Canaan, Litchfield County, Connecticut, USAi
| Regional Level Types | |
|---|---|
| Canaan | Town |
| Litchfield County | County |
| Connecticut | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Canaan is a town incorporated 1739. It originally included the town of North Canaan, which split from the town of Canaan in 1858. Note that North Canaan includes the village of Canaan (formerly known as Canaan Depot) and sometimes referred to as "Canaan Village" to distinguish it from the town of Canaan. The entire town of Canaan is often casually referred to as "Falls Village" (which is the principal population center in the town of Canaan) or "South Canaan" for the same reason.
Canaan is host to a few marble quarries; on Battle Hill within Falls Village, or on the east side of the unnamed hill just west of Sand Road. The two quarries on Sand Road are still active as of 2012.
Specimens labelled as just "Canaan" without a more specific locality are more likely from the town of North Canaan because the village of Canaan is the largest local population center in that town and is closer to the more numerous and largest and longest active marble quarries.
The locality coordinates are for the intersection of U. S. Route 7 and state Route 126 in Falls Village.
Geologically, the low-lying northwestern part of Canaan, and the Wangum Lake Brook valley in the southeast, is underlain by the Cambrian Stockbridge Marble and Ordovician Walloomsac Marble and Schist. Canaan Mountain, dominating the northeast part of town, is underlain by Cambrian Canaan Mountain Schist, which was thrust over the marbles. Proterozoic gneiss with some Cambrian Dalton Formation quartzite, gneiss and schist underlies Cobble Hill and the rugged terrain in the southern part of town.
Canaan is host to a few marble quarries; on Battle Hill within Falls Village, or on the east side of the unnamed hill just west of Sand Road. The two quarries on Sand Road are still active as of 2012.
Specimens labelled as just "Canaan" without a more specific locality are more likely from the town of North Canaan because the village of Canaan is the largest local population center in that town and is closer to the more numerous and largest and longest active marble quarries.
The locality coordinates are for the intersection of U. S. Route 7 and state Route 126 in Falls Village.
Geologically, the low-lying northwestern part of Canaan, and the Wangum Lake Brook valley in the southeast, is underlain by the Cambrian Stockbridge Marble and Ordovician Walloomsac Marble and Schist. Canaan Mountain, dominating the northeast part of town, is underlain by Cambrian Canaan Mountain Schist, which was thrust over the marbles. Proterozoic gneiss with some Cambrian Dalton Formation quartzite, gneiss and schist underlies Cobble Hill and the rugged terrain in the southern part of town.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities28 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) Colour: white References: |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 Habit: trapezohedral Colour: maroon Description: Subhedral crystals to 5 mm. References: |
| ⓘ Aragonite Formula: CaCO3 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Habit: elongated prismatic Colour: honey yellow Description: Subhedral crystals to 3 cm, smaller ones with very gemmy interiors. References: |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' Habit: subhedral grains Colour: dark green References: |
| ⓘ Chondrodite Formula: Mg5(SiO4)2F2 References: |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' Colour: black Description: very small crystals References: |
| ⓘ Diopside Formula: CaMgSi2O6 Localities: Habit: flattened short to elongated prisms
Colour: white to very pale green Fluorescence: light blue-gray under SW Description: pseudomorphed by tremolite (originally called Canaanite) |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Fluorescence: Yellow under SW UV Description: Small grains seen mostly via yellow fluorescence. References: |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 References: |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C Locality: Fulgurite (native iron) occurrence, Canaan Mountain, Canaan, Litchfield County, Connecticut, USA Habit: massive Description: Coating and mixed with native iron in an apparent fulgurite. |
| ⓘ Grossular Formula: Ca3Al2(SiO4)3 |
| ⓘ Gypsum Formula: CaSO4 · 2H2O Habit: flat prisms Colour: colorless Description: Micro crystals and coatings filling thin fractures in a loose, rusty, calcareous schist boulder. References: |
| ⓘ Gypsum var. Selenite Formula: CaSO4 · 2H2O Habit: flat prisms Colour: colorless Description: Micro crystals and coatings filling thin fractures in a loose, rusty, calcareous schist boulder. References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: Robinson, Samuel (1825) A Catalogue of American Minerals, With Their Localities - Including All Which Are Known to Exist in the United States and British Provinces, And Having the Towns, Counties, and Districts in Each State and Province Arranged Alphabetically. With an Appendix, Containing Additional Localities and a Tabular View. Cummings, Hilliard, & Co. |
| ⓘ 'Limonite' |
| ⓘ Marialite Formula: Na4Al3Si9O24Cl Habit: subhedral elongated prisms, square cross-section Colour: gray to dark gray Fluorescence: pale yellow Description: Crystals to 15m or so, translucent, but look like mechanical pencil lead lying in fine-grained, gray dolomite-phlogopite-tremolite-sulfide rock. Crystals mostly first order prisms with square cross-sections modified by minor second order prisms. Poorly terminated. References: |
| ⓘ Microcline Formula: K(AlSi3O8) Colour: white References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Native Iron Formula: Fe Locality: Fulgurite (native iron) occurrence, Canaan Mountain, Canaan, Litchfield County, Connecticut, USA Description: Mixed with graphite and quartz - part of a likely fulgurite. References: |
| ⓘ Phlogopite Formula: KMg3(AlSi3O10)(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ 'Scapolite' |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Colour: black Description: Subhedral crystals to a few cms. References: |
| ⓘ Sillimanite Formula: Al2(SiO4)O References: |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 Localities: Habit: Primary - bladed, pseudomorphs after diopside are flattened short to elongated prisms Colour: white, pale gray, pale green Fluorescence: light blue-gray under SW Description: As primary crystal to 15 cm as individual crystals or even larger as parallel to fan-shaped aggregates, or as pseudomorphs after diopside (originally called canaanite) to 10 cm. |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Zircon Formula: Zr(SiO4) Colour: brown Description: Microcrystals References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Iron | 1.AE.05 | Fe |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | var. Selenite | 7.CD.40 | CaSO4 · 2H2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Grossular | 9.AD.25 | Ca3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Sillimanite | 9.AF.05 | Al2(SiO4)O |
| ⓘ | Chondrodite | 9.AF.45 | Mg5(SiO4)2F2 |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Phlogopite | 9.EC.20 | KMg3(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Marialite | 9.FB.15 | Na4Al3Si9O24Cl |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| H | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Grossular | Ca3Al2(SiO4)3 |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Marialite | Na4Al3Si9O24Cl |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Sillimanite | Al2(SiO4)O |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| F | Fluorine | |
| F | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Marialite | Na4Al3Si9O24Cl |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Marialite | Na4Al3Si9O24Cl |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Sillimanite | Al2(SiO4)O |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Chondrodite | Mg5(SiO4)2F2 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Marialite | Na4Al3Si9O24Cl |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Sillimanite | Al2(SiO4)O |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Cl | Chlorine | |
| Cl | ⓘ Marialite | Na4Al3Si9O24Cl |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Phlogopite | KMg3(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Grossular | Ca3Al2(SiO4)3 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Gypsum var. Selenite | CaSO4 · 2H2O |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Native Iron | Fe |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Canaan,_Connecticut |
|---|---|
| Wikidata ID: | Q753937 |
| GeoNames ID: | 5283400 |
Localities in this Region
- Connecticut
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Canaan, Litchfield County, Connecticut, USA