Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austriai
| Regional Level Types | |
|---|---|
| Ganz valley | Valley |
| Langenwang | Municipality |
| Bruck-Mürzzuschlag District | District |
| Styria | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
47° 34' 33'' North , 15° 41' 25'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other Languages:
German:
Ganztal (Ganzgraben), Langenwang, Bezirk Bruck-Mürzzuschlag, Steiermark, Österreich
Boulders and possible outcrop (most time buried!) of lazulite-quartz veins. Located in the Ganz valley, ca. 3 km east of Hönigsberg and ca. 3 km south of Mürzzuschlag, immediately above a forest road, at an elevation of 940 m asl. Last visit by FB: 2. August 2010.
For locality map see https://www.mindat.org/photo-124734.html
A small boulder with dark blue lazulite in quartz was found at June 26, 2005 in a ditch dug for a high-voltage cable, about 200 m NNW of Ganz valley lazulite locality, at an elevation of 890 m asl.
For locality map see https://www.mindat.org/photo-124734.html
A small boulder with dark blue lazulite in quartz was found at June 26, 2005 in a ditch dug for a high-voltage cable, about 200 m NNW of Ganz valley lazulite locality, at an elevation of 890 m asl.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Augelite Formula: Al2(PO4)(OH)3 Description: with lazulite References: |
| ✪ Bearthite Formula: Ca2Al(PO4)2(OH) Habit: subhedral to anhedral, partly broken crystals in quartz Colour: slighly yellowish to light grey Fluorescence: none Description: molar Ca/(Ca+Sr) > 0.95 - 0.90. References: |
| ⓘ Cacoxenite Formula: Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| ⓘ 'Chlorite Group' |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ Crandallite Formula: CaAl3(PO4)(PO3OH)(OH)6 Description: between lazulite grains with goyazite References: |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ Florencite-(La) Formula: LaAl3(PO4)2(OH)6 Description: Tiny grains (<< 0.1 mm) in apatite. |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 Description: between lazulite grains with crandallite References: |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ✪ Lazulite Formula: MgAl2(PO4)2(OH)2 Colour: pale to medium blue Description: masses with quartz, apatite, muscovite References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Pretulite Formula: Sc(PO4) Habit: up to 0.1 mm large grains in lazulite References: |
| ⓘ Pyrite Formula: FeS2 Description: cm-sized masses with lazulite, apatite; micron-sized grains in apatite and lazulite References: |
| ⓘ Quartz Formula: SiO2 Localities: Colour: white Description: massive vein quartz |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Strengite Formula: FePO4 · 2H2O References: |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z References: |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Pretulite | 8.AD.35 | Sc(PO4) |
| ⓘ | Lazulite | 8.BB.40 | MgAl2(PO4)2(OH)2 |
| ⓘ | Augelite | 8.BE.05 | Al2(PO4)(OH)3 |
| ⓘ | Bearthite | 8.BG.05 | Ca2Al(PO4)2(OH) |
| ⓘ | Crandallite | 8.BL.10 | CaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| ⓘ | Florencite-(La) | 8.BL.13 | LaAl3(PO4)2(OH)6 |
| ⓘ | Strengite | 8.CD.10 | FePO4 · 2H2O |
| ⓘ | Cacoxenite | 8.DC.40 | Fe3+24AlO6(PO4)17(OH)12 · 75H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Augelite | Al2(PO4)(OH)3 |
| H | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| H | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Strengite | FePO4 · 2H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Augelite | Al2(PO4)(OH)3 |
| O | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| O | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Strengite | FePO4 · 2H2O |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Pretulite | Sc(PO4) |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| Na | Sodium | |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Augelite | Al2(PO4)(OH)3 |
| Al | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Al | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Augelite | Al2(PO4)(OH)3 |
| P | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| P | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| P | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Lazulite | MgAl2(PO4)2(OH)2 |
| P | ⓘ Strengite | FePO4 · 2H2O |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Pretulite | Sc(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Crandallite | CaAl3(PO4)(PO3OH)(OH)6 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Sc | Scandium | |
| Sc | ⓘ Pretulite | Sc(PO4) |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Cacoxenite | Fe243+AlO6(PO4)17(OH)12 · 75H2O |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Strengite | FePO4 · 2H2O |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ba | Barium | |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| La | Lanthanum | |
| La | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Ce | Cerium | |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
Localities in this Region
- Styria
- Bruck-Mürzzuschlag District
- Langenwang
- Ganz valley
- Langenwang
- Bruck-Mürzzuschlag District
Other Regions, Features and Areas containing this locality
Austria
- Styria
- Fischbach AlpsMountain Range
Eurasian PlateTectonic Plate
- Panonian BasinWide Rift
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Ganz valley, Langenwang, Bruck-Mürzzuschlag District, Styria, Austria