2(O,OH)6Z Description: as inclusion in titanite from a pegmatite References: Hawthorne, Frank C., Groat, Lee A., Raudsepp, Mati, Ball, Neil A., Kimata, Mitsuyoshi, Spike, Felix D., Gaba, G, Halden, Norman M., Lumpkin, Gregory R., Ewing, Rodney C., Greego, Robert B., Lytle, F. W., Ercit, T. Scott, Rossman, George R., Wicks, Frederick J., Ramik, Robert A., Sherriff, Barbara L., Fleet, Michael E., McCammo, Catherine (1991) Alpha-decay damage in titanite. American Mineralogist, 76 (3-4) 370-396 |
| ⓘ 'Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977)' Formula: (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) Description: as inclusion in titanite from a pegmatite References: Hawthorne, Frank C., Groat, Lee A., Raudsepp, Mati, Ball, Neil A., Kimata, Mitsuyoshi, Spike, Felix D., Gaba, G, Halden, Norman M., Lumpkin, Gregory R., Ewing, Rodney C., Greego, Robert B., Lytle, F. W., Ercit, T. Scott, Rossman, George R., Wicks, Frederick J., Ramik, Robert A., Sherriff, Barbara L., Fleet, Michael E., McCammo, Catherine (1991) Alpha-decay damage in titanite. American Mineralogist, 76 (3-4) 370-396 |
| ⓘ Pyrolusite ? Formula: Mn4+O2 |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 |
| ⓘ 'Pyroxene Group' Formula: ADSi2O6 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Localities: Description: Reported as "black tourmaline" by Bjørlykke 1937 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ 'Synchysite Group' Description: Occurs as powdery fracture-fillings in a mineral possibly being thorogummite. Possible synchisite-(Ce) |
| ⓘ Thorite var. Thorogummite ? Formula: (Th,U)(SiO4)1-x(OH)4x |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O Description: As inclusions in titanite from a pegmatite References: Hawthorne, Frank C., Groat, Lee A., Raudsepp, Mati, Ball, Neil A., Kimata, Mitsuyoshi, Spike, Felix D., Gaba, G, Halden, Norman M., Lumpkin, Gregory R., Ewing, Rodney C., Greego, Robert B., Lytle, F. W., Ercit, T. Scott, Rossman, George R., Wicks, Frederick J., Ramik, Robert A., Sherriff, Barbara L., Fleet, Michael E., McCammo, Catherine (1991) Alpha-decay damage in titanite. American Mineralogist, 76 (3-4) 370-396 |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | 'Pyrochlore Group' | 4.00. | A2Nb2(O,OH)6Z |
| ⓘ | 'var. Uranpyrochlore (of Hogarth 1977)' | 4.00. | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Pyrolusite ? | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ | Curite | 4.GB.55 | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| ⓘ | Clarkeite | 4.GC.05 | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | var. Risörite | 7.GA.05 | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Chernovite-(Y) | 8.AD.35 | Y(AsO4) |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Chlorapatite | 8.BN.05 | Ca5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite var. Thorogummite ? | 9.AD.30 | (Th,U)(SiO4)1-x(OH)4x |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Kasolite | 9.AK.15 | Pb(UO2)(SiO4) · H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Cummingtonite | 9.DE.05 | ◻Mg2Mg5(Si8O22)(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase-Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Almandine-Pyrope Series var. Rhodolite' | - | Mg3Al2(SiO4)3 |
| ⓘ | 'Clinopyroxene Subgroup' | - | |
| ⓘ | 'Almandine-Pyrope Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Fergusonite' | - | |
| ⓘ | 'Orthopyroxene Subgroup' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Synchysite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| H | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| H | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| H | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| H | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Graphite | C |
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Chernovite-(Y) | Y(AsO4) |
| O | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| O | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| O | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| O | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Fergusonite-(Y) | YNbO4 |
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| O | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Almandine-Pyrope Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Na | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Mg | ⓘ Almandine-Pyrope Series | |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Almandine-Pyrope Series | |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cummingtonite | ◻Mg2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Si | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase-Albite | Na(AlSi3O8) |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Almandine-Pyrope Series var. Rhodolite | Mg3Al2(SiO4)3 |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Almandine-Pyrope Series | |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Native Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Chlorapatite | Ca5(PO4)3Cl |
| Ca | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ca | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Ti | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ti | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Almandine-Pyrope Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Chernovite-(Y) | Y(AsO4) |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Chernovite-(Y) | Y(AsO4) |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Y | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
| Nb | ⓘ Pyrochlore Group | A2Nb2(O,OH)6Z |
| Nb | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Nb | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Er | Erbium | |
| Er | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
| Ta | ⓘ Fergusonite-(Y) var. Risörite | (Y,Er)(Nb,Ti,Ta)(O,OH)4 |
| Pb | Lead | |
| Pb | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| Pb | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| Pb | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Th | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | Uranium | |
| U | ⓘ Clarkeite | (Na,Ca,Pb)(UO2)O(OH) · 0-1H2O |
| U | ⓘ Curite | Pb3(H2O)2[(UO2)4O4(OH)3]2 |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
| U | ⓘ Kasolite | Pb(UO2)(SiO4) · H2O |
| U | ⓘ Thorite var. Thorogummite | (Th,U)(SiO4)1-x(OH)4x |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| U | ⓘ Pyrochlore Group var. Uranpyrochlore (of Hogarth 1977) | (Ca,U,Ce)2(Nb,Ti,Ta)2O6(OH,F) |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Gjerstad |
|---|---|
| Wikidata ID: | Q88813 |
| GeoNames ID: | 3155672 |
Localities in this Region
- Agder
- Gjerstad
- Båsvatn Mine
- Båsvatn Quarry
- Borjevassholene Feldspar Quarry
- Brenndalsmo
- Brokelandsheia
- Eikelands Verk
- Fone
- Fone apatite deposit
- Fone Rutile Mines
- Fossbrekke
- Gjerstad - Tvedestrand graphite paragneisses
- Gjerstad mica quarry
- Gjerstadveien roadcut
- Gryting Feldspar Quarry
- Grytting skarn locality
- Huldreheia Quarry
- Lunden
- Mo Quarries
- Gjerstad
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Hawthorne, Frank C., Groat, Lee A., Raudsepp, Mati, Ball, Neil A., Kimata, Mitsuyoshi, Spike, Felix D., Gaba, G, Halden, Norman M., Lumpkin, Gregory R., Ewing, Rodney C., Greego, Robert B., Lytle, F. W., Ercit, T. Scott, Rossman, George R., Wicks, Frederick J., Ramik, Robert A., Sherriff, Barbara L., Fleet, Michael E., McCammo, Catherine (1991) Alpha-decay damage in titanite. American Mineralogist, 76 (3-4) 370-396
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther RegionsReferences
Brokeland feldspar quarry, Brokelandsheia, Gjerstad, Agder, Norway