Laodoucun Au deposit, Dewulu Au-Cu ore field, Hezuo Co., Gannan, Gansu, Chinai
| Regional Level Types | |
|---|---|
| Laodoucun Au deposit | Deposit |
| Dewulu Au-Cu ore field | Ore Field |
| Hezuo Co. | County |
| Gannan | Prefecture |
| Gansu | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 6' North , 103° 1' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other/historical names associated with this locality:
Laodou
Name(s) in local language(s):
老豆村金矿床, 德乌鲁金铜矿田, 合作市, 甘南藏族自治州, 甘肃省, 中国
Altered-rock type gold deposit.
Mined by the Gansu Zhongxin Mining Co. Ltd, the Laodou deposit has a proven reserve of > 20 t Au, with an average grade of 3.8–5.5 g/t. The metasedimentary rocks in Laodou, belonging to the Lower Permian Daguanshan Group, form a complex suite and vary from hornfels and marbles to argillaceous slates and polymictic conglomerates with decreasing depth.
Wall-rock alternation is universal in the Laodou deposit, and the assemblages of altered minerals and replacement textures indicate four stages of hydrothermal alteration: (1) Early alteration assemblages of K-feldspar, tourmaline, biotite and quartz associated with quartz diorite porphyry and breccia; (2) subsequent sulfidation (arsenopyrite and pyrite), sericitization, silicification and tourmalinization; (3) late alternation zones comprised of stibnite, sphalerite, chalcopyrite, smokey quartz and tourmaline overprint the earlier alternations; and (4) the final stage alteration characterized by carbonates.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
29 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Enargite Formula: Cu3AsS4 |
| ⓘ Foitite Formula: ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Jamesonite Formula: Pb4FeSb6S14 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Kësterite Formula: Cu2ZnSnS4 |
| ⓘ 'K Feldspar' |
| ⓘ 'Limonite' |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold Formula: Au |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Twinnite Formula: Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Zinkenite Formula: Pb9Sb22S42 |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Kësterite | 2.CB.15a | Cu2ZnSnS4 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Jamesonite | 2.HB.15 | Pb4FeSb6S14 |
| ⓘ | Twinnite | 2.HC.05a | Pb0.8Tl0.1Sb1.3As0.8S4 |
| ⓘ | Zinkenite | 2.JB.35a | Pb9Sb22S42 |
| ⓘ | Enargite | 2.KA.05 | Cu3AsS4 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Foitite | 9.CK.05 | ◻(Fe2+2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Enargite | Cu3AsS4 |
| S | ⓘ Galena | PbS |
| S | ⓘ Jamesonite | Pb4FeSb6S14 |
| S | ⓘ Kësterite | Cu2ZnSnS4 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| S | ⓘ Zinkenite | Pb9Sb22S42 |
| Cl | Chlorine | |
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Foitite | ◻(Fe22+Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Jamesonite | Pb4FeSb6S14 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Enargite | Cu3AsS4 |
| Cu | ⓘ Kësterite | Cu2ZnSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Kësterite | Cu2ZnSnS4 |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Enargite | Cu3AsS4 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Sn | Tin | |
| Sn | ⓘ Kësterite | Cu2ZnSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Sb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Sb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Sb | ⓘ Zinkenite | Pb9Sb22S42 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Tl | Thallium | |
| Tl | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | Lead | |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Jamesonite | Pb4FeSb6S14 |
| Pb | ⓘ Twinnite | Pb0.8Tl0.1Sb1.3As0.8S4 |
| Pb | ⓘ Zinkenite | Pb9Sb22S42 |
Other Regions, Features and Areas containing this locality
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
China
- Qinling Metallogenic BeltMineral Belt
Eurasian PlateTectonic Plate
- Kunlun/South Qilian Fold BeltVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.