Childs-Adwinkle Mine (Childs and Altwilkle Mine; Childs-Aldwinkle Mine), Copper Creek (Copper Creek Canyon), Bunker Hill Mining District (Copper Creek Mining District), Pinal County, Arizona, USAi
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
32° 45' 2'' North , 110° 28' 59'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Mammoth | 1,487 (2017) | 15.1km |
| San Manuel | 3,551 (2011) | 21.7km |
| Oracle | 3,686 (2011) | 31.1km |
| Dudleyville | 959 (2011) | 36.8km |
| Winkelman | 346 (2017) | 37.6km |
A Mo-Cu-Ag-Au-Pb-Zn-As-Sb-Bi mine located in the W½ sec. 11, T8S, R18E (Oak Grove Canyon 7.5 minute topo map), 3½ miles N of Sombrero Butte, just N of Copper Creek in the Copper Creek Canyon, and 11 miles E of the town of Mammoth. Discovered in 1883 by Aldwinkle and grubstaked by Childs. Owned by the Arizona Molybdenum Corp. (1933-1938). Also known as / designated: The Calumet and Arizona Mining Co. property; Arizona Molybdenum Corp. property; Table Mountain Copper Co. property; Patented claims MS 3263; Minnesota-Arizona Copper Co. property; and the Copper Creek project (in part).
The orebodies are breccia pipes. There are two ore bodies. The south ore body is 220 X 100 feet, the Alamo ore body is 270 x 150 feet in size. The breccia pipes probably join at 700 feet and pinch out at 800 feet. The ore minerals are confined to the cementing material where they occur as disseminations and lining of fractures. The ore body is funnel-shaped and tapering downward. Ore control was a breccia pipe at fault and fracture intersections. Alteration was sericitic, chloritic, tourmaline, silicification and oxidation to iron oxides in the outcrop. Associated rock unit is the Copper Creek granodiorite, a porphyritic biotite granodiorite. Bornite, tennantite were important at depth. Molybdenite was confined to open spaces. The bulk of the chalcopyrite is interstitial to breccia fragments. Molybdenite, the latest sulfide, is later than many gangue minerals. The breccia pipe may have a zoned sulfide mineralogy. The Au, Ag, As, Sb, and Bi were derived from treatment of the copper concentrates.
Area structures include Tertiary block faulting trending NNW and the breccia pipe in strong E-W vertical faults and fractures with N60°E and N70°W strikes.
Two ore bodies were developed, the South and Alamo bodies. Workings included 2 adits, 5 levels below the haulage level, a 2-compartment winze, and 2 large glory holes on surface. Workings were to the 850 level (1938). Most workings are now inaccessible. Production was 6,454,321 pounds of MoS (1933-July, 1938), 5,519,140 pounds of Cu, 19,167 oz. Ag, and 4730 oz. Au.
Assay data: Mo grade 0.4-0.75%, Cu grade 3-4%. Molybdenite nearly constant at 1-2%. Cu content increased from 1% at surface to 6-8% at the 800 feet, then decreased to 2% at the bottom of the mine.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities39 valid minerals. 1 (TL) - type locality of valid minerals.
Detailed Mineral List:
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 References: |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Description: Gangue min.; crystals on 600 ft level; 5 inch xl. 820 level. References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 References: |
| ⓘ Beudantite Formula: PbFe3+3(AsO4)(SO4)(OH)6 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Description: Occurs on 600 level. |
| ⓘ Bornite Formula: Cu5FeS4 References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcocite Formula: Cu2S Description: Principle ore mineral in deeper levels. References: |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ 'Chlorite Group' Description: Occurs in country rock. |
| ⓘ Connellite Formula: Cu19(SO4)(OH)32Cl4 · 3H2O References: |
| ⓘ Corkite Formula: PbFe3+3(PO4)(SO4)(OH)6 References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O References: |
| ⓘ Enargite Formula: Cu3AsS4 Description: Occurs sparingly with tennantite. References: |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O Habit: Radiating crystal aggregates Colour: Yellow Description: Also occurs as a powder. References: |
| ⓘ Galena Formula: PbS |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Description: In cavities (300 level). |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hematite var. Specularite Formula: Fe2O3 |
| ⓘ Lindgrenite Formula: Cu3(MoO4)2(OH)2 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Markascherite (TL) Formula: Cu3(MoO4)(OH)4 Type Locality: |
| ⓘ Molybdenite Formula: MoS2 Description: Prin. ore min.; at one time considered to be among the highest Re contents known (320-580 ppm). References: |
| ⓘ Molybdenite var. Rhenium-bearing Molybdenite Formula: (Mo,Re)S2 Description: Prin. ore min.; at one time considered to be among the highest Re contents known (320-580 ppm). References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Description: Occurs in altered country rock. |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 Description: Occurs in altered country rock. |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Silver Formula: Ag |
| ⓘ Orthoclase Formula: K(AlSi3O8) Habit: Crystals to 6 inches long Description: Pegmatite zone at base of breccia pipe (300 level). References: |
| ⓘ Orthoserpierite Formula: Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O Localities: Childs-Adwinkle Mine (Childs and Altwilkle Mine; Childs-Aldwinkle Mine), Copper Creek (Copper Creek Canyon), Bunker Hill Mining District (Copper Creek Mining District), Pinal County, Arizona, USA Copper Creek shaft, Childs-Adwinkle Mine (Childs and Altwilkle Mine; Childs-Aldwinkle Mine), Copper Creek (Copper Creek Canyon), Bunker Hill Mining District (Copper Creek Mining District), Pinal County, Arizona, USA |
| ⓘ Powellite Formula: Ca(MoO4) References: |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 References: |
| ⓘ Pyrite Formula: FeS2 Description: As excellent crystals. References: |
| ⓘ Pyromorphite Formula: Pb5(PO4)3Cl References: |
| ⓘ Quartz Formula: SiO2 Description: Crystals with orthoclase in open cavities (300 level). |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 References: |
| ⓘ Rutile Formula: TiO2 Habit: Small, single crystals Description: Assoc. with molybdenite, quartz, and orthoclase crystals. |
| ⓘ Scheelite Formula: Ca(WO4) References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Gangue mineral in breccia pipe deposit. |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ 'Tennantite Subgroup' Formula: Cu6(Cu4C2+2)As4S12S References: |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S Description: Associated with stromeyerite. References: |
| ⓘ Torbernite Formula: Cu(UO2)2(PO4)2 · 12H2O References: |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Wulfenite Formula: Pb(MoO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | var. Rhenium-bearing Molybdenite | 2.EA.30 | (Mo,Re)S2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | 'Tennantite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)As4S12S |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 3 - Halides | |||
| ⓘ | Connellite | 3.DA.25 | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | var. Specularite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Orthoserpierite | 7.DD.30 | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Lindgrenite | 7.GB.05 | Cu3(MoO4)2(OH)2 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| ⓘ | Markascherite (TL) | 7.GB.70 | Cu3(MoO4)(OH)4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Corkite | 8.BL.05 | PbFe3+3(PO4)(SO4)(OH)6 |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| ⓘ | Torbernite | 8.EB.05 | Cu(UO2)2(PO4)2 · 12H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| H | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Markascherite | Cu3(MoO4)(OH)4 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | Oxygen | |
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| O | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Hematite var. Specularite | Fe2O3 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Markascherite | Cu3(MoO4)(OH)4 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| S | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Cl | Chlorine | |
| Cl | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Hematite var. Specularite | Fe2O3 |
| Cu | Copper | |
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Connellite | Cu19(SO4)(OH)32Cl4 · 3H2O |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
| Cu | ⓘ Markascherite | Cu3(MoO4)(OH)4 |
| Zn | Zinc | |
| Zn | ⓘ Orthoserpierite | Ca(Cu,Zn)4(SO4)2(OH)6 · 3H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Tennantite Subgroup | Cu6(Cu4C22+)As4S12S |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Mo | ⓘ Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Mo | ⓘ Markascherite | Cu3(MoO4)(OH)4 |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Stromeyerite | AgCuS |
| Sb | Antimony | |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Re | Rhenium | |
| Re | ⓘ Molybdenite var. Rhenium-bearing Molybdenite | (Mo,Re)S2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Corkite | PbFe33+(PO4)(SO4)(OH)6 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | ⓘ Torbernite | Cu(UO2)2(PO4)2 · 12H2O |
Geochronology
Mineralization age: Paleocene : 61 Ma to 60.4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||
|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||
| Cenozoic | ||||||||||
| Paleogene | ||||||||||
| Paleocene |
| |||||||||
Other Databases
| Link to USGS MRDS: | 10039463 |
|---|
Localities in this Region
- Arizona
- Pinal County
- Bunker Hill Mining District (Copper Creek Mining District)
- Copper Creek (Copper Creek Canyon)
- Childs-Adwinkle Mine (Childs and Altwilkle Mine; Childs-Aldwinkle Mine)
- Copper Creek (Copper Creek Canyon)
- Bunker Hill Mining District (Copper Creek Mining District)
- Pinal County
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Southern Basin and RangeWide Rift
USA
- Arizona
- Galiuro MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Childs-Adwinkle Mine, Copper Creek, Bunker Hill Mining District, Pinal County, Arizona, USA