Stratford, Fairfield County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Stratford | Town |
| Fairfield County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Stratford | 51,384 (2017) |
Other/historical names associated with this locality:
Pequannock; Cupheag
Stratford is a town founded by European settlers in 1639 as Pequannock and then as Cupheag in 1640. It became known as Stratford in 1643 to honor William Shakespeare's birthplace in England. Stratford was one of the two principal settlements in southwestern Connecticut, the other being Fairfield. Over time it gave rise to several new towns that broke off and incorporated separately. This is important relative to the proper localities of late 18th to early 19th century mineral finds and their documentation. The following towns were created from parts of Stratford:
Shelton (originally Ripton) in 1789. In 1789 Ripton Parish separated from Stratford and became the Town of Huntington.
Monroe created from Huntington in 1823.
Nichols (originally Unity in 1725, then North Stratford in 1744).
Long Hill, (merged with Unity to form North Stratford in 1744).
Trumbull, North Stratford separated from Stratford and became the town of Trumbull in 1797.
Bridgeport (also partly from Fairfield) in 1821.
Shelton (originally Ripton) in 1789. In 1789 Ripton Parish separated from Stratford and became the Town of Huntington.
Monroe created from Huntington in 1823.
Nichols (originally Unity in 1725, then North Stratford in 1744).
Long Hill, (merged with Unity to form North Stratford in 1744).
Trumbull, North Stratford separated from Stratford and became the town of Trumbull in 1797.
Bridgeport (also partly from Fairfield) in 1821.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 Localities: Habit: tabular Colour: red, brown, yellow Description: Clear, sharp micro crystals. |
| ⓘ Anhydrite Formula: CaSO4 |
| ⓘ Antigorite Formula: Mg3(Si2O5)(OH)4 Habit: massive Colour: dark yellowish-green Description: Described by Dana as occurring at "Oldfield Rock" near Stratford Landing, an place name no longer used and now somewhere between the former Vought (AVCO) plant and the Marine Basin. The outcrop is long covered, but based on descriptions by Percival (1842), was similar to those in Milford, Orange (see http://www.mindat.org/loc-227940.html) and West Haven and represents serpentinized lower oceanic crust. |
| ⓘ Aragonite Formula: CaCO3 Habit: oriented overgrowths on calcite |
| ⓘ Calcite Formula: CaCO3 Localities: Habit: tabular Description: Micro crystals. |
| ⓘ Chalcopyrite Formula: CuFeS2 Description: Micro crystals. |
| ⓘ 'Chlorite Group' Habit: vermiform and radiating Description: Micro crystals. References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: |
| ⓘ 'Fayalite-Forsterite Series' |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Helvine Formula: Be3Mn2+4(SiO4)3S Habit: tetrahedral, slightly cavernous showing trigonal indentations Colour: honey-brown Description: Two parallel-intergrown, translucent, 0.8mm crystals found on a single specimen associated with the other common site minerals. Crystal faces are slightly pitted with sub-vitreous luster, dusted with a small amount of sugary white alteration. Shows no fluoresence. Specimen is in the Yale Peabody Museum collection. |
| ⓘ 'Hypersthene' Formula: (Mg,Fe)SiO3 |
| ⓘ 'K Feldspar' Description: Micro crystals. References: |
| ⓘ 'K Feldspar var. Adularia' Formula: KAlSi3O8 Description: Micro crystals. References: |
| ⓘ 'Lanthanite' ? Formula: REE3+2(CO3)3 · 8H2O Habit: rectangular, blocky Colour: colorless Description: A single microcrystal specimen from the Bill Henderson micromount collection is held by the Yale Peabody Museum. Harold Moritz examined it on October 16, 2025. It consists of a 1mm cluster of very clear, pearly, colorless crystals sandwiched between some yellow mica in the typical Alpine-type clefts at this locality. The crystals appear rectangular and blocky (apparently orthorhombic) with some striations parallel to their long axes.
Some kind of analysis was apparently done because a label on the micromount box reads:
Lanthanite
Stratford
Conn
Analysis indices fit
A second small label says:
n[?] 1.573
> 1.573
Are these RI values? References: Yale Peabody Museum - Bill Henderson micromount collectionIdentification: Dealer/Collection Label |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) Description: Not analysed; may be questionable [Uwe Kolitsch]. References: |
| ⓘ 'Limonite' References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Description: Micro crystals. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 Description: Micro crystals. |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Orthoclase Formula: K(AlSi3O8) References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Habit: elongated prisms Colour: red Description: Tiny striated,elongated microcrystals with muscovite in vuggy albite. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Sphalerite Formula: ZnS Description: Micro crystals. |
| ⓘ 'Synchysite' Formula: Ca(Ce/Nd/Y/REE)(CO3)2F References: |
| ⓘ Titanite Formula: CaTiO(SiO4) Habit: wedge-shaped Colour: tan Description: Microcrystals in Alpine-type clefts with adularia, quartz, chlorite, etc. References: |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anhydrite | 7.AD.30 | CaSO4 |
| Group 9 - Silicates | |||
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Antigorite | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Helvine | 9.FB.10 | Be3Mn2+4(SiO4)3S |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Hypersthene' | - | (Mg,Fe)SiO3 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Fayalite-Forsterite Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Lanthanite' ? | - | REE3+2(CO3)3 · 8H2O |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| Be | Beryllium | |
| Be | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Anhydrite | CaSO4 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| O | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Fayalite-Forsterite Series | |
| O | ⓘ Lanthanite | REE23+(CO3)3 · 8H2O |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Mg | ⓘ Fayalite-Forsterite Series | |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Si | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Fayalite-Forsterite Series | |
| S | Sulfur | |
| S | ⓘ Anhydrite | CaSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Anhydrite | CaSO4 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Mn | Manganese | |
| Mn | ⓘ Helvine | Be3Mn42+(SiO4)3S |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hypersthene | (Mg,Fe)SiO3 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Fayalite-Forsterite Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Stratford,_Connecticut |
|---|---|
| Wikidata ID: | Q755140 |
| GeoNames ID: | 4843824 |
Localities in this Region
- Connecticut
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Lord Chamberlain Nursing and Rehabilitation Center, Stratford, Fairfield County, Connecticut, USA