Puttapa, Pastoral Unincorporated Area, South Australia, Australiai
| Regional Level Types | |
|---|---|
| Puttapa | Locality (Australia) |
| Pastoral Unincorporated Area | Unincorporated Area |
| South Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Other/historical names associated with this locality:
Puttapa Station
The Puttapa listing has been kept due to the significant and historical references used for the surrounding mines. Puttapa itself is not a locality, the name comes from ‘Puttapa Creek’, which runs through the area.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities47 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Adamite Formula: Zn2(AsO4)(OH) |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Arsendescloizite Formula: PbZn(AsO4)(OH) References: |
| ⓘ Austinite Formula: CaZn(AsO4)(OH) Description: First noted in October 1976, by members of I.M.A. after their 'Excursion of the Flinders Ranges, Olary and Broken Hill Areas'. The trip was held in conjunction with the 10th International Mineralogical Conference, Sydney Australia. It was later confirmed by P. Elliott as being common at this locality. References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Baumhauerite ? Formula: Pb12As16S36 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Calcite var. Manganese-bearing Calcite Formula: (Ca,Mn)CO3 |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chalcophanite Formula: ZnMn4+3O7 · 3H2O References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Coronadite Formula: Pb(Mn4+6Mn3+2)O16 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: Grubb, P. L. C. (1971) Mineralogy and genesis of the Beltana zinc‐lead deposit, Puttapa, South Australia. Journal of the Geological Society of Australia, 18 (2) 165-171 doi:10.1080/00167617108728755 |
| ⓘ Doloresite ? Formula: V4+3O4(OH)4 |
| ⓘ Dufrénoysite ? Formula: Pb2As2S5 |
| ⓘ Duftite Formula: PbCu(AsO4)(OH) |
| ⓘ Finnemanite ? Formula: Pb5(AsO3)3Cl Description: Peter Elliott studied the deposit and considers this one very doubtful. |
| ⓘ Galena Formula: PbS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hedyphane Formula: Ca2Pb3(AsO4)3Cl |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hetaerolite var. Hydrohetaerolite Formula: Zn(Mn,◻)2(O,OH)4 |
| ⓘ Hollandite Formula: Ba(Mn4+6Mn3+2)O16 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Köttigite Formula: Zn3(AsO4)2 · 8H2O |
| ⓘ Larsenite Formula: PbZnSiO4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ 'Manganese Oxides' References: |
| ⓘ 'Manganese Oxides var. Manganese Dendrites' References: |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Olivenite Formula: Cu2(AsO4)(OH) |
| ⓘ Parasymplesite Formula: Fe2+3(AsO4)2 · 8H2O |
| ⓘ Puttapaite (TL) Formula: Pb2Mn2+2ZnCr3+4O2(AsO4)4(OH)6 · 12H2O Type Locality: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl Description: Arsenian variety. |
| ⓘ Quartz Formula: SiO2 References: Muller, D. W. (1972) The Geology of the Beltana Willemite Deposits. Economic Geology, 67 (8) 1146-1167 doi:10.2113/gsecongeo.67.8.1146 |
| ⓘ Rhodochrosite Formula: MnCO3 |
| ⓘ Scholzite ? Formula: CaZn2(PO4)2 · 2H2O References: |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tilasite Formula: CaMg(AsO4)F |
| ⓘ Tsumcorite Formula: PbZn2(AsO4)2 · 2H2O Description: Dark reddish, Mn-rich varieties are also known (A. Pring and U. Kolitsch, unpubl. data) References: |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl |
| ⓘ Vanadinite var. Arsenic-bearing Vanadinite Formula: Pb5[(V,As)O4]3Cl |
| ⓘ 'Wad' |
| ⓘ Willemite Formula: Zn2SiO4 Description: Main ore mineral. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Baumhauerite ? | 2.HC.05b | Pb12As16S36 |
| ⓘ | Dufrénoysite ? | 2.HC.05d | Pb2As2S5 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | var. Hydrohetaerolite | 4.BB.10 | Zn(Mn,◻)2(O,OH)4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Coronadite | 4.DK.05a | Pb(Mn4+6Mn3+2)O16 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Hollandite | 4.DK.05a | Ba(Mn4+6Mn3+2)O16 |
| ⓘ | Chalcophanite | 4.FL.20 | ZnMn4+3O7 · 3H2O |
| ⓘ | Doloresite ? | 4.HE.30 | V4+3O4(OH)4 |
| ⓘ | Finnemanite ? | 4.JB.45 | Pb5(AsO3)3Cl |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | var. Manganese-bearing Calcite | 5.AB.05 | (Ca,Mn)CO3 |
| ⓘ | Rhodochrosite | 5.AB.05 | MnCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Tilasite | 8.BB. | CaMg(AsO4)F |
| ⓘ | Adamite | 8.BB.30 | Zn2(AsO4)(OH) |
| ⓘ | Olivenite | 8.BB.30 | Cu2(AsO4)(OH) |
| ⓘ | Arsendescloizite | 8.BH.35 | PbZn(AsO4)(OH) |
| ⓘ | Austinite | 8.BH.35 | CaZn(AsO4)(OH) |
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Vanadinite var. Arsenic-bearing Vanadinite | 8.BN.05 | Pb5[(V,As)O4]3Cl |
| ⓘ | Hedyphane | 8.BN.05 | Ca2Pb3(AsO4)3Cl |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Scholzite ? | 8.CA.45 | CaZn2(PO4)2 · 2H2O |
| ⓘ | Köttigite | 8.CE.40 | Zn3(AsO4)2 · 8H2O |
| ⓘ | Parasymplesite | 8.CE.40 | Fe2+3(AsO4)2 · 8H2O |
| ⓘ | Tsumcorite | 8.CG.15 | PbZn2(AsO4)2 · 2H2O |
| ⓘ | Puttapaite (TL) | 8.DK. | Pb2Mn2+2ZnCr3+4O2(AsO4)4(OH)6 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Larsenite | 9.AB.10 | PbZnSiO4 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Wad' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Adamite | Zn2(AsO4)(OH) |
| H | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| H | ⓘ Austinite | CaZn(AsO4)(OH) |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Doloresite | V34+O4(OH)4 |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Olivenite | Cu2(AsO4)(OH) |
| H | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| H | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| H | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| H | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rhodochrosite | MnCO3 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Adamite | Zn2(AsO4)(OH) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| O | ⓘ Austinite | CaZn(AsO4)(OH) |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| O | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Doloresite | V34+O4(OH)4 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Vanadinite var. Arsenic-bearing Vanadinite | Pb5[(V,As)O4]3Cl |
| O | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| O | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| O | ⓘ Larsenite | PbZnSiO4 |
| O | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Olivenite | Cu2(AsO4)(OH) |
| O | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodochrosite | MnCO3 |
| O | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Tilasite | CaMg(AsO4)F |
| O | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| F | Fluorine | |
| F | ⓘ Tilasite | CaMg(AsO4)F |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Tilasite | CaMg(AsO4)F |
| Al | Aluminium | |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Larsenite | PbZnSiO4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| P | Phosphorus | |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Baumhauerite | Pb12As16S36 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Dufrénoysite | Pb2As2S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Vanadinite var. Arsenic-bearing Vanadinite | Pb5[(V,As)O4]3Cl |
| Cl | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| Cl | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| K | Potassium | |
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Austinite | CaZn(AsO4)(OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Ca | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Ca | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| Ca | ⓘ Tilasite | CaMg(AsO4)F |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Doloresite | V34+O4(OH)4 |
| V | ⓘ Vanadinite var. Arsenic-bearing Vanadinite | Pb5[(V,As)O4]3Cl |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| Mn | Manganese | |
| Mn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Mn | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Mn | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Mn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Mn | ⓘ Calcite var. Manganese-bearing Calcite | (Ca,Mn)CO3 |
| Mn | ⓘ Rhodochrosite | MnCO3 |
| Mn | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Olivenite | Cu2(AsO4)(OH) |
| Zn | Zinc | |
| Zn | ⓘ Adamite | Zn2(AsO4)(OH) |
| Zn | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Zn | ⓘ Austinite | CaZn(AsO4)(OH) |
| Zn | ⓘ Chalcophanite | ZnMn34+O7 · 3H2O |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hetaerolite var. Hydrohetaerolite | Zn(Mn,◻)2(O,OH)4 |
| Zn | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| Zn | ⓘ Larsenite | PbZnSiO4 |
| Zn | ⓘ Scholzite | CaZn2(PO4)2 · 2H2O |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| As | Arsenic | |
| As | ⓘ Adamite | Zn2(AsO4)(OH) |
| As | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| As | ⓘ Austinite | CaZn(AsO4)(OH) |
| As | ⓘ Baumhauerite | Pb12As16S36 |
| As | ⓘ Dufrénoysite | Pb2As2S5 |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Vanadinite var. Arsenic-bearing Vanadinite | Pb5[(V,As)O4]3Cl |
| As | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| As | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| As | ⓘ Köttigite | Zn3(AsO4)2 · 8H2O |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| As | ⓘ Olivenite | Cu2(AsO4)(OH) |
| As | ⓘ Parasymplesite | Fe32+(AsO4)2 · 8H2O |
| As | ⓘ Tilasite | CaMg(AsO4)F |
| As | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| As | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Hollandite | Ba(Mn64+Mn23+)O16 |
| Pb | Lead | |
| Pb | ⓘ Arsendescloizite | PbZn(AsO4)(OH) |
| Pb | ⓘ Baumhauerite | Pb12As16S36 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Coronadite | Pb(Mn64+Mn23+)O16 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Dufrénoysite | Pb2As2S5 |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Vanadinite var. Arsenic-bearing Vanadinite | Pb5[(V,As)O4]3Cl |
| Pb | ⓘ Finnemanite | Pb5(AsO3)3Cl |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hedyphane | Ca2Pb3(AsO4)3Cl |
| Pb | ⓘ Larsenite | PbZnSiO4 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Tsumcorite | PbZn2(AsO4)2 · 2H2O |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Puttapaite | Pb2Mn22+ZnCr43+O2(AsO4)4(OH)6 · 12H2O |
Fossils
There are 253 fossil localities from the PaleoBioDB database within this region.These data are provided on an experimental basis and are taken from external databases. Mindat.org has no control currently over the accuracy of these data.
| Occurrences | 253 | ||||||
|---|---|---|---|---|---|---|---|
| Youngest Fossil Listed | 513 Ma (Cambrian) | ||||||
| Oldest Fossil Listed | 520 Ma (Cambrian) | ||||||
| Stratigraphic Units |
| ||||||
| Fossils from Region | Click here to show the list. | ||||||
| Fossil Localities | Click to show 3 fossil localities |
Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Puttapa |
|---|---|
| Wikidata ID: | Q24090229 |
Localities in this Region
- South Australia
- Pastoral Unincorporated Area
- Puttapa
- Pastoral Unincorporated Area
Other Regions, Features and Areas that Intersect
Australia
- Adelaide SuperbasinBasin
- Arrowie BasinBasin
- Delamerian OrogenOrogen
- South Australia
- Flinders RangesMountain Range
Australian PlateTectonic Plate
- South Australian Craton
- Adelaide Rift ComplexOrogenic Belt
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions





Copper King Mine, Puttapa, Pastoral Unincorporated Area, South Australia, Australia