Streuspitz, Weißenstadter Forst-Nord, Wunsiedel im Fichtelgebirge, Upper Franconia, Bavaria, Germanyi
| Regional Level Types | |
|---|---|
| Streuspitz | Quarry (Active) |
| Weißenstadter Forst-Nord | Unincorporated Area |
| Wunsiedel im Fichtelgebirge | District |
| Upper Franconia | Administrative District |
| Bavaria | State |
| Germany | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 7' 36'' North , 11° 51' 50'' East
Latitude & Longitude (decimal):
Type:
Quarry (Active) - last checked 2021
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Zell im Fichtelgebirge | 2,275 (2017) | 3.1km |
| Weißenstadt | 3,545 (2015) | 3.3km |
| Sparneck | 1,802 (2013) | 4.2km |
| Oberhaid | 4,680 (2018) | 4.2km |
| Grub | 3,129 (2018) | 5.4km |
Other/historical names associated with this locality:
Waldstein quarry; Grasyma quarry
Other Languages:
German:
Streuspitz (Steinbruch Waldstein; Steinbruch Grasyma)), Landkreis Wunsiedel im Fichtelgebirge, Oberfranken, Bayern, Deutschland
Granite with pegmatite inclusions.
Granite quarry, which was abandoned until around 2020, then active again since 2021.
Known for pegmatites.
Located about 1.5 km ESE of the Großer Waldenstein mountain.
Granite quarry, which was abandoned until around 2020, then active again since 2021.
Known for pegmatites.
Located about 1.5 km ESE of the Großer Waldenstein mountain.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Chabazite' |
| ⓘ 'Chlorite Group' |
| ⓘ Euclase Formula: BeAl(SiO4)(OH) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Goyazite ? Formula: SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Herderite ? Formula: CaBe(PO4)F Description: No chemical analysis. |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Gilbertite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Parisite-(Ce) Formula: CaCe2(CO3)3F2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Rock Crystal Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ 'Tapiolite' Formula: (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ 'Wolframite Group' |
| ⓘ 'Zinnwaldite' |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Parisite-(Ce) | 5.BD.20b | CaCe2(CO3)3F2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Herderite ? | 8.BA.10 | CaBe(PO4)F |
| ⓘ | Goyazite ? | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Euclase | 9.AE.10 | BeAl(SiO4)(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Gilbertite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tapiolite' | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Zinnwaldite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Euclase | BeAl(SiO4)(OH) |
| H | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| H | ⓘ Zinnwaldite | |
| Li | Lithium | |
| Li | ⓘ Zinnwaldite | |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Euclase | BeAl(SiO4)(OH) |
| Be | ⓘ Herderite | CaBe(PO4)F |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Euclase | BeAl(SiO4)(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Herderite | CaBe(PO4)F |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| O | ⓘ Zinnwaldite | |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Herderite | CaBe(PO4)F |
| F | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Zinnwaldite | |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Euclase | BeAl(SiO4)(OH) |
| Al | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Zinnwaldite | |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Euclase | BeAl(SiO4)(OH) |
| Si | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Si | ⓘ Zinnwaldite | |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| P | Phosphorus | |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Herderite | CaBe(PO4)F |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Gilbertite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Zinnwaldite | |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Herderite | CaBe(PO4)F |
| Ca | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Fe | ⓘ Zinnwaldite | |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Ce | Cerium | |
| Ce | ⓘ Parisite-(Ce) | CaCe2(CO3)3F2 |
| Ta | Tantalum | |
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Saxo-Thuringian BeltOrogenic Belt
EuropeContinent
- Bohemian MassifMassif
Germany/Czech Republic
- Fichtel MountainsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Streuspitz, Weißenstadter Forst-Nord, Wunsiedel im Fichtelgebirge, Upper Franconia, Bavaria, Germany