Kit Hill United Mines (incl. Kit Hill Great Consols), Callington, Stokeclimsland, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Kit Hill United Mines (incl. Kit Hill Great Consols) | Group of Mines |
| Callington | - not defined - |
| Stokeclimsland | Village |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
50° 31' 9'' North , 4° 17' 36'' West (est.)
Estimate based on other nearby localities or region boundaries.
Margin of Error:
~0km
Type:
Group of Mines
Köppen climate type:
Primarily exploited for Cassiterite and Wolframite as late as the first world war, the hill has been mapped and is said to contain up to 1000 shafts, pits and other trials for minerals.
One of the final trials was the Excelsior mine tunnel see the separate entry.
One of the final trials was the Excelsior mine tunnel see the separate entry.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities20 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Varlamoffite | 4.DB.05 | Sn1-xFexO2-x(OH) |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Beudantite | 8.BL.05 | PbFe3+3(AsO4)(SO4)(OH)6 |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Wavellite | 8.DC.50 | Al3(PO4)2(OH)3 · 5H2O |
| Group 9 - Silicates | |||
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Carpholite ? | 9.DB.05 | Mn2+Al2(Si2O6)(OH)4 |
| Unclassified | |||
| ⓘ | 'K Feldspar var. Adularia' | - | KAlSi3O8 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| H | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| H | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| H | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| H | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Be | Beryllium | |
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| O | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| O | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| O | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Al | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| Si | Silicon | |
| Si | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
| Si | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Wavellite | Al3(PO4)2(OH)3 · 5H2O |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| K | Potassium | |
| K | ⓘ K Feldspar var. Adularia | KAlSi3O8 |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Mn | Manganese | |
| Mn | ⓘ Carpholite | Mn2+Al2(Si2O6)(OH)4 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Varlamoffite | Sn1-xFexO2-x(OH) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Beudantite | PbFe33+(AsO4)(SO4)(OH)6 |
| Pb | ⓘ Galena | PbS |
Geochronology
| Geologic Time | Rocks, Minerals and Events | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Phanerozoic | ||||||||||||||||||||||
| Paleozoic | ||||||||||||||||||||||
| Permian | ||||||||||||||||||||||
| Guadalupian |
| |||||||||||||||||||||
| Cisuralian |
| |||||||||||||||||||||
Localities in this Region
- England
- Cornwall
- Stokeclimsland
- Callington
- Kit Hill United Mines (incl. Kit Hill Great Consols)
- Callington
- Stokeclimsland
- Cornwall
Other Regions, Features and Areas containing this locality
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Callington and Tavistock Mining DistrictMining District
- Cornubian mining districtMining District
- Tamar Valley National LandscapeNational Landscape
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Kit Hill United Mines, Callington, Stokeclimsland, Cornwall, England, UK