Lanmuchang Tl deposit, Huijiabao gold field, Xingren County, Qianxinan, Guizhou, Chinai
| Regional Level Types | |
|---|---|
| Lanmuchang Tl deposit | Deposit |
| Huijiabao gold field | - not defined - |
| Xingren County | County |
| Qianxinan | Prefecture |
| Guizhou | Province |
| China | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
25° 31' 32'' North , 105° 30' 32'' East
Latitude & Longitude (decimal):
Type:
Age:
298.9 ± 0.15 to ~237 Ma
Geologic Time:
Köppen climate type:
Other/historical names associated with this locality:
Lanmuchang Tl-Hg deposit
Name(s) in local language(s):
滥木厂砣汞矿, 兴仁县, 黔西南布依族苗族自治州, 贵州省, 中国
The thallium-rich orebodies extend over an area of about 1.5 square km. They contain lorándite as the major ore mineral. Major geogenic pollution affecting human health has been documented.
The deposit was formed by biomethallogenesis (involving the enrichment of Tl in micro-paleo-animals in rocks and ores, biofossil casts in Tl-rich ores, the involvement of bio-sulfur in minerogenesis, and the enrichment of biogenetic organic carbon in Tl ores) and subsequent hydrothermal reworking (Zhang et al., 2007).
The deposit was originally formed in the Late Permian. Subsequently, hydrothermal reworking took place during the Middle Triassic (Zhang & Zhang, 2000).
The Lanmuchang Anticline extends northeastward (40–60°) and is ~700 m long and ~250 m wide. Fault structures primarily developed in two groups: northeast- and approximately north-south-trending structures. The north-south-trending Huilong Fault cuts through the Lanmuchang Anticline at a breaking distance of ~200 m. Exposed strata primarily include the Lower Permian Maokou Formation; Upper Permian Longtan, Changxing, and Dalong Formations; and Lower Triassic Yelang Formation. Ore-bearing rocks are diverse and primarily include limestone, silty claystone, carbonaceous siltstone, and shale, which are typically mixed to form banded and laminated structures. Due to the diversity of the ore-bearing strata, more than 20 mineralized horizons have been identified. Hydrothermal alteration is dominated by low-temperature alteration, including sulfidation, silicification, decarbonation, carbonation, and kaolinitization. Kaolinitization is responsible for the formation of not only kaolinite but also subordinate amounts of illite.
According to the characteristics of ore paragenesis, texture, and alteration, the mineralization can be preliminarily divided into three stages: pyrite–quartz–illite (I), cinnabar–kaolinite–calcite–fluorite (II), and lorándite–pyrite–quartz (III). Stage I is the primary mineralization stage of Au and the initial enrichment stage of Hg and Tl, and these mineralizing elements are primarily enriched in pyrite. Stage II is the primary Hg mineralization stage, characterized by cinnabar enrichment. Stage III is the primary Tl mineralization stage, characterized by lorándite enrichment.
The mineralized layers of the Lanmuchang Hg-(Tl) deposit extend up to 15 layers, primarily distributed in the Permian Longtan Formation and Changxing Formation, followed by the Triassic Yelang Formation. These orebodies owe their formation and occurrence to a combination of structural and stratigraphic controls, characterized by distinctive layered and lens-shaped features that closely resemble the surrounding sediments. The mercury content in the orebodies typically ranges from 0.08% to 0.3%, with the highest concentration reaching 1.17% and the resource amounting to 4874 tons. Thallium grades generally fall between 0.01% and 0.02%, peaking at 0.035%, with resources exceeding 500 tons.
The deposit was formed by biomethallogenesis (involving the enrichment of Tl in micro-paleo-animals in rocks and ores, biofossil casts in Tl-rich ores, the involvement of bio-sulfur in minerogenesis, and the enrichment of biogenetic organic carbon in Tl ores) and subsequent hydrothermal reworking (Zhang et al., 2007).
The deposit was originally formed in the Late Permian. Subsequently, hydrothermal reworking took place during the Middle Triassic (Zhang & Zhang, 2000).
The Lanmuchang Anticline extends northeastward (40–60°) and is ~700 m long and ~250 m wide. Fault structures primarily developed in two groups: northeast- and approximately north-south-trending structures. The north-south-trending Huilong Fault cuts through the Lanmuchang Anticline at a breaking distance of ~200 m. Exposed strata primarily include the Lower Permian Maokou Formation; Upper Permian Longtan, Changxing, and Dalong Formations; and Lower Triassic Yelang Formation. Ore-bearing rocks are diverse and primarily include limestone, silty claystone, carbonaceous siltstone, and shale, which are typically mixed to form banded and laminated structures. Due to the diversity of the ore-bearing strata, more than 20 mineralized horizons have been identified. Hydrothermal alteration is dominated by low-temperature alteration, including sulfidation, silicification, decarbonation, carbonation, and kaolinitization. Kaolinitization is responsible for the formation of not only kaolinite but also subordinate amounts of illite.
According to the characteristics of ore paragenesis, texture, and alteration, the mineralization can be preliminarily divided into three stages: pyrite–quartz–illite (I), cinnabar–kaolinite–calcite–fluorite (II), and lorándite–pyrite–quartz (III). Stage I is the primary mineralization stage of Au and the initial enrichment stage of Hg and Tl, and these mineralizing elements are primarily enriched in pyrite. Stage II is the primary Hg mineralization stage, characterized by cinnabar enrichment. Stage III is the primary Tl mineralization stage, characterized by lorándite enrichment.
The mineralized layers of the Lanmuchang Hg-(Tl) deposit extend up to 15 layers, primarily distributed in the Permian Longtan Formation and Changxing Formation, followed by the Triassic Yelang Formation. These orebodies owe their formation and occurrence to a combination of structural and stratigraphic controls, characterized by distinctive layered and lens-shaped features that closely resemble the surrounding sediments. The mercury content in the orebodies typically ranges from 0.08% to 0.3%, with the highest concentration reaching 1.17% and the resource amounting to 4874 tons. Thallium grades generally fall between 0.01% and 0.02%, peaking at 0.035%, with resources exceeding 500 tons.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
40 valid minerals. 1 (TL) - type locality of valid minerals.
Rock Types Recorded
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Alum-(K) Formula: KAl(SO4)2 · 12H2O |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Arsenolite Formula: As2O3 |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Baryte Formula: BaSO4 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ 'Chlorite Group' |
| ⓘ Christite Formula: TlHgAsS3 References: |
| ⓘ Chromite Formula: Fe2+Cr3+2O4 |
| ⓘ Cinnabar Formula: HgS References: |
| ⓘ Dickite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Fibroferrite Formula: Fe3+(SO4)(OH) · 5H2O References: |
| ⓘ Florencite-(La) Formula: LaAl3(PO4)2(OH)6 |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Halotrichite Formula: Fe2+Al2(SO4)4 · 22H2O References: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Imhofite Formula: Tl5.8As15.4S26 |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 References: |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ Lanmuchangite (TL) Formula: Tl+Al(SO4)2 · 12H2O Type Locality: |
| ⓘ 'Limonite' |
| ✪ Lorándite Formula: TlAsS2 Description: main ore mineral in the thallium orebody and its crystals there can reach 4cm.
Dr. Philippe Roth, letter to Lapis(2007) References: Li, X., An, X., Nan, J. (1989): The second discovery of christite in nature. Chinese Science Bulletin 34(11), 942-945.(EPMA of co-existing lorándite) |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6(SO4) · H2O References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Muscovite var. Illite Formula: K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ Muscovite var. Sericite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Orpiment Formula: As2S3 References: |
| ⓘ Pickeringite Formula: MgAl2(SO4)4 · 22H2O |
| ⓘ Picropharmacolite Formula: Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| ⓘ Pyrite Formula: FeS2 References: |
| ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite Formula: (Fe,Tl)(S,As)2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Raguinite Formula: TlFeS2 |
| ⓘ Realgar Formula: As4S4 References: |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ 'Unnamed (Tl Arsenide-Sulphide)' Formula: Tl2AsS3 |
| ⓘ 'Unnamed (Tl-Cu Arsenide-Sulphide)' Formula: Tl6CuAs16S40 |
| ⓘ 'Unnamed (Tl-Sn Arsenide-Sulphide)' Formula: TlSnAsS3 |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Raguinite | 2.CB.60 | TlFeS2 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | var. Thallium- and Arsenic-bearing Pyrite | 2.EB.05a | (Fe,Tl)(S,As)2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Realgar | 2.FA.15a | As4S4 |
| ⓘ | Orpiment | 2.FA.30 | As2S3 |
| ⓘ | Lorándite | 2.HD.05 | TlAsS2 |
| ⓘ | Christite | 2.HD.15 | TlHgAsS3 |
| ⓘ | Imhofite | 2.HD.30 | Tl5.8As15.4S26 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Chromite | 4.BB.05 | Fe2+Cr3+2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Arsenolite | 4.CB.50 | As2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile | 4.DB.05 | TiO2 |
| ⓘ | Goethite | 4.FD.10 | Fe3+O(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6(SO4) · H2O |
| ⓘ | Halotrichite | 7.CB.85 | Fe2+Al2(SO4)4 · 22H2O |
| ⓘ | Pickeringite | 7.CB.85 | MgAl2(SO4)4 · 22H2O |
| ⓘ | Alum-(K) | 7.CC.20 | KAl(SO4)2 · 12H2O |
| ⓘ | Lanmuchangite (TL) | 7.CC.20 | Tl+Al(SO4)2 · 12H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Fibroferrite | 7.DC.15 | Fe3+(SO4)(OH) · 5H2O |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Florencite-(La) | 8.BL.13 | LaAl3(PO4)2(OH)6 |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Picropharmacolite | 8.CH.15 | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite var. Illite | 9.EC.15 | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | var. Sericite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Dickite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
| ⓘ | 'Unnamed (Tl-Cu Arsenide-Sulphide)' | - | Tl6CuAs16S40 |
| ⓘ | 'Unnamed (Tl-Sn Arsenide-Sulphide)' | - | TlSnAsS3 |
| ⓘ | 'Unnamed (Tl Arsenide-Sulphide)' | - | Tl2AsS3 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| H | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| H | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| H | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| H | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| H | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
| H | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| O | Oxygen | |
| O | ⓘ Arsenolite | As2O3 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Chromite | Fe2+Cr23+O4 |
| O | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| O | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| O | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| O | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
| O | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Mg | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| Al | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Al | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| Al | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Dickite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
| Si | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| P | Phosphorus | |
| P | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Christite | TlHgAsS3 |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| S | ⓘ Imhofite | Tl5.8As15.4S26 |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Lorándite | TlAsS2 |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| S | ⓘ Orpiment | As2S3 |
| S | ⓘ Pickeringite | MgAl2(SO4)4 · 22H2O |
| S | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Raguinite | TlFeS2 |
| S | ⓘ Realgar | As4S4 |
| S | ⓘ Native Sulphur | S8 |
| S | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| S | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| S | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| S | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| S | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Illite | K0.65Al2.0[Al0.65Si3.35O10](OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Alum-(K) | KAl(SO4)2 · 12H2O |
| K | ⓘ Muscovite var. Sericite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Rutile | TiO2 |
| Cr | Chromium | |
| Cr | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chromite | Fe2+Cr23+O4 |
| Fe | ⓘ Fibroferrite | Fe3+(SO4)(OH) · 5H2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Halotrichite | Fe2+Al2(SO4)4 · 22H2O |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Melanterite | Fe2+(H2O)6(SO4) · H2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Raguinite | TlFeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| Cu | Copper | |
| Cu | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| As | Arsenic | |
| As | ⓘ Arsenolite | As2O3 |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Christite | TlHgAsS3 |
| As | ⓘ Imhofite | Tl5.8As15.4S26 |
| As | ⓘ Lorándite | TlAsS2 |
| As | ⓘ Orpiment | As2S3 |
| As | ⓘ Picropharmacolite | Ca4Mg(AsO4)2(HAsO4)2 · 11H2O |
| As | ⓘ Realgar | As4S4 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| As | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| As | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| As | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
| Sn | Tin | |
| Sn | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| La | Lanthanum | |
| La | ⓘ Florencite-(La) | LaAl3(PO4)2(OH)6 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Hg | Mercury | |
| Hg | ⓘ Christite | TlHgAsS3 |
| Hg | ⓘ Cinnabar | HgS |
| Tl | Thallium | |
| Tl | ⓘ Christite | TlHgAsS3 |
| Tl | ⓘ Imhofite | Tl5.8As15.4S26 |
| Tl | ⓘ Lorándite | TlAsS2 |
| Tl | ⓘ Raguinite | TlFeS2 |
| Tl | ⓘ Lanmuchangite | Tl+Al(SO4)2 · 12H2O |
| Tl | ⓘ Pyrite var. Thallium- and Arsenic-bearing Pyrite | (Fe,Tl)(S,As)2 |
| Tl | ⓘ Unnamed (Tl-Cu Arsenide-Sulphide) | Tl6CuAs16S40 |
| Tl | ⓘ Unnamed (Tl-Sn Arsenide-Sulphide) | TlSnAsS3 |
| Tl | ⓘ Unnamed (Tl Arsenide-Sulphide) | Tl2AsS3 |
Other Regions, Features and Areas containing this locality
AsiaContinent
China
- Giant Sb metallogenic beltMineral Belt
- Sichuan-Yunnan-Guizhou Li Mineral BeltMineral Belt
- ⭔Southwest ChinaRegion
- Youjiang metallogenic provinceMineral Province
Eurasian PlateTectonic Plate
- Eastern Yangtze CratonCraton
- Nanpanjiang BasinBasin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Daiyan, Chen, Guanxin, Wang, Zhenxi, Zou, Yuming, Chen (2003) Lanmuchangite, a new thallium (Hydrous) Sulphate from Lanmuchang, Guizhou Province, China. Chinese Journal of Geochemistry, 22 (2) 185-192 doi:10.1007/bf02831529
Lin, Jingfen; Yin, Meiling; Wang, Jin; Liu, Juan; Tsang, Daniel C.W.; Wang, Yuxuan; Lin, Mao; Li, Hongchun; Zhou, Yaoyu; Song, Gang; et al. (2020) Geochemical fractionation of thallium in contaminated soils near a large-scale Hg-Tl mineralised area. Chemosphere, 239. 124775 doi:10.1016/j.chemosphere.2019.124775
Ning, Zengping; Liu, Enguang; Yao, Dongju; Xiao, Tangfu; Ma, Liang; Liu, Yizhang; Li, Hang; Liu, Chengshuai (2021) Contamination, oral bioaccessibility and human health risk assessment of thallium and other metal(loid)s in farmland soils around a historic Tl Hg mining area. Science of The Total Environment, 758. 143577 doi:10.1016/j.scitotenv.2020.143577






Lanmuchang Tl deposit, Huijiabao gold field, Xingren County, Qianxinan, Guizhou, China