Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germanyi
| Regional Level Types | |
|---|---|
| Schiltach | Town |
| Rottweil | District |
| Freiburg Region | Region |
| Baden-Württemberg | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Schiltach | 4,025 (2013) |
Other Languages:
German:
Schiltach, Rottweil, Regierungsbezirk Freiburg, Baden-Württemberg, Deutschland
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities55 valid minerals.
Detailed Mineral List:
| ⓘ Acanthite Formula: Ag2S Localities: Johannes Mine, Stammelbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany Isaak's Segen Mine, Reichenbächle, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany Maria Magdalena Mine, Erdlinsbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arseniosiderite Formula: Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Asbolane Formula: (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| ⓘ Bariopharmacosiderite Formula: Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Coffinite Formula: U(SiO4) · nH2O |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Emplectite Formula: CuBiS2 |
| ⓘ Erythrite Formula: Co3(AsO4)2 · 8H2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hörnesite Formula: Mg3(AsO4)2 · 8H2O |
| ⓘ Hydronováčekite Formula: Mg(UO2)2(AsO4)2 · 12H2O |
| ⓘ Langite Formula: Cu4(SO4)(OH)6 · 2H2O |
| ⓘ Lavendulan Formula: NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ 'Limonite' |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Metaheinrichite Formula: Ba(UO2)2(AsO4)2 · 8H2O References: |
| ⓘ Mixite Formula: BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ Native Arsenic Formula: As |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Silver Formula: Ag |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Pharmacolite Formula: Ca(HAsO4) · 2H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ Proustite Formula: Ag3AsS3 Localities: Johannes Mine, Stammelbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany Hilfe Gottes Mine, Stammelbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany Maria Magdalena Mine, Erdlinsbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Realgar Formula: As4S4 |
| ⓘ Safflorite Formula: (Co,Ni,Fe)As2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uraninite var. Pitchblende Formula: UO2 |
| ⓘ 'Wad' |
| ⓘ Walpurgite Formula: (BiO)4(UO2)(AsO4)2 · 2H2O |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Zeunerite Formula: Cu(UO2)2(AsO4)2 · 12H2O |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| ⓘ | Native Arsenic | 1.CA.05 | As |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Safflorite | 2.EB.15a | (Co,Ni,Fe)As2 |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Proustite | 2.GA.05 | Ag3AsS3 |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | Emplectite | 2.HA.05 | CuBiS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Uraninite var. Pitchblende | 4.DL.05 | UO2 |
| ⓘ | 4.DL.05 | UO2 | |
| ⓘ | Asbolane | 4.FL.30 | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Langite | 7.DD.10 | Cu4(SO4)(OH)6 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Erythrite | 8.CE.40 | Co3(AsO4)2 · 8H2O |
| ⓘ | Hörnesite | 8.CE.40 | Mg3(AsO4)2 · 8H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ | Pharmacolite | 8.CJ.50 | Ca(HAsO4) · 2H2O |
| ⓘ | Lavendulan | 8.DG.05 | NaCaCu5(AsO4)4Cl · 5H2O |
| ⓘ | Arseniosiderite | 8.DH.30 | Ca2Fe3+3(AsO4)3O2 · 3H2O |
| ⓘ | Bariopharmacosiderite | 8.DK.10 | Ba0.5Fe3+4(AsO4)3(OH)4 · 5H2O |
| ⓘ | Mixite | 8.DL.15 | BiCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Walpurgite | 8.EA.05 | (BiO)4(UO2)(AsO4)2 · 2H2O |
| ⓘ | Hydronováčekite | 8.EB.05 | Mg(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Zeunerite | 8.EB.05 | Cu(UO2)2(AsO4)2 · 12H2O |
| ⓘ | Metaheinrichite | 8.EB.10 | Ba(UO2)2(AsO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Wad' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| H | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| H | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| H | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| H | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| H | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| H | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| H | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| O | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| O | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| O | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| O | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| O | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| O | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Uraninite var. Pitchblende | UO2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| O | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| Mg | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Al | Aluminium | |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Emplectite | CuBiS2 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Proustite | Ag3AsS3 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| Cl | Chlorine | |
| Cl | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Ca | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mn | Manganese | |
| Mn | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Fe | Iron | |
| Fe | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| Fe | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Co | Cobalt | |
| Co | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Co | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| Co | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Co | ⓘ Skutterudite | CoAs3 |
| Ni | Nickel | |
| Ni | ⓘ Asbolane | (Ni,Co)2-xMn4+(O,OH)4 · nH2O |
| Ni | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Emplectite | CuBiS2 |
| Cu | ⓘ Langite | Cu4(SO4)(OH)6 · 2H2O |
| Cu | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| Cu | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Native Arsenic | As |
| As | ⓘ Arseniosiderite | Ca2Fe33+(AsO4)3O2 · 3H2O |
| As | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| As | ⓘ Erythrite | Co3(AsO4)2 · 8H2O |
| As | ⓘ Hörnesite | Mg3(AsO4)2 · 8H2O |
| As | ⓘ Lavendulan | NaCaCu5(AsO4)4Cl · 5H2O |
| As | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| As | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| As | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Pharmacolite | Ca(HAsO4) · 2H2O |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Proustite | Ag3AsS3 |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Safflorite | (Co,Ni,Fe)As2 |
| As | ⓘ Skutterudite | CoAs3 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| As | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| As | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Proustite | Ag3AsS3 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Native Silver | Ag |
| Sb | Antimony | |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Ba | Barium | |
| Ba | ⓘ Bariopharmacosiderite | Ba0.5Fe43+(AsO4)3(OH)4 · 5H2O |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Emplectite | CuBiS2 |
| Bi | ⓘ Mixite | BiCu6(AsO4)3(OH)6 · 3H2O |
| Bi | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Metaheinrichite | Ba(UO2)2(AsO4)2 · 8H2O |
| U | ⓘ Hydronováčekite | Mg(UO2)2(AsO4)2 · 12H2O |
| U | ⓘ Uraninite var. Pitchblende | UO2 |
| U | ⓘ Uraninite | UO2 |
| U | ⓘ Walpurgite | (BiO)4(UO2)(AsO4)2 · 2H2O |
| U | ⓘ Zeunerite | Cu(UO2)2(AsO4)2 · 12H2O |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- Baden-Württemberg
- Freiburg Region
- Rottweil
- Freiburg Region
- Baden-Württemberg
- Freiburg Region
- Rottweil
- Schiltach
- Rottweil
- Freiburg Region
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
Germany
- Baden-Württemberg
- Black ForestMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Stammelbach valley, Schiltach, Rottweil, Freiburg Region, Baden-Württemberg, Germany