Haapaluoma pegmatite, Peräseinäjoki, Seinäjoki, South Ostrobothnia, Finlandi
| Regional Level Types | |
|---|---|
| Haapaluoma pegmatite | Quarry (Flooded) |
| Peräseinäjoki | - not defined - |
| Seinäjoki | Municipality |
| South Ostrobothnia | Region |
| Finland | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
62° 34' 27'' North , 23° 14' 15'' East
Latitude & Longitude (decimal):
Type:
Quarry (Flooded) - last checked 2023
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Alavus | 9,422 (2014) | 19.4km |
| Jalasjärvi | 8,662 (2016) | 26.3km |
| Kuortane | 4,219 (2014) | 28.4km |
| Seinäjoki | 32,149 (2015) | 32.2km |
| Nurmo | 11,908 (2015) | 32.8km |
The Haapaluoma pegmatite deposit was found in 1958, when Paavo Iloniemi found feldspar boulders while digging a ditch.
Haapaluoma is a pegmatite quarry mined for feldspar from 1961 until 1997, and it has been quarried by Oy Lohja Ab and later by Paraisten kalkki companies.
The pegmatite consists of two parallel dykes that lie within the granodioritic country rock. The main dyke is 0.5 km long and 10 – 30 m wide. The main minerals of the pegmatite are microcline, albite, quartz, and mica. Haapaluoma is a zoned lithium pegmatite containing accessory beryl, spodumene, lepidolite, columbite, and other pegmatitic minerals.
The pegmatite also contains tourmaline in large crystals and crystal groups.
The iron content of the feldspar in the mine was very low. It was delivered in Finland to Tammisaari porcelain (now IDO Bathroom) and to the glass wool factories in Forssa and Hyvinkää. The feldspar was also finely ground at the plant located in Kemi, and the powder was delivered to Hackman-Arabia. It was exported abroad in sacks to Poland and Hungary.
There is currently free access to the decommissioned Haapaluoma quarry. Various lithium-containing minerals can still be found in the quarry's stone piles, such as purple-colored lepidolite, tourmaline in red (rubellite) and multicolored, red morganite, kunzite, the bright reddish form of spodumene, and, rarely, eucryptite. There is an information board near the locked gate of the quarry, and the key to the gate can be obtained from Peräseinäjoki tourist information, which is located eight kilometers from the quarry next to the Kalajärvi caravan park.
The fifteen-meter-deep quarry is currently filled with water and is used as a diving site. In the summer of 2008, a seven-meter long mid-engine boat was sunk to the bottom of the quarry.
Moderatetly N-dipping, E-W-aligned dykes (c. 10–––30 x 700 m + ) Discordant to metamorphic foliations in wall rock
Zoned, complex pegmatite; late metasomatic albite replacement zones
The Haapaluoma Li ± Be ± Sn prospect consists of two moderately (50 − 60°) N-dipping and c. E-W-striking pegmatite dykes intruding a foliated granodioritic host rock. The main eastern dyke is c. 500 m long and 10 – 30 m wide, while the western dyke is about 230 m long and of similar width.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
33 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | 'Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series' | 4.. | |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Varulite ? | 8.AC.10 | NaCaMn2+Mn2+2(PO4)3 |
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | var. Manganese-bearing Fluorapatite | 8.BN.05 | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| ⓘ | Brockite | 8.CJ.45 | (Ca,Th,Ce)PO4 · H2O |
| ⓘ | Eosphorite | 8.DD.20 | Mn2+Al(PO4)(OH)2 · H2O |
| Group 9 - Silicates | |||
| ⓘ | Eucryptite | 9.AA.05 | LiAlSiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Topaz ? | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene var. Kunzite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | 9.DA.30 | LiAlSi2O6 | |
| ⓘ | var. Hiddenite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Tourmaline var. Rubellite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | '' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'var. Verdelite' | - | A(D3)G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Gigantolite' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Columbite-Tantalite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Eucryptite | LiAlSiO4 |
| Li | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| B | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| O | ⓘ Eucryptite | LiAlSiO4 |
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Tourmaline var. Rubellite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Thorite | Th(SiO4) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| O | ⓘ Tourmaline var. Verdelite | A(D3)G6(T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Al | ⓘ Eucryptite | LiAlSiO4 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Eucryptite | LiAlSiO4 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Thorite | Th(SiO4) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Spodumene var. Hiddenite | LiAlSi2O6 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| P | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Galena | PbS |
| Cl | Chlorine | |
| Cl | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mn | Manganese | |
| Mn | ⓘ Eosphorite | Mn2+Al(PO4)(OH)2 · H2O |
| Mn | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Fluorapatite var. Manganese-bearing Fluorapatite | (Ca,Mn2+)5(PO4)3(F,Cl,OH) or Ca5([P,Mn5+]O4)3(F,Cl,OH) |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Mn | ⓘ Varulite | NaCaMn2+Mn22+(PO4)3 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Fe | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Native Copper | Cu |
| As | Arsenic | |
| As | ⓘ Löllingite | FeAs2 |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Ce | Cerium | |
| Ce | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Ta | Tantalum | |
| Ta | ⓘ Ixiolite-(Mn2+)-Ixiolite-(Fe2+) Series | |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Th | Thorium | |
| Th | ⓘ Brockite | (Ca,Th,Ce)PO4 · H2O |
| Th | ⓘ Thorite | Th(SiO4) |
Other Databases
| Wikipedia: | https://fi.wikipedia.org/wiki/Haapaluoman_kaivos |
|---|---|
| Wikidata ID: | Q63103826 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Central Finland Granitoid ComplexMagmatic Province
EuropeContinent
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Haapala, Ilmari (1966) On the granitic pegmatites in the Peräseinäjoki-Alavus area, South Pohjanmaa, Finland. Bulletin de la Commission Géologique de Finlande Vol. 224. Geological Survey of Finland
Lahti, S.I., Kallio, P., von Knorring, O. (1982) The composition, physical properties and occurrence of eucryptite from the Haapaluoma pegmatite, Finland. Bulletin of the Geological Society of Finland, 54 (1) 5-13 doi:10.17741/bgsf/54.1-2.001
Lahti, S.I., Saikkonen, R. (1986) Kunzite from the Haapaluoma pegmatite quarry, western Finland. Bulletin of the Geological Society of Finland, 58 (2). 47-52 doi:10.17741/bgsf/58.2.005
Teertstra, David K., Lahti, Seppo I., Alviola, Reijo, Cerný, Petr (1993) Pollucite and its alteration in Finnish pegmatites. Bulletin de la Commission Géologique de Finlande Vol. 368. Geological Survey of Finland pp.22-26
[1]Lynch, Edward P.; Szentpéteri, Krisztián; Andersson, Joel B.H.; Kuusela, Janne; Sadeghi, Martiya; Bauer, Tobias E. (2025) Lithium-caesium-tantalum (LCT) pegmatite mineralization in the Paleoproterozoic central Fennoscandian Shield (Sweden and Finland): A review of geological characteristics and assessment of mineral system commonalities. Ore Geology Reviews, 184. 106739 doi:10.1016/j.oregeorev.2025.106739




Haapaluoma pegmatite, Peräseinäjoki, Seinäjoki, South Ostrobothnia, Finland