Dora-Maira coesite-bearing unit, Cuneo Province, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Dora-Maira coesite-bearing unit | Rock Unit |
| Cuneo Province | Province |
| Piedmont | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
44° North , 7° East (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~5km
Type:
Age:
~145.0 to 66.0 Ma
Geologic Time:
Köppen climate type:
Other/historical names associated with this locality:
Dora-Maira ultra‐high‐pressure unit; Brossasco-Isasca Unit; "Dora-Maira Massif"
Other Languages:
Italian:
Unità a coesite del Dora-Maira (Unità di ultra-alta pressione del Dora-Maira; Unità di Brossasco-Isasca; "Massiccio Dora-Maira"), Provincia di Cuneo, Piemonte, Italia
The Dora Maira coesite-bearing unit, also known as Dora‐Maira ultra‐high‐pressure (UHP) unit or Brossasco–Isasca Unit, is a ∼1‐km‐thick continental slice sandwiched between lower‐pressure rock units. It is exposed in the southern Dora Maira Massif between the lower Po Valley and the lower Varaita Valley.
This unit, which is about 10 x 4 x 1 km in size, consists of orthogneisses and subordinate meta-pelites, marbles and metabasites which underwent UHP metamorphism at P>35 kbar. Ultra-high-pressure metamorphism has created the very unusual pyrope-coesite assemblage in whiteschists and jadeite-coesite assemblage in granofels, emerged from a depth of 100 km during the Cretaceous. These rocks are now covered only by a thin fraction of the synmetamorphic overburden.
The whiteschist outcrops are famous for their (nearly) colorless, very pure pyrope (over 95% pyrope molecule) as crude crystals up to coconut size. Peculiar ultra-high-pressure phases like ellenbergerite, phosphoellenbergerite, magnesiodumortierite, and coesite are found as inclusions armoured in pyrope.
The main composition of the whiteschists is quartz, phengite, talc, kyanite, and pyrope. Some pyropes contain more than 50 vol.% of mineral inclusions, largely kyanite.
Coesite (or its pseudomorphs consisting of polycrystalline quartz aggregates) is found not only in the pyrope-bearing whiteschists but in a wide spectrum of lithologies. It can be found armoured in minerals such as garnet (pyrope and almandine rich), clinopyroxene (jadeite and omphacite), kyanite and zoisite. Coesite relics are often surrounded by peculiar radial cracks in the host mineral, resulting from the increase in volume connected to the coesite to quartz reaction.
Well-known individual localities for pyrope are: Case Parigi (Case Paris) and Case Ramello, Po Valley; Gilba Valley and Pratoluogo, Varaita Valley.
The Pinerolo unit with its metaconglomerates, that is included, is suggested as a good site for Alpine geology training.
IMPORTANT NOTE: The use of only the simplified indication "Dora Maira Massif" to designate the coesite-bearing terrain occurring in the southern sector of this massif, although quite diffuse in the literature and among mineral collectors, should be avoided and discouraged, because the Dora Maira Massif, consisting of different tectonic slices of continental basement intruded by large bodies of late- to post-Variscan granitoids, is the crystalline basement of the Cottian Alps.
It is an ellipsoid-shaped body of about 70×25 km, which extends from south to north from Maira Valley (Cuneo Province) to Susa Valley (Torino Province).
It includes a very large array of different lithologies and mineral localities, such as the quarries of "Pietra di Luserna" leucogranitic orthogneiss at Montoso and in the Luserna Valley, Monte Bracco, Rocca di Cavour inselberg, the talc mines of Germanasca Valley, the graphite mines in the area near Pinerolo, the gneiss quarries of Borgone di Susa and Bussoleno in Susa Valley, etc.
A wide sector of the Dora-Maira Massif, from Pellice (Grange Subiaschi) to the Sangone Valley (Grange Martinetto and Rolando), through Germanasca (Envie, Sapatlè, Pleinet, Comba la Fracia, Malzas, Fontane, Crosetto, Maniglia) and Chisone Valley (La Roussa), has been the centre of talc mining since XVII century, representing nearly the total Italian production.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities39 valid minerals. 6 (TL) - type locality of valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Aluminoceladonite Formula: K(MgAl◻)(Si4O10)(OH)2 Localities: Description: This white mica, occurring as inclusions in pyrope, is a Fe-free phengite aascribable to an intermediate member of the solid-solution series aluminoceladonite-muscovite. A typical composition, represented by the empirical formula K0.93Na0.02(Al1.41Mg0.59)(Si3.60Al0.40O10)(OH)2, is reported by Chukanov (2014).
|
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Bearthite (TL) Formula: Ca2Al(PO4)2(OH) Localities: Type Locality: Gilba Valley, Brossasco, Cuneo Province, Piedmont, Italy |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Coesite Formula: SiO2 |
| ⓘ Corundum Formula: Al2O3 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Ellenbergerite (TL) Formula: Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 Localities: Type Locality: Case Parigi, Martiniana Po, Cuneo Province, Piedmont, Italy |
| ⓘ 'Ellenbergerite-(PO4)' Formula: (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| ⓘ Enstatite Formula: Mg2Si2O6 |
| ⓘ 'Ferro-nybøite' Formula: NaNa2(Fe2+3Al2)(AlSi7)O22(OH)2 |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Gedrite Formula: ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ Glaucophane Formula: ◻[Na2][Mg3Al2]Si8O22(OH)2 Description: Glaucophane has been identified as tiny inclusions in pyrope |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hydroxylwagnerite (TL) Formula: Mg2(PO4)(OH) Type Locality: |
| ⓘ Jadeite Formula: Na(Al,Fe3+)Si2O6 |
| ⓘ Kyanite Formula: Al2(SiO4)O Localities: |
| ⓘ Magnesiochloritoid Formula: MgAl2O(SiO4)(OH)2 |
| ⓘ Magnesiodumortierite (TL) Formula: Mg(Al2OH)(Al2O)2(SiO4)3(BO3) Localities: Case Ramello, Case Parigi, Martiniana Po, Cuneo Province, Piedmont, Italy San Giacomo, Gilba Valley, Brossasco, Cuneo Province, Piedmont, Italy Dora-Maira coesite-bearing unit, Cuneo Province, Piedmont, Italy Case Parigi, Martiniana Po, Cuneo Province, Piedmont, Italy Pratoluogo, Venasca, Cuneo Province, Piedmont, Italy |
| ⓘ Magnesiostaurolite (TL) Formula: Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 Localities: Type Locality: Gilba Valley, Brossasco, Cuneo Province, Piedmont, Italy Description: Occurs together with talc, clinochlore and kyanite (or alone, armouring corundum) as inclusions in pyrope megablasts. |
| ⓘ 'Manganese Oxides' References: |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ 'Monazite Group' Formula: REE(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Phengite Formula: KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 Localities: Description: Two different types of phengite are observed in the host rock and as inclusions in pyrope crystals.
The white mica, occurring as inclusions in pyrope, is a Fe-free phengite ascribable to an intermediate member of the solid-solution series aluminoceladonite-muscovite. A typical composition, represented by the empirical formula K0.93Na0.02(Al1.41Mg0.59)(Si3.60Al0.40O10)(OH)2, is reported by Chukanov (2014). |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Nybøite Formula: NaNa2(Mg3Al2)(AlSi7O22)(OH)2 References: |
| ⓘ Omphacite Formula: (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Phosphoellenbergerite (TL) Formula: (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 Localities: |
| ⓘ 'Plumbogummite Group' |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrope Formula: Mg3Al2(SiO4)3 Localities: |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 Localities: |
| ⓘ Sapphirine Formula: Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Taramite Root Name Group' Formula: A(CaNa)(Z2+3Z3+2)(Al2Si6O22)(OH,F,Cl)2 |
| ⓘ Trolleite Formula: Al4(PO4)3(OH)3 |
| ⓘ Vermiculite Formula: Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ Wagnerite Formula: Mg2(PO4)F |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Corundum | 4.CB.05 | Al2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Coesite | 4.DA.35 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Wagnerite | 8.BB.15 | Mg2(PO4)F |
| ⓘ | Hydroxylwagnerite (TL) | 8.BB.15 | Mg2(PO4)(OH) |
| ⓘ | Trolleite | 8.BB.45 | Al4(PO4)3(OH)3 |
| ⓘ | Phosphoellenbergerite (TL) | 8.BB.55 | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| ⓘ | Bearthite (TL) | 8.BG.05 | Ca2Al(PO4)2(OH) |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Pyrope | 9.AD.25 | Mg3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Magnesiostaurolite (TL) | 9.AF.30 | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| ⓘ | Ellenbergerite (TL) | 9.AF.80 | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| ⓘ | Magnesiochloritoid | 9.AF.85 | MgAl2O(SiO4)(OH)2 |
| ⓘ | Magnesiodumortierite (TL) | 9.AJ.10 | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Enstatite | 9.DA.05 | Mg2Si2O6 |
| ⓘ | Omphacite | 9.DA.20 | (NaaCabFe2+cMgd)(AleFe3+fFe2+gMgh)Si2O6 |
| ⓘ | Jadeite | 9.DA.25 | Na(Al,Fe3+)Si2O6 |
| ⓘ | Gedrite | 9.DD.05 | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| ⓘ | Glaucophane | 9.DE.25 | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| ⓘ | Nybøite | 9.DE.25 | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| ⓘ | 'Ferro-nybøite' | 9.DE.25 | NaNa2(Fe2+3Al2)(AlSi7)O22(OH)2 |
| ⓘ | Sapphirine | 9.DH.45 | Mg4(Mg3Al9)O4[Si3Al9O36] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Phengite | 9.EC.15 | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| ⓘ | Aluminoceladonite | 9.EC.15 | K(MgAl◻)(Si4O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Vermiculite | 9.EC.50 | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| Unclassified | |||
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Taramite Root Name Group' | - | A(CaNa)(Z2+3Z3+2)(Al2Si6O22)(OH,F,Cl)2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Manganese Oxides' | - | |
| ⓘ | 'Plumbogummite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Ellenbergerite-(PO4)' | - | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| H | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| H | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| H | ⓘ Magnesiochloritoid | MgAl2O(SiO4)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| H | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| H | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| H | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| H | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| H | ⓘ Hydroxylwagnerite | Mg2(PO4)(OH) |
| H | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| Li | Lithium | |
| Li | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| O | Oxygen | |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Coesite | SiO2 |
| O | ⓘ Corundum | Al2O3 |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| O | ⓘ Enstatite | Mg2Si2O6 |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| O | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| O | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| O | ⓘ Magnesiochloritoid | MgAl2O(SiO4)(OH)2 |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| O | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| O | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| O | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| O | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| O | ⓘ Wagnerite | Mg2(PO4)F |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| O | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Hydroxylwagnerite | Mg2(PO4)(OH) |
| O | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| F | Fluorine | |
| F | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| F | ⓘ Wagnerite | Mg2(PO4)F |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Na | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Na | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Na | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| Na | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| Mg | ⓘ Enstatite | Mg2Si2O6 |
| Mg | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Mg | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Mg | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Mg | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| Mg | ⓘ Magnesiochloritoid | MgAl2O(SiO4)(OH)2 |
| Mg | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Mg | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Mg | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Mg | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Mg | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Mg | ⓘ Wagnerite | Mg2(PO4)F |
| Mg | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Mg | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| Mg | ⓘ Hydroxylwagnerite | Mg2(PO4)(OH) |
| Mg | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| Al | Aluminium | |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Corundum | Al2O3 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Al | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Al | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Al | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| Al | ⓘ Magnesiochloritoid | MgAl2O(SiO4)(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Al | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Al | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Al | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| Al | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| Al | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Al | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| Al | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| Si | Silicon | |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Coesite | SiO2 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| Si | ⓘ Enstatite | Mg2Si2O6 |
| Si | ⓘ Gedrite | ◻{Mg2}{Mg3Al2}(Al2Si6O22)(OH)2 |
| Si | ⓘ Glaucophane | ◻[Na2][Mg3Al2]Si8O22(OH)2 |
| Si | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Magnesiodumortierite | Mg(Al2OH)(Al2O)2(SiO4)3(BO3) |
| Si | ⓘ Magnesiostaurolite | Mg(Mg,Li)3(Al,Mg)18Si8O44(OH)4 |
| Si | ⓘ Magnesiochloritoid | MgAl2O(SiO4)(OH)2 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nybøite | NaNa2(Mg3Al2)(AlSi7O22)(OH)2 |
| Si | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Si | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Pyrope | Mg3Al2(SiO4)3 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Sapphirine | Mg4(Mg3Al9)O4[Si3Al9O36] |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| Si | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| Si | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| P | Phosphorus | |
| P | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Trolleite | Al4(PO4)3(OH)3 |
| P | ⓘ Wagnerite | Mg2(PO4)F |
| P | ⓘ Phosphoellenbergerite | (Mg,◻)2Mg12(PO4,PO3OH)6(PO3OH,CO3)2(OH)6 |
| P | ⓘ Hydroxylwagnerite | Mg2(PO4)(OH) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| P | ⓘ Ellenbergerite-(PO4) | (Mg,◻)2(Mg,Al)12(SiO3OH)6(PO3OH)(OH)6 |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Native Sulphur | S8 |
| Cl | Chlorine | |
| Cl | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| K | ⓘ Aluminoceladonite | K(MgAl◻)(Si4O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Bearthite | Ca2Al(PO4)2(OH) |
| Ca | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Ca | ⓘ Taramite Root Name Group | A(CaNa)(Z32+Z23+)(Al2Si6O22)(OH,F,Cl)2 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| Ti | ⓘ Rutile | TiO2 |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Jadeite | Na(Al,Fe3+)Si2O6 |
| Fe | ⓘ Omphacite | (NaaCabFec2+Mgd)(AleFef3+Feg2+Mgh)Si2O6 |
| Fe | ⓘ Muscovite var. Phengite | KAl1.5(Mg,Fe)0.5(Al0.5Si3.5O10)(OH)2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vermiculite | Mg0.7(Mg,Fe,Al)6(Si,Al)8O20(OH)4 · 8H2O |
| Fe | ⓘ Ferro-nybøite | NaNa2(Fe32+Al2)(AlSi7)O22(OH)2 |
| Zr | Zirconium | |
| Zr | ⓘ Ellenbergerite | Mg6(Mg,Ti,Zr,◻)2(Al,Mg)6Si8O28(OH)10 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Ce | Cerium | |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
Geochronology
Mineralization age: Eocene : 35.4 ± 1 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||
|---|---|---|---|---|---|---|---|
| Phanerozoic | |||||||
| Cenozoic | |||||||
| Paleogene | |||||||
| Eocene |
| ||||||
Mindat Articles
Giant pyrope crystals in Ultra High Pressure (UHP) rocks of the Dora Maira Massif by Olav RevheimLocalities in this Region
- Piedmont
- Cuneo Province
- Brossasco
- Martiniana Po
- Venasca
- Cuneo Province
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
Europe
- The AlpsMountain Range
Italy
- Piedmont
- Cuneo Province
- Po ValleyValley
- Varaita ValleyValley
- Dora-Maira MassifMassif
- Cuneo Province
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Chopin, Christian (1984) Coesite and pure pyrope in high-grade blueschists of the Western Alps: a first record and some consequences. Contributions to Mineralogy and Petrology, 86 (2) 107-118 doi:10.1007/bf00381838
Chopin, Christian, Henry, Caroline, Michard, Andre (1991) Geology and petrology of the coesite-bearing terrain, Dora Maira massif, Western Alps. European Journal of Mineralogy, 3 (2) 263-292 doi:10.1127/ejm/3/2/0263
Schertl, H. -P., Schreyer, W., Chopin, C. (1991) The pyrope-coesite rocks and their country rocks at Parigi, Dora Maira Massif, Western Alps: detailed petrography, mineral chemistry and PT-path. Contributions to Mineralogy and Petrology, 108 (1) 1-21 doi:10.1007/bf00307322
Tilton, G. R.; Schreyer, W.; Schertl, H. -P. (1991) Pb−Sr−Nd isotopic behavior of deeply subducted crustal rocks from the Dora Maira Massif, Western Alps, Italy-II: what is the age of the ultrahigh-pressure metamorphism? Contributions to Mineralogy and Petrology, 108 (1). 22-33 doi:10.1007/bf00307323
Sharp, Z. D., Essene, E. J., Hunziker, J. C. (1993) Stable isotope geochemistry and phase equilibria of coesite-bearing whiteschists, Dora Maira Massif, western Alps. Contributions to Mineralogy and Petrology, 114 (1) 1-12 doi:10.1007/bf00307861
Gebauer, D., Schertl, H.-P., Brix, M., Schreyer, W. (1997) 35 Ma old ultrahigh-pressure metamorphism and evidence for very rapid exhumation in the Dora Maira Massif, Western Alps. Lithos, 41 (1) 5-24 doi:10.1016/s0024-4937(97)82002-6
Compagnoni, Roberto, Hirajima, Takao (2001) Superzoned garnets in the coesite-bearing Brossasco-Isasca Unit, Dora-Maira massif, Western Alps, and the origin of the whiteschists. Lithos, 57 (4) 219-236 doi:10.1016/s0024-4937(01)00041-x
Compagnoni, Roberto (2003) HP metamorphic belt of the western Alps. Episodes, 26 (3) 200-204 doi:10.18814/epiiugs/2003/v26i3/008
Mosenfelder, J. L. (2005) Factors in the preservation of coesite: The importance of fluid infiltration. American Mineralogist, 90 (5) 779-789 doi:10.2138/am.2005.1687
Ferrando, Simona (2012) Mg-metasomatism of metagranitoids from the Alps: genesis and possible tectonic scenarios. Terra Nova, 24 (6). 423-436 doi:10.1111/j.1365-3121.2012.01078.x
Compagnoni, Roberto, Rolfo, Franco, Groppo, Chiara, Hirajima, Takao, Turello, Robertino (2012) Geological map of the ultra-high pressure Brossasco-Isasca unit (Western Alps, Italy) Journal of Maps, 8 (4) 465-472 doi:10.1080/17445647.2012.744367
Franz, Leander, Romer, Rolf L., de Capitani, Christian (2013) Protoliths and phase petrology of whiteschists. Contributions to Mineralogy and Petrology, 166 (1) 255-274 doi:10.1007/s00410-013-0874-5
Schenker, F. L., Schmalholz, S. M., Moulas, E., Pleuger, J., Baumgartner, L. P., Podladchikov, Y., Vrijmoed, J., Buchs, N., Müntener, O. (2015) Current challenges for explaining (ultra)high-pressure tectonism in the Pennine domain of the Central and Western Alps. Journal of Metamorphic Geology, 33 (8) 869-886 doi:10.1111/jmg.12143
Groppo, Chiara, Ferrando, Simona, Gilio, Manuele, Botta, Serena, Nosenzo, Francesco, Balestro, Gianni, Festa, Andrea, Rolfo, Franco (2019) What’s in the sandwich? New P–T constraints for the (U)HP nappe stack of southern Dora-Maira Massif (Western Alps) European Journal of Mineralogy, 31 (4) 665-683 doi:10.1127/ejm/2019/0031-2860
Balestro, Gianni, Nosenzo, Francesco, Cadoppi, Paola, Fioraso, Gianfranco, Groppo, Chiara, Festa, Andrea (2020) Geology of the southern Dora-Maira Massif: insights from a sector with mixed ophiolitic and continental rocks (Valmala tectonic unit, Western Alps). Journal of Maps, 16 (2). 736-744 doi:10.1080/17445647.2020.1824825
Ballèvre, Michel; Camonin, Audrey; Manzotti, Paola; Poujol, Marc (2020) A step towards unraveling the paleogeographic attribution of pre-Mesozoic basement complexes in the Western Alps based on U–Pb geochronology of Permian magmatism. Swiss Journal of Geosciences, 113 (1). 12 doi:10.1186/s00015-020-00367-1
Vaughan‐Hammon, Joshua D., Luisier, Cindy, Baumgartner, Lukas P., Schmalholz, Stefan M. (2021) Peak Alpine metamorphic conditions from staurolite‐bearing metapelites in the Monte Rosa nappe (Central European Alps) and geodynamic implications. Journal of Metamorphic Geology, 39 (7) 897-917 doi:10.1111/jmg.12595




Dora-Maira coesite-bearing unit, Cuneo Province, Piedmont, Italy