Benson, Star Lake, Clifton, St. Lawrence County, New York, USAi
| Regional Level Types | |
|---|---|
| Benson | Group of Hamlets |
| Star Lake | Hamlet |
| Clifton | Town |
| St. Lawrence County | County |
| New York | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° 10' 11'' North , 75° 0' 55'' West
Latitude & Longitude (decimal):
Type:
Group of Hamlets
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Star Lake | 809 (2017) | 1.7km |
| Cranberry Lake | 200 (2017) | 15.4km |
| Harrisville | 622 (2017) | 24.4km |
| Edwards | 439 (2017) | 25.4km |
| Hermon | 406 (2017) | 37.2km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| St. Lawrence County Rock & Mineral Club | Canton, New York | 49km |
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities44 valid minerals.
Detailed Mineral List:
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chamosite Formula: (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ Chrysoberyl Formula: BeAl2O4 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Covellite Formula: CuS |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Dumortierite Formula: Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ 'Feldspar Group' |
| ⓘ 'Feldspar Group var. Sunstone' Description: Sanidine, not albite! |
| ⓘ Ferrohögbomite-2N2S Formula: [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hercynite Formula: Fe2+Al2O4 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Isokite Formula: CaMg(PO4)F |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Sericite ? Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrophyllite Formula: Al2Si4O10(OH)2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Sanidine Formula: K(AlSi3O8) Description: "Sunstone" |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorzalite ? Formula: Fe2+Al2(PO4)2(OH)2 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Strontianite Formula: SrCO3 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Vivianite Formula: Fe2+Fe2+2(PO4)2 · 8H2O |
| ⓘ Wagnerite Formula: Mg2(PO4)F |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Chrysoberyl | 4.BA.05 | BeAl2O4 |
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Ferrohögbomite-2N2S | 4.CB. | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Strontianite | 5.AB.15 | SrCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Scorzalite ? | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Isokite | 8.BH.10 | CaMg(PO4)F |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Vivianite | 8.CE.40 | Fe2+Fe2+2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Dumortierite | 9.AJ.10 | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Pyrophyllite | 9.EC.10 | Al2Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite ? | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Sanidine | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Unclassified | |||
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Feldspar Group var. Sunstone' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Be | Beryllium | |
| Be | ⓘ Chrysoberyl | BeAl2O4 |
| B | Boron | |
| B | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| C | ⓘ Strontianite | SrCO3 |
| O | Oxygen | |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| O | ⓘ Chrysoberyl | BeAl2O4 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Isokite | CaMg(PO4)F |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sanidine | K(AlSi3O8) |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Strontianite | SrCO3 |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Isokite | CaMg(PO4)F |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Mg | Magnesium | |
| Mg | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Isokite | CaMg(PO4)F |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Mg | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Al | Aluminium | |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Al | ⓘ Chrysoberyl | BeAl2O4 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Al | ⓘ Sanidine | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Si | Silicon | |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Si | ⓘ Dumortierite | Al(Al2O)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrophyllite | Al2Si4O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sanidine | K(AlSi3O8) |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Isokite | CaMg(PO4)F |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Covellite | CuS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Sanidine | K(AlSi3O8) |
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Isokite | CaMg(PO4)F |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | (Fe2+,Mg,Al,Fe3+)6(Si,Al)4O10(OH,O)8 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Vivianite | Fe2+Fe22+(PO4)2 · 8H2O |
| Fe | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Covellite | CuS |
| Zn | Zinc | |
| Zn | ⓘ Ferrohögbomite-2N2S | [(Fe2+,Mg,Zn,Al)3(Al,Ti,Fe3+)8O15(OH)]2 |
| Sr | Strontium | |
| Sr | ⓘ Strontianite | SrCO3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Localities in this Region
- New York
- St. Lawrence County
- Clifton
- Star Lake
- Benson
- Star Lake
- Clifton
- St. Lawrence County
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Grenville OrogenyOrogenic Belt
- Shawnee DomainDomain
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Benson Mines, Benson, Star Lake, Clifton, St. Lawrence County, New York, USA