Chakabeishan rare-element pegmatites, Tianjun County, Haixi Mongol and Tibetan Autonomous Prefecture, Qinghai, Chinai
| Regional Level Types | |
|---|---|
| Chakabeishan rare-element pegmatites | Pegmatite |
| Tianjun County | County |
| Haixi Mongol and Tibetan Autonomous Prefecture | Prefecture |
| Qinghai | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
36° 58' 30'' North , 99° 1' 0'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other/historical names associated with this locality:
Chaqiabeishan
The Chakabeishan pegmatite dikes are irregularly distributed along the northern side of the Zongwulongshan Southern Margin Fault, and occur as lenses and veins with widths of 1–6 m and lengths of 5–60 m. The rare-element pegmatites can be divided into barren, spodumene, and lepidolite pegmatites, based on mineralogy. The spodumene pegmatites are further divided into A- and B-type spodumene pegmatites, mainly according to the different wall rocks.
There are ca. 800 LCT-type pegmatite dykes in the CKBS deposit, which were derived from high fractional crystallization of granitic magmas. These pegmatite dykes occurred in the Paleoproterozoic Dakendaban Group schist Formation and the Ordovician quartz diorite. The elongation of these pegmatites varies but generally shows NW-SE trending with varying dipping (23°–83°). These pegmatite dykes are ca. 10–400 m in length and ca. 0.5–5 m in width. Since its first discovery in 2018, Li-Be resources of ca. 14,200 t Li2O and ca. 7000 t BeO have been identified.
(1) Mineralization Belt Ⅰ: The pegmatite belt is distributed in a northwest-southeast direction and is located in the GA21 anomaly site, and it spans approximately 1 km in length and 200 m in width. The surrounding rocks are quartz diorite, and 29 granitic pegmatite dikes were delineated, out of which 17 are ore-bearing pegmatite dikes.
(2) Mineralization Belt Ⅱ: The pegmatite belt is distributed in a northwest-southeast direction and is located on the southern side of Mineralization Belt Ⅰ. It stretches approximately 7 km in length and is 200–700 m in width. The surrounding rocks consist of grayish-brown two-mica quartz schist. A total of 144 pegmatite dikes were delineated, with 60 of them being ore-bearing pegmatite dikes.
(3) Mineralization Belt Ⅲ: The pegmatite belt is distributed in a northwest direction and is located on the south side of the mineralization belt Ⅱ, it stretches for about 7 km in length and is 300–500 m in width. The surrounding rocks primarily consist of mylonitic quartz diorite, along with two-mica quartz schist. A total of 115 pegmatite dikes were delineated, predominantly white granitic pegmatites. These pegmatite dikes generally dip to the northeast and extend approximately 50–150 m on the surface. And only 14 ore-bearing pegmatite dikes are delineated.
There are ca. 800 LCT-type pegmatite dykes in the CKBS deposit, which were derived from high fractional crystallization of granitic magmas. These pegmatite dykes occurred in the Paleoproterozoic Dakendaban Group schist Formation and the Ordovician quartz diorite. The elongation of these pegmatites varies but generally shows NW-SE trending with varying dipping (23°–83°). These pegmatite dykes are ca. 10–400 m in length and ca. 0.5–5 m in width. Since its first discovery in 2018, Li-Be resources of ca. 14,200 t Li2O and ca. 7000 t BeO have been identified.
(1) Mineralization Belt Ⅰ: The pegmatite belt is distributed in a northwest-southeast direction and is located in the GA21 anomaly site, and it spans approximately 1 km in length and 200 m in width. The surrounding rocks are quartz diorite, and 29 granitic pegmatite dikes were delineated, out of which 17 are ore-bearing pegmatite dikes.
(2) Mineralization Belt Ⅱ: The pegmatite belt is distributed in a northwest-southeast direction and is located on the southern side of Mineralization Belt Ⅰ. It stretches approximately 7 km in length and is 200–700 m in width. The surrounding rocks consist of grayish-brown two-mica quartz schist. A total of 144 pegmatite dikes were delineated, with 60 of them being ore-bearing pegmatite dikes.
(3) Mineralization Belt Ⅲ: The pegmatite belt is distributed in a northwest direction and is located on the south side of the mineralization belt Ⅱ, it stretches for about 7 km in length and is 300–500 m in width. The surrounding rocks primarily consist of mylonitic quartz diorite, along with two-mica quartz schist. A total of 115 pegmatite dikes were delineated, predominantly white granitic pegmatites. These pegmatite dikes generally dip to the northeast and extend approximately 50–150 m on the surface. And only 14 ore-bearing pegmatite dikes are delineated.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities24 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Lithiophilite | 8.AB.10 | LiMn2+PO4 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Eucryptite | 9.AA.05 | LiAlSiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Pezzottaite-(Cs) | 9.CJ.60 | Cs(Be2Li)Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Siderophyllite | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Calcium Amphibole Subgroup var. Hornblende' | - | AnCa2(Z2+5-mZ3+m)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Zinnwaldite' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Calcium Amphibole Subgroup' | - | AnCa2(C2+5-mC3+m)(Si8-(n+m)Al(n+m))W2 |
| ⓘ | 'Columbite Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Zinnwaldite | |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Eucryptite | LiAlSiO4 |
| Li | ⓘ Lithiophilite | LiMn2+PO4 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Zinnwaldite | |
| Li | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eucryptite | LiAlSiO4 |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| O | ⓘ Lithiophilite | LiMn2+PO4 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| F | ⓘ Zinnwaldite | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eucryptite | LiAlSiO4 |
| Al | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Zinnwaldite | |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Al | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Al | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Eucryptite | LiAlSiO4 |
| Si | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Si | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Lithiophilite | LiMn2+PO4 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| Cl | Chlorine | |
| Cl | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Zinnwaldite | |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Calcium Amphibole Subgroup var. Hornblende | AnCa2(Z2+5-mZm3+)(Si8-(n+m)Al(n+m))(OH,F,Cl)2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Calcium Amphibole Subgroup | AnCa2(C2+5-mCm3+)(Si8-(n+m)Al(n+m))W2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Lithiophilite | LiMn2+PO4 |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Zinnwaldite | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
Localities in this Region
- Qinghai
- Haixi Mongol and Tibetan Autonomous Prefecture
- Tianjun County
- Chakabeishan rare-element pegmatites
- Tianjun County
- Haixi Mongol and Tibetan Autonomous Prefecture
Other Regions, Features and Areas containing this locality
AsiaContinent
- Tibetan PlateauPlateau
China
- Qilian MountainsMountain Range
- Qinghai
- Haixi Mongol and Tibetan Autonomous Prefecture
- Zongulong pegmatite beltMineral Belt
- Haixi Mongol and Tibetan Autonomous Prefecture
Eurasian PlateTectonic Plate
- Kunlun/South Qilian Fold BeltVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Sun, Wenli, Zhao, Zhidan, Niu, Yaoling, Wei, Chunjing, Dong, Guochen, Li, Xiaowei, Yuan, Wanming, Wang, Tao, Wang, Bingzhang, Pan, Tong, Han, Jie, Cao, Hongliang, Tang, Yan, Zhu, Dicheng (2023) Petrogenesis of granitic pegmatite veins: Perspectives from major element and B isotope in tourmalines, Chakabeishan, Northern Tibetan Plateau. Geoscience Frontiers, 14 (5) 101611 doi:10.1016/j.gsf.2023.101611
[3]Sun, Wenli; Zhao, Zhidan; Mo, Xuanxue; Dong, Guochen; Li, Xiaowei; Yuan, Wanming; Wang, Tao; Wang, Bingzhang; Pan, Tong; Han, Jie; et al. (2024) Tourmaline as an indicator for pegmatite evolution and exploration: A case study from the Chakabeishan deposit, northeastern Tibetan Plateau. Ore Geology Reviews, 165. doi:10.1016/j.oregeorev.2024.105892
Lv, Shu-Jun, Dong, Guo-Cheng, Zhao, Zhi-Dan, Luo, Zhi-Bo, Ketchaya, Yanick-Blaise, Li, Xiao-Wei, Yuan, Wan-Ming (2024) The genesis of the Chakabeishan Li-(Be) pegmatite deposit in the northern Tibetan Plateau: Evidence from fluid inclusion and lithium isotope. Ore Geology Reviews, 105965 doi:10.1016/j.oregeorev.2024.105965
[4]Zhou, Xuan, Ding, Qing-Feng, Wu, Rui-Zhe, Li, Shan-Ping (2024) Geochemical characteristic and B isotopic compositions of tourmaline from the Chaqiabeishan Li-rich pegmatite in the Quanji Massif, NW China. Ore Geology Reviews, 167. 106009 doi:10.1016/j.oregeorev.2024.106009
Yang, Li; Yuan, Wanming; Yang, Jing; Zhao, Zhidan; Zhou, Zhenju; Zhao, Mingming (2025) The multi-stage mineralization and uplift of the Li-Be metal ore belt on the northern margin of Qaidam basin in Qinghai province. Ore Geology Reviews, 181. 106630 doi:10.1016/j.oregeorev.2025.106630
Luo, Zhi-Bo; Dong, Guo-Chen; Zhao, Zhi-Dan; Lv, Shu-Jun; Ketchaya, Yanick Blaise (2026) Evolution of Chakabeishan pegmatites and associated Be–Li mineralization in North Qaidam Terrane, China. Ore Geology Reviews, 193. p.107276. doi:10.1016/j.oregeorev.2026.107276
Guo, Xianzheng; Zhou, Taofa; Yuan, Feng; Wang, Fangyue; Kong, Huilei (2027) Multi-stage superimposed Li–Be mineralization in the Chakabeishan pegmatite deposit, NW China: Constraints from garnet geochemistry and in situ U–Pb dating of garnet, cassiterite, and apatite. Geoscience Frontiers, 18 (1). doi:10.1016/j.gsf.2026.102433
