Khan Bogd Peralkaline Granite, Khanbogd District, Ömnögovi Province, Mongoliai
| Regional Level Types | |
|---|---|
| Khan Bogd Peralkaline Granite | Complex |
| Khanbogd District | District |
| Ömnögovi Province | Province |
| Mongolia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
43° 0' 1'' North , 107° 35' 0'' East
Latitude & Longitude (decimal):
Type:
Age:
362 to 245 Ma
Geologic Time:
Dating method:
K-Ar
Reference for age:
Vladykin, N.V., Kovalenko, V.I., and Dorfman, M.D. (1981) Mineralogical and geochemical peculiarities of Khan Bogd massif of alkaline granites (MPR) - Moscow, Nauka, p. 136 (in Russian).
Köppen climate type:
Other/historical names associated with this locality:
Khanbogd; Khan-Bogdo; Han Bogd; Hanbogd
Name(s) in local language(s):
массив Хан Богдо
The largest known intrusion of peralkaline granites.
Extends over 1500km². It is emplaced into Paleozoic sedimentary and volcanic rocks and consists of 2 roughly circular overlapping intrusions, of which the western one is substantially larger.
About 15 occurrences of mineralization rich in rare metals, including Nb, Zr, and REEs have been identified (Vladykin 2013).
Extends over 1500km². It is emplaced into Paleozoic sedimentary and volcanic rocks and consists of 2 roughly circular overlapping intrusions, of which the western one is substantially larger.
About 15 occurrences of mineralization rich in rare metals, including Nb, Zr, and REEs have been identified (Vladykin 2013).
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities34 valid minerals. 2 (TL) - type locality of valid minerals. 1 (FRL) - first recorded locality of unapproved mineral/variety/etc.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 3 - Halides | |||
|---|---|---|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Davidite-(La) | 4.CC.40 | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| ⓘ | Landauite | 4.CC.40 | NaMnZn2(Ti,Fe)6Ti12O38 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Pyrolusite | 4.DB.05 | Mn4+O2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Synchysite-(Ce) | 5.BD.20c | CaCe(CO3)2F |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 9 - Silicates | |||
| ⓘ | Coffinite | 9.AD.30 | U(SiO4) · nH2O |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Gittinsite | 9.BC.05 | CaZrSi2O7 |
| ⓘ | Catapleiite | 9.CA.15 | Na2Zr(Si3O9) · 2H2O |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Aegirine | 9.DA.25 | NaFe3+Si2O6 |
| ⓘ | Astrophyllite | 9.DC.05 | K2NaFe2+7Ti2[Si4O12]2O2(OH)4F |
| ⓘ | 'Hydroastrophyllite' | 9.DC.05 | [H3O]+2CaFe2+7Ti2[Si4O12]2O2(OH)4O |
| ⓘ | Arfvedsonite | 9.DE.25 | NaNa2(Fe2+4Fe3+)Si8O22(OH)2 |
| ⓘ | Elpidite | 9.DG.65 | Na2ZrSi6O15 · 3H2O |
| ⓘ | var. Calcium-bearing Elpidite | 9.DG.65 | (Na,Ca)2ZrSi6O15 · 3H2O |
| ⓘ | Armstrongite (TL) | 9.EA.35 | CaZr[Si6O15] · 3H2O |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Polylithionite | 9.EC.20 | KLi2Al(Si4O10)(F,OH)2 |
| ⓘ | Montmorillonite | 9.EC.40 | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| ⓘ | Neptunite | 9.EH.05 | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Mongolite (TL) | 9.HF.05 | Ca4Nb6Si5O24(OH)10 · nH2O |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Monazite Group' | - | REE(PO4) |
| ⓘ | 'Xenotime' | - | |
| ⓘ | 'Feldspar Group var. Perthite' | - | |
| ⓘ | 'Parisite' | - | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| ⓘ | 'Synchysite' | - | Ca(Ce/Nd/Y/REE)(CO3)2F |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Pyroxene Group' | - | ADSi2O6 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Kovalenkoite' (TL) | - | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| ⓘ | 'Alkali amphibole' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| H | ⓘ Armstrongite | CaZr[Si6O15] · 3H2O |
| H | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| H | ⓘ Coffinite | U(SiO4) · nH2O |
| H | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| H | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| H | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| H | ⓘ Mongolite | Ca4Nb6Si5O24(OH)10 · nH2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| H | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| H | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Li | Lithium | |
| Li | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Li | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Be | Beryllium | |
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| C | Carbon | |
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| C | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | Oxygen | |
| O | ⓘ Aegirine | NaFe3+Si2O6 |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| O | ⓘ Armstrongite | CaZr[Si6O15] · 3H2O |
| O | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| O | ⓘ Coffinite | U(SiO4) · nH2O |
| O | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| O | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| O | ⓘ Gittinsite | CaZrSi2O7 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| O | ⓘ Monazite Group | REE(PO4) |
| O | ⓘ Mongolite | Ca4Nb6Si5O24(OH)10 · nH2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| O | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| O | ⓘ Pyrolusite | Mn4+O2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Uraninite | UO2 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| O | ⓘ Pyroxene Group | ADSi2O6 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| O | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| O | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| F | Fluorine | |
| F | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| F | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| F | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Na | Sodium | |
| Na | ⓘ Aegirine | NaFe3+Si2O6 |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Na | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Na | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Na | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Na | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| Na | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Na | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Na | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | Silicon | |
| Si | ⓘ Aegirine | NaFe3+Si2O6 |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Si | ⓘ Armstrongite | CaZr[Si6O15] · 3H2O |
| Si | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Si | ⓘ Coffinite | U(SiO4) · nH2O |
| Si | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Si | ⓘ Gittinsite | CaZrSi2O7 |
| Si | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Si | ⓘ Mongolite | Ca4Nb6Si5O24(OH)10 · nH2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Si | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Si | ⓘ Pyroxene Group | ADSi2O6 |
| Si | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| Si | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| P | Phosphorus | |
| P | ⓘ Monazite Group | REE(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3A |
| K | Potassium | |
| K | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| K | ⓘ Polylithionite | KLi2Al(Si4O10)(F,OH)2 |
| K | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| Ca | Calcium | |
| Ca | ⓘ Armstrongite | CaZr[Si6O15] · 3H2O |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gittinsite | CaZrSi2O7 |
| Ca | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| Ca | ⓘ Mongolite | Ca4Nb6Si5O24(OH)10 · nH2O |
| Ca | ⓘ Montmorillonite | (Na,Ca)0.33(Al,Mg)2(Si4O10)(OH)2 · nH2O |
| Ca | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ca | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| Ca | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Ti | Titanium | |
| Ti | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Ti | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| Ti | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| V | Vanadium | |
| V | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Cr | Chromium | |
| Cr | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Mn | Manganese | |
| Mn | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| Mn | ⓘ Pyrolusite | Mn4+O2 |
| Fe | Iron | |
| Fe | ⓘ Aegirine | NaFe3+Si2O6 |
| Fe | ⓘ Arfvedsonite | NaNa2(Fe42+Fe3+)Si8O22(OH)2 |
| Fe | ⓘ Astrophyllite | K2NaFe72+Ti2[Si4O12]2O2(OH)4F |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Hydroastrophyllite | [H3O]2+CaFe72+Ti2[Si4O12]2O2(OH)4O |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Neptunite | KNa2Li(Fe2+)2Ti2[Si4O12]2 |
| Zn | Zinc | |
| Zn | ⓘ Landauite | NaMnZn2(Ti,Fe)6Ti12O38 |
| Sr | Strontium | |
| Sr | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| Y | Yttrium | |
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Y | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| Zr | Zirconium | |
| Zr | ⓘ Armstrongite | CaZr[Si6O15] · 3H2O |
| Zr | ⓘ Catapleiite | Na2Zr(Si3O9) · 2H2O |
| Zr | ⓘ Elpidite | Na2ZrSi6O15 · 3H2O |
| Zr | ⓘ Gittinsite | CaZrSi2O7 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Elpidite var. Calcium-bearing Elpidite | (Na,Ca)2ZrSi6O15 · 3H2O |
| Nb | Niobium | |
| Nb | ⓘ Mongolite | Ca4Nb6Si5O24(OH)10 · nH2O |
| Nb | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ba | Barium | |
| Ba | ⓘ Kovalenkoite | (K,Sr,Ba)2Ca5Nb12[Si8O52(O,OH)] · 15H2O |
| La | Lanthanum | |
| La | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| La | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Ce | Cerium | |
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Ce | ⓘ Synchysite-(Ce) | CaCe(CO3)2F |
| Ce | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Nd | Neodymium | |
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
| Nd | ⓘ Parisite | Ca(Ce/La/Nd/REE)2(CO3)3F2 |
| Pb | Lead | |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| U | Uranium | |
| U | ⓘ Coffinite | U(SiO4) · nH2O |
| U | ⓘ Davidite-(La) | La(Y,U)Fe2(Ti,Fe,Cr,V)18(O,OH,F)38 |
| U | ⓘ Uraninite | UO2 |
Geochronology
Mineralization age: Permian : 292 ± 1 Ma to 283 ± 4 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||
| Paleozoic | ||||||||||||||||
| Permian | ||||||||||||||||
| Cisuralian |
| |||||||||||||||
Localities in this Region
- Ömnögovi Province
- Khanbogd District
- Khan Bogd Peralkaline Granite
- Khanbogd District
Other Regions, Features and Areas containing this locality
AsiaContinent
- Gobi DesertDesert
Eurasian PlateTectonic Plate
- Henegshan-Baolidao Accretionary ComplexAccretionary Complex
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Kynicky, J., Chakhmouradian, A. R., Xu, C., Krmicek, L., Galiova, M. (2011) Distribution and evolution of zirconium mineralization in peralkaline granites and associated pegmatites of the Khan Bogd complex, southern Mongolia. The Canadian Mineralogist, 49 (4). 947-965 doi:10.3749/canmin.49.4.947
Woolley, Alan R. (2019) Alkaline Rocks and Carbonatites of the World. Part 4: Antarctica, Asia and Europe (excluding the former USSR), Australasia and Oceanic Islands. The Geological Society of London. doi:10.1144/mpar4p.167
Dostal, Jaroslav; Gerel, Ochir (2022) Occurrences of Niobium and Tantalum Mineralization in Mongolia. Minerals, 12 (12). 1529 doi:10.3390/min12121529
Breiter, Karel, Kynický, Jindřich, Korbelová, Zuzana (2024) Chemical and Textural Peculiarities of Zircon from Peralkaline Granites and Quartz-Bearing Syenites. Minerals, 14 (2) doi:10.3390/min14020187
Vakanjac, Boris; Simić, Marko; Drobnjak, Siniša; Petrović, Rastko; Banković, Radoje; Bakrač, Saša; Kostić, Miodrag (2026) Uranium Sources and Depositional Environments in Southeastern Mongolia: Case Studies from the Han Bogd Granite Massif, Ail Bayan Coal Deposit, Suujin Tal Structural System, Zuunbayan Depression, and Naarst Structural Complex. Minerals, 16 (5). doi:10.3390/min16050447
Quick NavTopCommoditiesMineral ListRock TypesGeochronologyLocalities in RegionOther RegionsReferences







Khan Bogd Peralkaline Granite, Khanbogd District, Ömnögovi Province, Mongolia