Lippnik feldspar quarry, Lieser ravine, Spittal an der Drau, Spittal an der Drau District, Carinthia, Austriai
| Regional Level Types | |
|---|---|
| Lippnik feldspar quarry | Quarry |
| Lieser ravine | Ravine |
| Spittal an der Drau | Municipality |
| Spittal an der Drau District | District |
| Carinthia | State |
| Austria | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
46° 48' 11'' North , 13° 30' 1'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Spittal an der Drau | 12,880 (2018) | 0.4km |
| Lurnbichl | 216 (2018) | 2.0km |
| Seeboden | 3,123 (2018) | 2.1km |
| Unterhaus | 362 (2018) | 2.7km |
| Kras | 191 (2018) | 3.2km |
Other/historical names associated with this locality:
Holzmann quarry
Other Languages:
German:
Feldspatbruch Lippnik (Steinbruch Lippnik; Holzmannbruch), Lieserschlucht, Spittal an der Drau, Bezirk Spittal an der Drau, Kärnten, Österreich
Quarry (mainly underground) in pegmatite. Active 1927-1960.
Located NE of Spittal at an alt. of 580-650 m.
Located NE of Spittal at an alt. of 580-650 m.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
34 valid minerals.
Detailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Analcime Formula: Na(AlSi2O6) · H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Clinozoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' References: |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Florencite-(Ce) Formula: CeAl3(PO4)2(OH)6 References: |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Gorceixite Formula: BaAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Goyazite Formula: SrAl3(PO4)(PO3OH)(OH)6 References: |
| ⓘ Hematite Formula: Fe2O3 References: |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Lepidocrocite Formula: Fe3+O(OH) References: |
| ⓘ Microcline Formula: K(AlSi3O8) References: |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ1-n |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ 'Plumbogummite Group' |
| ⓘ Pumpellyite-(Fe2+) Formula: Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ Pyrolusite Formula: Mn4+O2 References: |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tantalite-(Fe) Formula: Fe2+Ta2O6 |
| ⓘ Tapiolite-(Fe) Formula: Fe2+Ta2O6 |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ 'Uranmicrolite (of Hogarth 1977)' Formula: (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zoisite Formula: (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ1-n |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Tapiolite-(Fe) | 4.DB.10 | Fe2+Ta2O6 |
| ⓘ | Tantalite-(Fe) | 4.DB.35 | Fe2+Ta2O6 |
| ⓘ | Lepidocrocite | 4.FE.15 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Gorceixite | 8.BL.10 | BaAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Goyazite | 8.BL.10 | SrAl3(PO4)(PO3OH)(OH)6 |
| ⓘ | Florencite-(Ce) | 8.BL.13 | CeAl3(PO4)2(OH)6 |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Clinozoisite | 9.BG.05a | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Zoisite | 9.BG.10 | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| ⓘ | Pumpellyite-(Fe2+) | 9.BG.20 | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Analcime | 9.GB.05 | Na(AlSi2O6) · H2O |
| Unclassified | |||
| ⓘ | 'Uranmicrolite (of Hogarth 1977)' | - | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Plumbogummite Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Analcime | Na(AlSi2O6) · H2O |
| H | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Lepidocrocite | Fe3+O(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Analcime | Na(AlSi2O6) · H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| O | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Lepidocrocite | Fe3+O(OH) |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| Mg | Magnesium | |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Al | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Analcime | Na(AlSi2O6) · H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| P | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Clinozoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Zoisite | (CaCa)(AlAlAl)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Mn | Manganese | |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Lepidocrocite | Fe3+O(OH) |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pumpellyite-(Fe2+) | Ca2Fe2+Al2[Si2O6OH][SiO4](OH)2(OH) |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Sr | Strontium | |
| Sr | ⓘ Goyazite | SrAl3(PO4)(PO3OH)(OH)6 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Ba | Barium | |
| Ba | ⓘ Gorceixite | BaAl3(PO4)(PO3OH)(OH)6 |
| Ce | Cerium | |
| Ce | ⓘ Florencite-(Ce) | CeAl3(PO4)2(OH)6 |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Tapiolite-(Fe) | Fe2+Ta2O6 |
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ1-n |
| Ta | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| U | Uranium | |
| U | ⓘ Uranmicrolite (of Hogarth 1977) | (Ca,U,Na)2-x(Ta,Nb)2(O,OH)7 |
Other Regions, Features and Areas containing this locality
Austria
- Carinthia
- Millstatt lake ridgeRidge
- Gurktal AlpsMountain Range
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.


Lippnik feldspar quarry, Lieser ravine, Spittal an der Drau, Spittal an der Drau District, Carinthia, Austria