Dannemora Mine, Dannemora, Östhammar, Uppsala County, Swedeni
| Regional Level Types | |
|---|---|
| Dannemora Mine | Deposit |
| Dannemora | Town |
| Östhammar | Municipality |
| Uppsala County | County |
| Sweden | Country |
Dannemora Mine, Uppland Province, Sweden
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
60° 12' 17'' North , 17° 51' 37'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Söderskogen | 363 (2012) | 2.0km |
| Österbybruk | 2,331 (2017) | 2.2km |
| Dannemora | 238 (2012) | 3.4km |
| Upplanda | 222 (2017) | 7.4km |
| Gubbo | 227 (2018) | 7.8km |
Other/historical names associated with this locality:
Dannemora deposit
Other Languages:
Swedish:
Dannemoragruvan, Östhammars kommun, Uppsala län, Sverige
The Dannemora deposit comprises some 25 bodies of magnetite ore, over 3km in length and around 400 to 800 metres in width.
The iron mines also had minor zinc, copper and silver.
Earliest mention as being a silver mine is 1481.
The iron ore is of skarn iron type and hosted in metavolcanics rocks and sediments. The iron ore low in phosphorus and rich in lime and manganese was the base for the high quality steel from the famous Walloon works.
The 25 ore bodies comprise around 50 open-cast mines of which the largest, Storrymningen, is 200 m long and 100 m deep. Closed 1992. Reopened in June 2012 by the company Dannemora Mineral.
Coordinates for the Dannemora mine office.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities43 valid minerals.
Detailed Mineral List:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Calderite | 9.AD.25 | Mn2+3Fe3+2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Ilvaite | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Clino-suenoite | 9.DE. | ◻{Mn2+2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Cummingtonite | 9.DE.05 | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Ferro-actinolite | 9.DE.10 | ◻Ca2Fe2+5(Si8O22)(OH)2 |
| ⓘ | Ferro-hornblende | 9.DE.10 | ◻Ca2(Fe2+4Al)(Si7Al)O22(OH)2 |
| ⓘ | Magnesio-hornblende | 9.DE.10 | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Fluoro-tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)F2 |
| ⓘ | Clino-ferro-suenoite | 9.DE.10 | ◻{Mn2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Pyrosmalite-(Fe) | 9.EE.10 | Fe2+8Si6O15(OH,Cl)10 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Fayalite-Tephroite Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Fayalite-Tephroite Series var. Knebelite' | - | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| ⓘ | 'Serpentine Subgroup' | - | D3[Si2O5](OH)4 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Axinite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| H | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| H | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| H | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| H | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Rhodochrosite | MnCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| O | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| O | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Pyrophanite | Mn2+TiO3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite-Tephroite Series | |
| O | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| O | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Fluoro-tremolite | ◻Ca2Mg5(Si8O22)F2 |
| O | ⓘ Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| O | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | ⓘ Fluoro-tremolite | ◻Ca2Mg5(Si8O22)F2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Mg | ⓘ Fluoro-tremolite | ◻Ca2Mg5(Si8O22)F2 |
| Mg | ⓘ Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Si | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Cummingtonite | ◻{Mg2}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Si | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite-Tephroite Series | |
| Si | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Si | ⓘ Serpentine Subgroup | D3[Si2O5](OH)4 |
| Si | ⓘ Fluoro-tremolite | ◻Ca2Mg5(Si8O22)F2 |
| Si | ⓘ Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Si | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Ca | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Magnesio-hornblende | ◻Ca2(Mg4Al)(Si7Al)O22(OH)2 |
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | ⓘ Fluoro-tremolite | ◻Ca2Mg5(Si8O22)F2 |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Fayalite-Tephroite Series | |
| Mn | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Mn | ⓘ Clino-suenoite | ◻{Mn22+}{Mg5}(Si8O22)(OH)2 |
| Mn | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
| Fe | ⓘ Calderite | Mn32+Fe23+(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferro-actinolite | ◻Ca2Fe52+(Si8O22)(OH)2 |
| Fe | ⓘ Ferro-hornblende | ◻Ca2(Fe42+Al)(Si7Al)O22(OH)2 |
| Fe | ⓘ Pyrosmalite-(Fe) | Fe82+Si6O15(OH,Cl)10 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Fayalite-Tephroite Series | |
| Fe | ⓘ Fayalite-Tephroite Series var. Knebelite | from (Fe1.5Mn0.5)2SiO4 to (Mn1.5Fe0.5)2SiO4 |
| Fe | ⓘ Clino-ferro-suenoite | ◻{Mn22+}{Fe52+}(Si8O22)(OH)2 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Dannemora_mine |
|---|---|
| Wikidata ID: | Q948703 |
Localities in this Region
- Uppsala County
- Östhammar
- Dannemora
- Dannemora Mine
- Dannemora
- Östhammar
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Bergslagen-LivoniaShield
EuropeContinent
ScandinaviaRegion
Sweden
- ⭔Uppland ProvinceProvince
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Sjögren, Hj. (1895) 2. Analyser på axinit från Nordmarken och Dannemora och om axinitens kemiska konstitution [2. Analyses on axinite from Nordmarken and Dannemora and on the chemical constitution of axinite], in Preliminära meddelanden om några undersökningar på svenska mineral. Geologiska Föreningen i Stockholm Förhandlingar, 17 (3). 279-288 doi:10.1080/11035899509442303




Dannemora Mine, Dannemora, Östhammar, Uppsala County, Sweden