Mount Charlotte Gold Mine, Kalgoorlie-Boulder, Kalgoorlie-Boulder Shire, Western Australia, Australiai
| Regional Level Types | |
|---|---|
| Mount Charlotte Gold Mine | Mine |
| Kalgoorlie-Boulder | - not defined - |
| Kalgoorlie-Boulder Shire | Shire |
| Western Australia | State |
| Australia | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
30° 44' 33'' South , 121° 28' 46'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Kalgoorlie | 31,107 (2014) | 0.7km |
| Williamstown | 161 (2018) | 0.9km |
| Boulder | 5,178 (2017) | 4.5km |
| Stoneville | 2,841 (2016) | 30.7km |
| Coolgardie | 802 (2016) | 38.2km |
A gold mine owned by Homestake Mining Co. (48%) and Kalgoorlie Mining Assoc. Workings feature a 1,200 meter deep shaft. 394,000 tons ore yielded 1,700 kg Au (1984).
(2013) mine half owned each by Barrick Gold and Newmont who also own and operate the Superpit nearby. Located at the top of Hannan Street and very near the town, and the original gold discovery by Paddy Hannan. Named after the hill the mine is on, and has been mined almost continuously from around 1894. The orebodies are Charlotte, and Reward, with satellite orebodies Maritana and North Charlotte. The mine is very near the Golden Mile, and accesses the same geology, but is viewed as separate from the old historic Golden Mile mines.
The gold occurs in quartz vein systems, as a series of steeply plunging pipe-like vein stockwork orebodies in metagabbro of the Golden Mile dolerite. The Fimiston and Oroya Lodes (see Fimiston Mindat locality) cut the ore. The mineralisation is controlled by district scale north north-east trending strike slip faults.
The Charlotte orebody goes down 800 metres from the surface, 250 metres north-south, and up to 100 metres east-west. Reward extends 800 metres down from the surface, 250 metres north-south, and 50 metres east-west. Both are restricted to units in the host sill and adjacent to major steeply dipping faults that have cut the sill. There is gold in pyrite or pyrrhotite bearing metagabbro around the veins, and to a lesser degree free gold in the veins, and along the vein margins. The pyrite zones contain carbonate-pyrite-pyrrhotite-muscovite-arsenopyrite, with tellurides virtually absent. Pyrite is found as scattered grains 1 to 2 mms wide. Gold is found at the margins of the quartz veins, or bordering pyrite crystals, and along fractures in pyrite grains.
Silver rich D2 shear zones as part of the Golden Mile Fault at level 22 is described in one source, with tellurides hessite and altaite.
The stockwork of veins tends to be thin, but grouped together form ore shoots tens of metres wide, hundreds of metres in strike (east-west) and depth.
Veins developed during brittle fracture, resulting from movement on the Charlotte, Reward and Maritana Faults and then extended by hydrofracturing during the ingress of the mineralised fluids, and channelled by oblique faults.
Mineralisation in fractures is confined to the granophyric Unit 8 of Golden Mile Dolerite, including veins 2 to 20 cms thick, averaging 8 cms, densely packed with less than 1 metres separating them. Alteration zones cover up to 100 cms from the veins.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
30 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Altaite Formula: PbTe |
| ⓘ Alunite Formula: KAl3(SO4)2(OH)6 |
| ⓘ Ankerite Formula: Ca(Fe2+,Mg)(CO3)2 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baddeleyite Formula: ZrO2 |
| ⓘ Boulangerite Formula: Pb5Sb4S11 |
| ⓘ Bournonite Formula: PbCuSbS3 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Galena Formula: PbS |
| ⓘ Gold Formula: Au |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ 'Limonite' |
| ⓘ Magnesite Formula: MgCO3 |
| ⓘ Magnesite var. Breunnerite Formula: (Mg,Fe)CO3 |
| ⓘ Magnesite var. Mesitine Spar Formula: (Mg,Fe)CO3 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Muscovite var. Fuchsite Formula: K(Al,Cr)3Si3O10(OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Natroalunite Formula: NaAl3(SO4)2(OH)6 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
| ⓘ Zirconolite Formula: CaZrTi2O7 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Altaite | 2.CD.10 | PbTe |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Bournonite | 2.GA.50 | PbCuSbS3 |
| ⓘ | Boulangerite | 2.HC.15 | Pb5Sb4S11 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Baddeleyite | 4.DE.35 | ZrO2 |
| ⓘ | Zirconolite | 4.DH.30 | CaZrTi2O7 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Magnesite | 5.AB.05 | MgCO3 |
| ⓘ | var. Breunnerite | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | var. Mesitine Spar | 5.AB.05 | (Mg,Fe)CO3 |
| ⓘ | Ankerite | 5.AB.10 | Ca(Fe2+,Mg)(CO3)2 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Alunite | 7.BC.10 | KAl3(SO4)2(OH)6 |
| ⓘ | Natroalunite | 7.BC.10 | NaAl3(SO4)2(OH)6 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Magnesite | MgCO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| C | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| O | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| O | ⓘ Baddeleyite | ZrO2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnesite | MgCO3 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Zirconolite | CaZrTi2O7 |
| O | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Magnesite | MgCO3 |
| Mg | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Mg | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| S | Sulfur | |
| S | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Boulangerite | Pb5Sb4S11 |
| S | ⓘ Bournonite | PbCuSbS3 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Natroalunite | NaAl3(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ Alunite | KAl3(SO4)2(OH)6 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Zirconolite | CaZrTi2O7 |
| Ti | Titanium | |
| Ti | ⓘ Rutile | TiO2 |
| Ti | ⓘ Zirconolite | CaZrTi2O7 |
| Cr | Chromium | |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Ankerite | Ca(Fe2+,Mg)(CO3)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Magnesite var. Breunnerite | (Mg,Fe)CO3 |
| Fe | ⓘ Magnesite var. Mesitine Spar | (Mg,Fe)CO3 |
| Cu | Copper | |
| Cu | ⓘ Bournonite | PbCuSbS3 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Y | Yttrium | |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Baddeleyite | ZrO2 |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Zr | ⓘ Zirconolite | CaZrTi2O7 |
| Ag | Silver | |
| Ag | ⓘ Hessite | Ag2Te |
| Sb | Antimony | |
| Sb | ⓘ Boulangerite | Pb5Sb4S11 |
| Sb | ⓘ Bournonite | PbCuSbS3 |
| Te | Tellurium | |
| Te | ⓘ Altaite | PbTe |
| Te | ⓘ Hessite | Ag2Te |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Altaite | PbTe |
| Pb | ⓘ Boulangerite | Pb5Sb4S11 |
| Pb | ⓘ Bournonite | PbCuSbS3 |
| Pb | ⓘ Galena | PbS |
Geochronology
Mineralization age: Neoarchean : 2695 ± 16 Ma to 2602 ± 8 MaImportant note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
| Geologic Time | Rocks, Minerals and Events | ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Precambrian | |||||||||||||
| Archean | |||||||||||||
| Neoarchean |
| ||||||||||||
Other Regions, Features and Areas containing this locality
Australia
- Western Australia
- Kambalda Nickel Metallogenic ProvinceGeologic Province
- West Australian ElementCraton
- Yilgarn CratonCraton
Australian PlateTectonic Plate
- West Australian Craton
- Eastern Yilgarn CratonCraton
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Rasmussen, Birger, Mueller, Andreas G., Fletcher, Ian R. (2009) Zirconolite and xenotime U–Pb age constraints on the emplacement of the Golden Mile Dolerite sill and gold mineralization at the Mt Charlotte mine, Eastern Goldfields Province, Yilgarn Craton, Western Australia. Contributions to Mineralogy and Petrology, 157 (5) 559-572 doi:10.1007/s00410-008-0352-7



Mount Charlotte Gold Mine, Kalgoorlie-Boulder, Kalgoorlie-Boulder Shire, Western Australia, Australia