Mt Wills mining district, Glen Valley, East Gippsland Shire, Victoria, Australiai
| Regional Level Types | |
|---|---|
| Mt Wills mining district | Mining District |
| Glen Valley | Town |
| East Gippsland Shire | Shire |
| Victoria | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
36° 50' 27'' South , 147° 31' 8'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Tin- and tantalum-bearing LCT-type granitic pegmatites.
An abandoned tin mining settlement and small workings.
An abandoned tin mining settlement and small workings.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
31 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ Alluaudite Formula: (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Andalusite Formula: Al2(SiO4)O |
| ⓘ Arrojadite-(KFe) Formula: (KNa)(Fe2+◻)Ca(Na2◻)Fe2+13Al(PO4)11(PO3OH)(OH)2 |
| ⓘ Bertossaite Formula: Li2CaAl4(PO4)4(OH)4 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Brazilianite Formula: NaAl3(PO4)2(OH)4 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cordierite Formula: Mg2Al4Si5O18 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Heterosite Formula: Fe3+(PO4) |
| ⓘ 'Jahnsite Group' Formula: XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ 'K Feldspar' |
| ⓘ Lazulite Formula: MgAl2(PO4)2(OH)2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Miargyrite Formula: AgSbS2 |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Phosphoferrite Formula: (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| ⓘ Phosphosiderite Formula: FePO4 · 2H2O |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rockbridgeite Formula: (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Formula: Fe2+Al2(PO4)2(OH)2 Description: A corrigendum was issued indicating that the references to the mineral name scorzalite should be replaced by lazulite throughout the text and in Table 2.
|
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Strengite Formula: FePO4 · 2H2O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Triplite Formula: Mn2+2(PO4)F |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ 'Whiteite Subgroup' Formula: XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ Whitmoreite Formula: Fe2+Fe3+2(PO4)2(OH)2 · 4H2O |
| ⓘ Wolfeite Formula: Fe2+2(PO4)(OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Miargyrite | 2.HA.10 | AgSbS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Heterosite | 8.AB.10 | Fe3+(PO4) |
| ⓘ | Alluaudite | 8.AC.10 | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Triplite | 8.BB.10 | Mn2+2(PO4)F |
| ⓘ | Wolfeite | 8.BB.15 | Fe2+2(PO4)(OH) |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Scorzalite ? | 8.BB.40 | Fe2+Al2(PO4)2(OH)2 |
| ⓘ | Rockbridgeite | 8.BC.10 | (Fe2+0.5Fe3+0.5)2Fe3+3(PO4)3(OH)5 |
| ⓘ | Arrojadite-(KFe) | 8.BF.05 | (KNa)(Fe2+◻)Ca(Na2◻)Fe2+13Al(PO4)11(PO3OH)(OH)2 |
| ⓘ | Bertossaite | 8.BH.25 | Li2CaAl4(PO4)4(OH)4 |
| ⓘ | Brazilianite | 8.BK.05 | NaAl3(PO4)2(OH)4 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Phosphoferrite | 8.CC.05 | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| ⓘ | Phosphosiderite | 8.CD.05 | FePO4 · 2H2O |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Whitmoreite | 8.DC.15 | Fe2+Fe3+2(PO4)2(OH)2 · 4H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Andalusite | 9.AF.10 | Al2(SiO4)O |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Cordierite | 9.CJ.10 | Mg2Al4Si5O18 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Whiteite Subgroup' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
| ⓘ | 'Jahnsite Group' | - | XM1M22M32(H2O)8(OH)2(PO4)4 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| H | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phosphosiderite | FePO4 · 2H2O |
| H | ⓘ Phosphoferrite | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| H | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| H | ⓘ Strengite | FePO4 · 2H2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| H | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| H | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| H | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| Li | Lithium | |
| Li | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| O | ⓘ Andalusite | Al2(SiO4)O |
| O | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cordierite | Mg2Al4Si5O18 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Heterosite | Fe3+(PO4) |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Phosphosiderite | FePO4 · 2H2O |
| O | ⓘ Phosphoferrite | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Triplite | Mn22+(PO4)F |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| O | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| O | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Triplite | Mn22+(PO4)F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Na | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| Na | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Cordierite | Mg2Al4Si5O18 |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Andalusite | Al2(SiO4)O |
| Al | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| Al | ⓘ Cordierite | Mg2Al4Si5O18 |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andalusite | Al2(SiO4)O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Cordierite | Mg2Al4Si5O18 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| P | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| P | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| P | ⓘ Brazilianite | NaAl3(PO4)2(OH)4 |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Heterosite | Fe3+(PO4) |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Phosphosiderite | FePO4 · 2H2O |
| P | ⓘ Phosphoferrite | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| P | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| P | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Triplite | Mn22+(PO4)F |
| P | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| P | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| P | ⓘ Whiteite Subgroup | XM1M22M32(H2O)8(OH)2(PO4)4 |
| P | ⓘ Jahnsite Group | XM1M22M32(H2O)8(OH)2(PO4)4 |
| S | Sulfur | |
| S | ⓘ Miargyrite | AgSbS2 |
| K | Potassium | |
| K | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Ca | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| Ca | ⓘ Bertossaite | Li2CaAl4(PO4)4(OH)4 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Mn | ⓘ Phosphoferrite | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Triplite | Mn22+(PO4)F |
| Fe | Iron | |
| Fe | ⓘ Alluaudite | (Na,Ca)Mn2+(Fe3+,Mn2+,Fe2+,Mg)2(PO4)3 |
| Fe | ⓘ Arrojadite-(KFe) | (KNa)(Fe2+◻)Ca(Na2◻)Fe132+Al(PO4)11(PO3OH)(OH)2 |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Heterosite | Fe3+(PO4) |
| Fe | ⓘ Phosphosiderite | FePO4 · 2H2O |
| Fe | ⓘ Phosphoferrite | (Fe2+,Mn2+)3(PO4)2 · 3H2O |
| Fe | ⓘ Rockbridgeite | (Fe2+0.5Fe3+0.5)2Fe33+(PO4)3(OH)5 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorzalite | Fe2+Al2(PO4)2(OH)2 |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Whitmoreite | Fe2+Fe23+(PO4)2(OH)2 · 4H2O |
| Fe | ⓘ Wolfeite | Fe22+(PO4)(OH) |
| Cu | Copper | |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Ag | Silver | |
| Ag | ⓘ Miargyrite | AgSbS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sb | Antimony | |
| Sb | ⓘ Miargyrite | AgSbS2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
Mindat Articles
Pegmatite dykes of the Mount Wills district, northeastern Victoria, Australia by Ryan EagleOther Regions, Features and Areas containing this locality
Australia
- Great Dividing RangeMountain Range
- Lachlan OrogenOrogen
- Central NSW - Omeo ProvinceGeologic Province
- Victoria
- East Gippsland Shire
- Glen Wills goldfieldMining Field
- East Gippsland Shire
Australian PlateTectonic Plate
- Lachlan Fold BeltOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Mt Wills mining district, Glen Valley, East Gippsland Shire, Victoria, Australia