Rollstone Hill Quarries, Fitchburg, Worcester County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Rollstone Hill Quarries | Quarry (Abandoned) |
| Fitchburg | City |
| Worcester County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 34' 44'' North , 71° 48' 32'' West
Latitude & Longitude (decimal):
Type:
Quarry (Abandoned) - last checked 2019
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Fitchburg | 40,545 (2017) | 0.7km |
| Lunenburg | 1,760 (2017) | 7.1km |
| Leominster | 41,569 (2017) | 7.2km |
| Westminster | 7,028 (2017) | 9.1km |
| Ashburnham | 5,643 (2017) | 10.3km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Nashoba Valley Mineralogical Society | Westford, Massachusetts | 30km |
| Worcester Mineral Club | Worcester, Massachusetts | 35km |
At least six granite quarries were formerly worked on Rollstone Hill -- including the (John) McCauliff, (O. E.) Litchfield, and (Henry) Godbeer quarries, with the McCauliff being the largest of these. In 1928, the McCauliff Quarry Company acquired the other quarries which had been operated by independent companies. The locality is often now referred to as simply "Rollstone Hill Quarry." Granite was quarried here from before 1830 until 1941. The name "Rollstone Hill" was in use at least as early as 1731.
C. Stanfield Hitchen (1935) studied the pegmatites on Rollstone Hill and named the following types: (I.) Biotite type; (II.) Tourmaline type; (III.) Beryl type; (IV.) Titanite type; and (V.) Allanite type. In addition, rare calcite veins also occur. Only one pegmatite, a beryl type, showed significant zonation, and gem beryls were collected from the quartz core. A fine specimen of radiating "sunburst" schorl crystals is in the collection of the Harvard Mineralogical Museum.
A. C. Hamlin (1884) enthusiastically reported on beryl from the locality: "At the quarries on Rollestone [sic] Mountain in Fitchburg, beryls of a rich golden color have been blasted out. Some of these approach the chrysoberyl and topaz in hardness and hue. Others so closely resemble the yellow diamond that they may readily be taken for that superior gem. The refractive power of these yellow stones is remarkable; and the goniometer will probably reveal a higher index than is accorded to all the varieties of beryl by the learned Abbé Haüy." Beryl is extremely rare now that the quarries are inactive.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Habit: Small crystals occur in the titanite pegmatites and in calcite veins (Hitchen, 1935). |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] Habit: "Primary oligoclase occurs along with microcline as phenocrysts in the Type II [tourmaline type] pegmatites. (Hitchen, 1935) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Habit: crystal habit similar to epidote, with e(101) prominent (Hitchen, 1935) Colour: dark green to black, sometimes weathered superficially to red-brown Fluorescence: none Description: Crystals to at least 30mm. References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Habit: "Trapezohedron n(211) and the dodechedron d(110)in combination, the former being usually dominant" (Hitchen, 1935) Colour: red, orange-red, orange, pink Description: According to Hitchen (1935), the garnets on Rollstone Hill are "spessartitic almandite." He gave an analysis of 52.29% almandine, 41.53 % spessartine, 0.92 % pyrope, and 3.55% andradite.
The results of an SEM-EDS analysis by Kerry Day 2008 for a garnet specimen collected by Peter Cristofono showed approximately ~ 55% almandine, 45% spessartine. |
| ⓘ 'Almandine-Spessartine Series' References: |
| ⓘ Arsenopyrite Formula: FeAsS Habit: massive and in crystals (see comments) Colour: gray Description: Crystals commonly show the forms m(110), q(011), e(101), k(021), t(013). "Certain crystals ...recently acquired by the Harvard Museum, are somewhat complex and show, in addition to the above, the forms: g(111), o(112), i(312), n(012), Φ(023), τ(031), x(321), B(514)." (Hitchen, 1935) |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Habit: Individual crystals measure from 0.3 to 2 cms, in diameter (Hitchen, 1935) Colour: golden yellow, pale green, aquamarine References: |
| ⓘ Beryl var. Aquamarine |
| ⓘ Beryl var. Goshenite Formula: Be3Al2(Si6O18) References: |
| ⓘ Beryl var. Heliodor Formula: Be3Al2(Si6O18) Description: "At the quarries at Fitchburg, beryl of a rich golden hue, approaching the chrysoberyl and topaz in color and hardness, and closely resembling the yellow diamond in lustre, have been blasted out." -- Hamlin, A. C. (1870): The Gems of the United States in Proceedings of the American Association for the Advancement of Science, Eighteenth Meeting, p. 212. |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Habit: usually not well crystallized Colour: black Description: "The refractive indices are: α =1.640 β and γ = 1.645, and suggest siderophyllite." (Hitchen, 1935) References: |
| ⓘ Calcite Formula: CaCO3 Habit: massive Colour: white Description: Rare calcite veins occur in the granite. |
| ⓘ Chalcopyrite Formula: CuFeS2 Habit: grains of chalcopyrite are frequently grown upon pyrrhotite (Hitchen, 1935) Colour: brassy References: |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O10)(OH)8 Colour: dark green Description: Occurs as an alteration of biotite.
References: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' ? Description: Probably misidentified; likely ilmenite. References: |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Habit: as accessory grains in granite |
| ⓘ 'Feldspar Group' References: |
| ⓘ 'Feldspar Group var. Perthite' References: |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Habit: hexagonal prisms Colour: gray Fluorescence: yellow (SW) |
| ⓘ Fluorite Formula: CaF2 Habit: "Small light purple to colourless cubes, 0.3 cm along an edge, occur on the selvages of the calcite veins (Hitchen, 1935). Colour: colorless, purple References: |
| ⓘ 'Gummite' ? Description: Reported as an alteration product of allanite by Emerson (1917). |
| ⓘ Ilmenite Formula: Fe2+TiO3 Habit: as large platy crystals in quartz, and delicate hexagonal plates in calcite (Hitchen, 1935) Colour: black References: |
| ⓘ Marcasite Formula: FeS2 Description: Noted as concretionary masses resulting from supergene alteration of pyrrhotite (Hitchen, 1935). References: |
| ⓘ Microcline Formula: K(AlSi3O8) Habit: Good crystals occur in quartz. Colour: white References: |
| ⓘ Molybdenite Formula: MoS2 Description: Found only in the beryl pegmatite (Hitchen, 1935). References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Habit: Good crystals occur in the calcite veins. According to Hitchen (1935), pinkish bronze plates to 4 cm occurred in the beryl pegmatite. Colour: gray, bronze Fluorescence: none References: |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Opal Formula: SiO2 · nH2O Habit: amorphous coating Colour: cololress Fluorescence: green References: |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O Habit: amorphous coating Colour: cololress Fluorescence: green References: |
| ⓘ Pyrite Formula: FeS2 Description: Pyrite is very rare. Arsenopyrite is the most common sulfide at Rollstone Hill, followed by pyrrhotite. References: |
| ⓘ Pyrrhotite Formula: Fe1-xS Description: Associated with chalcopyrite. References: |
| ⓘ Quartz Formula: SiO2 Habit: almost always massive Colour: colorless, smoky |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 Habit: massive Colour: smoky References: |
| ⓘ Rutile Formula: TiO2 Habit: microscopic rutile needles in quartz occurs in the granite (Hitchen, 1935) |
| ✪ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Habit: Crystals to 10 cm long. (Hitchen, 1935) Colour: black Fluorescence: none References: |
| ⓘ Siderophyllite ? Formula: KFe2+2Al(Al2Si2O10)(OH)2 Colour: black Description: "The refractive indices are: α =1.640 β and γ = 1.645, and suggest siderophyllite." (Hitchen, 1935) |
| ⓘ Titanite Formula: CaTi(SiO4)O Habit: simple, tabular crystals to 2 cm (Hitchen, 1935) Colour: brown, cinnamon brown |
| ⓘ Uraninite Formula: UO2 Description: Lane (1933) gives a microchemical analysis of a sample of uraninite. |
| ⓘ Zircon Formula: Zr(SiO4) Habit: as small crystals in biotite or microcline References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Heliodor | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Siderophyllite ? | 9.EC.20 | KFe2+2Al(Al2Si2O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O10)(OH)8 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Gummite' ? | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Almandine-Spessartine Series' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' ? | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Almandine-Spessartine Series | |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Al | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Almandine-Spessartine Series | |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Beryl var. Heliodor | Be3Al2(Si6O18) |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Almandine-Spessartine Series | |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Almandine-Spessartine Series | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O10)(OH)8 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderophyllite | KFe22+Al(Al2Si2O10)(OH)2 |
| Fe | ⓘ Almandine-Spessartine Series | |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ce | Cerium | |
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| U | Uranium | |
| U | ⓘ Uraninite | UO2 |
Mindat Articles
Minerals of Rollstone Hill, Fitchburg, Massachusetts by Peter CristofonoOther Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Hitchcock, Edward (1833) Report on the geology, mineralogy, botany, and zoology of Massachusetts. Massachusetts Geological Survey, Amherst, MD. p.17
Emerson, B.K. (1917) Geology of Massachusetts and Rhode Island. Bulletin 597. US Geological Survey doi:10.3133/b597
Rollstone Hill Quarries, Fitchburg, Worcester County, Massachusetts, USA