Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, Francei
| Regional Level Types | |
|---|---|
| Perros-Guirec | Commune |
| Lannion | Arrondissement |
| Côtes-d'Armor | Department |
| Brittany | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Perros-Guirec | 8,062 (2016) |
Other Languages:
French:
Perros-Guirec, Lannion, Côtes-d'Armor, Bretagne, France
German:
Perros-Guirec, Arrondissement Lannion, Département Côtes-d’Armor, Bretagne, Frankreich
Italian:
Perros-Guirec, arrondissement di Lannion, Côtes-d'Armor, Bretagna, Francia
Russian:
Перрос-Гирек, Ланьон, Кот-д’Армор, Бретань, Франция
Simplified Chinese:
佩尔罗吉雷克, 兰尼昂区, 阿摩尔滨海省, 布列塔尼半岛, 法国
Spanish:
Perros-Guirec, Distrito de Lannion, Costas de Armor, Bretón, Francia
Afrikaans:
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankryk
Aragonese:
Perros-Guirec, Destrito de Lannuon, Costas d'Armor, Bretanya, Francia
Asturian:
Perros-Guirec, Bretaña, Francia
Bambara:
Perros-Guirec, Faransi
Basque:
Perros-Guirec, Lanniongo barrutia, Côtes-d'Armor, Bretainia, Frantzia
Bavarian:
Perros-Guirec, Arrondissement Lannion, Département Côtes-d’Armor, Bretagne, Frankreich
Breton:
Perroz-Gireg, Lannuon, Aodoù-an-Arvor, Breizh, Bro-C'hall
Buginese:
Perros-Guirec, Perancis
Catalan:
Perros-Guirec, districte de Lannion, Costes d'Armor, Bretanya, França
Cebuano:
Perros-Guirec, Arrondissement de Lannion, Côtes-d'Armor, Bretagne, Pransiya
Chechen:
Перрос-Гирек, Ланьон , Кот-д’Армор, Бретань, Франци
Corsican:
Perros-Guirec, Francia
Croatian:
Perros-Guirec, Bretanja, Francuska
Czech:
Perros-Guirec, Arrondissement Lannion, Côtes-d'Armor, Bretaň, Francie
Danish:
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankrig
Dutch:
Perros-Guirec, Arrondissement Lannion, Côtes-d'Armor, Bretagne, Frankrijk
Dutch Low Saxon:
Perros-Guirec, Frankriek
Esperanto:
Perros-Guirec, Côtes-d'Armor, Bretonio, Francio
Estonian:
Perros-Guirec, Côtes-d'Armori departemang, Bretagne, Prantsusmaa
Faroese:
Perros-Guirec, Frakland
Finnish:
Perros-Guirec, Côtes-d'Armor, Bretagne, Ranska
Franco-Provençal:
Perros-Guirec, Coutes-d’Armor, Bretagne, France
Friulian:
Perros-Guirec, France
Galician:
Perros-Guirec, Côtes-d'Armor, Bretaña, Francia
Greek:
Περρος-Νκιρενκ, Διαμέρισμα του Λανιόν, Κοτ-ντ'Αρμόρ, Βρετάνη, Γαλλία
Greenlandic:
Perros-Guirec, Franskit Nunaat
Hungarian:
Perros-Guirec, Côtes-d’Armor, Bretagne, Franciaország
Icelandic:
Perros-Guirec, Côtes-d'Armor, Bretanía, Frakkland
Ido:
Perros-Guirec, Bretonia, Francia
Indonesian:
Perros-Guirec, Arondisemen Lannion, Côtes-d'Armor, Bretagne, Perancis
Interlingua:
Perros-Guirec, Departimento Cotes-d'Armor, Region Britannia, Francia
Interlingue:
Perros-Guirec, Francia
Irish Gaelic:
Perros-Guirec, An Bhriotáin, An Fhrainc
Jamaican Patois:
Perros-Guirec, Frans
Kabyle:
Perros-Guirec, Bretagne, Fransa
Kazakh (Cyrillic Script):
Перро-Гирек, Кот-д’Армор, Франция
Kongo:
Perros-Guirec, Côtes-d'Armor, Fwalansa
Latin:
Perros-Guirec, Litora ad Mare, Britannia Minor, Francia
Latvian:
Perros-Guirec, Kotdarmora, Bretaņa, Francija
Ligurian:
Perros-Guirec, Fransa
Limburgian:
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankriek
Lithuanian:
Perros-Guirec, Kot d'Armoras, Bretanė, Prancūzija
Low Saxon/Low German:
Perros-Guirec, Côtes-d'Armor, Frankriek
Luxembourgish:
Perros-Guirec, Arrondissement Lannion, Departement Côtes-d'Armor, Bretagne, Frankräich
Macedonian:
Перос-Гирек, Лањон, Арморски Брег, Бретања, Франција
Malagasy:
Perros-Guirec, Frantsa
Malay:
Perros-Guirec, Côtes-d'Armor, Bretagne, Perancis
Manx:
Perroz-Gireg, Aodoù-an-Arvor, Yn Vritaan, Yn Rank
Minangkabau:
Perros-Guirec, Parancih
Minnan / Hokkien-Taiwanese:
Perros-Guirec, Lannion Kūn, Côtes-d'Armor, Région Bretagne, Hoat-kok
Narom:
Perros-Guirec, Brétangne, France
Neapolitan:
Perros-Guirec, Franza
Norwegian:
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankrike
Norwegian (Nynorsk):
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankrike
Occitan:
Perros-Guirec, arrondiment de Lannuon, Còstas d'Arvòr, Bretanha, França
Papiamento:
Perros-Guirec, Fransia
Picard:
Perros-Guirec, Franche
Piedmontese:
Perros-Guirec, Côtes-d'Armor, Brëtagna, Fransa
Polish:
Perros-Guirec, Okręg Lannion, Côtes-d'Armor, Bretania, Francja
Portuguese:
Perros-Guirec, Côtes-d'Armor, Bretanha, França
Romanian:
Perros-Guirec, Arondismentul Lannion, Côtes-d'Armor, Bretania, Franța
Romansh:
Perros-Guirec, Frantscha
Sardinian:
Perros-Guirec, Bretagna, Frantza
Scots:
Perros-Guirec, Côtes-d'Armor, Breetany, Fraunce
Scottish Gaelic:
Perros-Guirec, Aodoù-an-Arvor, An Fhraing
Sicilian:
Perros-Guirec, Britagna, Francia
Slovak:
Perros-Guirec, Lannion, Côtes-d’Armor, Bretónsko, Francúzsko
Slovenian:
Perros-Guirec, Côtes-d'Armor, Bretanja, Francija
Swahili:
Perros-Guirec, Côtes-d'Armor, Bretagne, Ufaransa
Swedish:
Perros-Guirec, Côtes-d'Armor, Bretagne, Frankrike
Traditional Chinese:
佩爾羅吉雷克, 阿摩爾濱海, 布禮斯大區, 法國
Turkish:
Perros-Guirec, Côtes-d'Armor, Bretonya, Fransa
Ukrainian:
Перро-Гірек, Кот-д'Армор, Бретань, Франція
Uzbek (Latin Script):
Perros-Guirec, Bretan, Fransiya
Venetian:
Perros-Guirec, Côtes-d'Armor, Bretagna, Fransa
Vietnamese:
Perros-Guirec, Lannion, Côtes-d'Armor, Bretagne, Pháp
Volapük:
Perros-Guirec, Fransän
Walloon:
Perros-Guirec, France
Waray:
Perros-Guirec, Côtes-d'Armor, Bretagne, Fransya
Welsh:
Perroz-Gireg, Aodoù-an-Arvor, Bretagne, Ffrainc
West Flemish:
Perros-Guirec, Bretagne, Vrankryk
Wolof:
Perros-Guirec, Faraas
Zulu:
Perros-Guirec, IFulansi
Perros-Guirec (pronounced [pɛ.ʁos ɡi.ʁɛk]; Breton: Perroz-Gireg) is a commune in the Côtes-d'Armor department in Brittany in northwestern France. It has been a seaside resort since the end of the 19th century.
The largest part of Perros-Guirec consists of the granodiorite of Perros-Guirec, formed during the Cadomian orogeny 615 million years ago; in modern plate tectonics, it is considered part of the Pan-African orogeny. This orogeny has also formed dolerite intrusions.
The westernmost part (La Clarté) is formed by the pink granite of Ploumanac’h. This is 300 million years old and was formed at the end of the Variscan orogeny (also called the Hercynian orogeny). Here are the quarries where minerals can be found.
Those 2 units are separated by a small zone of Icartian gneiss, nearly 2 billion years old.
The largest part of Perros-Guirec consists of the granodiorite of Perros-Guirec, formed during the Cadomian orogeny 615 million years ago; in modern plate tectonics, it is considered part of the Pan-African orogeny. This orogeny has also formed dolerite intrusions.
The westernmost part (La Clarté) is formed by the pink granite of Ploumanac’h. This is 300 million years old and was formed at the end of the Variscan orogeny (also called the Hercynian orogeny). Here are the quarries where minerals can be found.
Those 2 units are separated by a small zone of Icartian gneiss, nearly 2 billion years old.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities28 valid minerals. 1 (TL) - type locality of valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Oligoclase Formula: (Na,Ca)[Al(Si,Al)Si2O8] |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Description: Crystals up to 10 centimeters ("Les minéraux, leurs gisements, leurs associations", P. Bariand, F. Cesbron et J. Geffroy (1977), Editions Minéraux et Fossiles, BRGM). |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5(T8O22)W2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 References: |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Feldspar Group' |
| ⓘ ' Formula: ◻{Ca2}{Mg3Fe3+2}(Al2Si6O22)F2 Locality: Morle et Mica, Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France - erroneously reported References: |
| ⓘ Ferro-tschermakite (TL) Formula: ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 Type Locality: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 |
| ⓘ 'K Feldspar' |
| ⓘ Mackinawite Formula: FeS |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Molybdenite Formula: MoS2 Localities: Madec Quarry, La Clarté, Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France Société Armoricaine de Granite quarry, La Clarté, Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France Kerdu ("Trez Traou"), Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France Ploumanac'h, Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France Habit: Hexagonal flake Colour: Grey metallic Description: Crystals up to 3 centimeters and more ("Les minéraux, leurs gisements, leurs associations", P. Bariand, F. Cesbron et J. Geffroy (1977), Editions Minéraux et Fossiles, BRGM). |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 References: |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Titanite Formula: CaTiO(SiO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Mackinawite | 2.CC.25 | FeS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Ferro-tschermakite (TL) | 9.DE.10 | ◻Ca2(Fe2+3Al2)(Al2Si6O22)(OH)2 |
| ⓘ | 'Ferri-fluoro-tschermakite' ? | 9.DE.10 | ◻{Ca2}{Mg3Fe3+2}(Al2Si6O22)F2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Oligoclase | 9.FA.35 | (Na,Ca)[Al(Si,Al)Si2O8] |
| Unclassified | |||
| ⓘ | 'Amphibole Supergroup' | - | AB2C5(T8O22)W2 |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(C2+4C3+)(AlSi7O22)W2 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amphibole Supergroup | AB2C5(T8O22)W2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| O | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Mg | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Al | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Si | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| S | Sulfur | |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Galena | PbS |
| S | ⓘ Mackinawite | FeS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Albite var. Oligoclase | (Na,Ca)[Al(Si,Al)Si2O8] |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(C42+C3+)(AlSi7O22)W2 |
| Ca | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Ferro-tschermakite | ◻Ca2(Fe32+Al2)(Al2Si6O22)(OH)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Mackinawite | FeS |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Ferri-fluoro-tschermakite | ◻{Ca2}{Mg3Fe23+}(Al2Si6O22)F2 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Perros-Guirec |
|---|---|
| Wikidata ID: | Q239943 |
| GeoNames ID: | 2987863 |
Localities in this Region
- Brittany
- Côtes-d'Armor
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Quick NavTopCommoditiesMineral ListRock TypesFossilsOther DatabasesLocalities in RegionOther Regions
Perros-Guirec, Lannion, Côtes-d'Armor, Brittany, France