Keene, Cheshire County, New Hampshire, USAi
| Regional Level Types | |
|---|---|
| Keene | City |
| Cheshire County | County |
| New Hampshire | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Keene | 23,265 (2017) |
Other Languages:
French:
Keene, comté de Cheshire, New Hampshire, États-Unis
German:
Keene, Cheshire County, New Hampshire, Vereinigte Staaten
Italian:
Keene, contea di Cheshire, New Hampshire, Stati Uniti d'America
Russian:
Кин, Чешир, Нью-Гэмпшир, Соединённые Штаты Америки
Simplified Chinese:
基恩, 赤夏縣, 新罕布什尔州, 美国
Spanish:
Keene, Condado de Cheshire, Nuevo Hampshire, Estados Unidos
Arabic:
كين, مقاطعة شيشاير , نيوهامبشير, الولايات المتحدة
Armenian:
Քին, Չեշիր շրջան, Նյու Հեմփշիր, Ամերիկայի Միացյալ Նահանգներ
Basque:
Keene, Cheshire konderria , New Hampshire
Bulgarian:
Кийн, Чешър, Ню Хампшър, Съединени американски щати
Catalan:
Keene, Nou Hampshire, Estats Units d’Amèrica
Cebuano:
Keene, Cheshire County, New Hampshire
Chechen:
Кин, Нью-Гэмпшир, Америкин Цхьаьнатоьхна Штаташ
Czech:
Keene, Cheshire County, New Hampshire, Spojené státy americké
Danish:
Keene, New Hampshire, USA
Dutch:
Keene, Cheshire County, New Hampshire, Verenigde Staten
Egyptian Arabic:
كين, نيوهامشير, امريكا
Farsi/Persian:
کین, شهرستان چشایر، نیوهمپشایر, نیوهمپشایر, ایالات متحده آمریکا
Gilaki:
کین , آمريکا ايجؤنأبؤ ايالتؤن
Haitian:
Keene, Nou Anpchi, Etazini
Hebrew:
קיני, מחוז צ'שייר, ניו המפשייר, ארצות הברית
Hungarian:
Keene, Cheshire megye, New Hampshire, Amerikai Egyesült Államok
Irish Gaelic:
Keene, Contae Cheshire, New Hampshire, Stáit Aontaithe Mheiriceá
Japanese:
キーン, チェシャー郡, ニューハンプシャー州, アメリカ合衆国
Kazakh (Cyrillic Script):
Кини, Нью-Гэмпшир, Америка Құрама Штаттары
Korean:
킨, 뉴햄프셔주, 미국
Kyrgyz:
Кини, Нью-Хемпшир, Америка Кошмо Штаттары
Ladin:
Keene
Malagasy:
Keene, New Hampshire, Etazonia
Mazanderani:
کین , نیوهمشایر
Minnan / Hokkien-Taiwanese:
Keene, Cheshire Kūn
Norwegian:
Keene, Cheshire County, New Hampshire, USA
Polish:
Keene, Hrabstwo Cheshire, New Hampshire, Stany Zjednoczone
Portuguese:
Keene, Condado de Cheshire, Nova Hampshire, Estados Unidos
Serbian:
Кин, Округ Чешир, Њу Хемпшир, Сједињене Америчке Државе
Serbo-Croatian:
Keene, Cheshire County, New Hampshire, Sjedinjene Američke Države
Silesian:
Keene , New Hampshire, Zjednoczůne Sztaty
Slovak:
Keene, New Hampshire, Spojené štáty
Slovenian:
Keene, New Hampshire, Združene države Amerike
South Azerbaijani:
کین، نیوهمپشایر, نیوهمپشایر ایالتی, آمریکا بیرلشمیش ایالتلری
Swedish:
Keene, Cheshire County, New Hampshire, USA
Tatar:
Кин , Нью-Һәмпшир, Америка Кушма Штатлары
Turkish:
Keene, Cheshire, New Hampshire, Amerika Birleşik Devletleri
Ukrainian:
Кін, Чешир, Нью-Гемпшир, Сполучені Штати Америки
Urdu:
کین, چیشائر کاؤنٹی، نیو ہیمپشائر, نیو ہیمپشائر, ریاستہائے متحدہ امریکا
Uzbek (Latin Script):
Keene, Nyu-Xempshir, Amerika Qoʻshma Shtatlari
Vietnamese:
Keene, Quận Cheshire, New Hampshire, Chủng Quốc Hoa Kỳ
Volapük:
Keene, New Hampshire, Lamerikän
Waray:
Keene, Condado han Cheshire, New Hampshire, Estados Unidos
Welsh:
Keene, New Hampshire, Unol Daleithiau America
Keene is the county seat of Cheshire County. It was incorporated as a town in 1753 and incorporated as a city in 1874.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities22 valid minerals.
Detailed Mineral List:
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Amesite ? Formula: Mg2Al(AlSiO5)(OH)4 |
| ⓘ Antigorite ? Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Chrysotile ? Formula: Mg3(Si2O5)(OH)4 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' |
| ⓘ Galena Formula: PbS |
| ⓘ Graphite Formula: C |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ 'Mica Group' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Silver ? Formula: Ag |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Quartz var. Rose Quartz ? Formula: SiO2 |
| ⓘ Rhodonite Formula: CaMn3Mn[Si5O15] |
| ⓘ Schorl ? Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sillimanite Formula: Al2(SiO4)O |
| ⓘ Sphalerite ? Formula: ZnS |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Silver ? | 1.AA.05 | Ag |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite ? | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz ? | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| Group 9 - Silicates | |||
| ⓘ | Chrysotile ? | 9.00. | Mg3(Si2O5)(OH)4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl ? | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Rhodonite | 9.DK.05 | CaMn3Mn[Si5O15] |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Amesite ? | 9.ED.15 | Mg2Al(AlSiO5)(OH)4 |
| ⓘ | Antigorite ? | 9.ED.15 | Mg3(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Mica Group' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| H | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| O | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Kyanite | Al2(SiO4)O |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Mg | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Kyanite | Al2(SiO4)O |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Si | Silicon | |
| Si | ⓘ Amesite | Mg2Al(AlSiO5)(OH)4 |
| Si | ⓘ Antigorite | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chrysotile | Mg3(Si2O5)(OH)4 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Kyanite | Al2(SiO4)O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Mn | Manganese | |
| Mn | ⓘ Rhodonite | CaMn3Mn[Si5O15] |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Ag | Silver | |
| Ag | ⓘ Native Silver | Ag |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Keene,_New_Hampshire |
|---|---|
| Wikidata ID: | Q767364 |
| GeoNames ID: | 5088258 |
Localities in this Region
- New Hampshire
Other Regions, Features and Areas that Intersect
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.



Keene, Cheshire County, New Hampshire, USA