Johnny Lyon Hills, Yellowstone Mining District, Cochise County, Arizona, USAi
| Regional Level Types | |
|---|---|
| Johnny Lyon Hills | Group of Hills |
| Yellowstone Mining District | Mining District |
| Cochise County | County |
| Arizona | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
32° 8' 8'' North , 110° 13' 58'' West
Latitude & Longitude (decimal):
Type:
Group of Hills
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Benson | 4,888 (2017) | 19.5km |
| Dragoon | 209 (2011) | 21.9km |
| Whetstone | 2,617 (2011) | 22.3km |
| Mescal | 1,812 (2011) | 25.0km |
| Saint David | 1,699 (2011) | 25.8km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Sunsites Gem and Mineral Club | Pearce, Arizona | 47km |
A range of hills.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsMineral List
Mineral list contains entries from the region specified including sub-localities45 valid minerals.
Detailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Silver | 1.AA.05 | Ag |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | var. Silver-bearing Galena | 2.CD.10 | PbS with Ag |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Friedrichite | 2.HB.05a | Cu5Pb5Bi7S18 |
| ⓘ | Nordströmite | 2.JB.25c | CuPb3Bi7(Se4S10) |
| Group 3 - Halides | |||
| ⓘ | Iodargyrite | 3.AA.10 | AgI |
| ⓘ | Chlorargyrite | 3.AA.15 | AgCl |
| ⓘ | Perite | 3.DC.30 | PbBiClO2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Blue Quartz | 4.DA.05 | SiO2 |
| ⓘ | 'Roméite Group' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Bindheimite | 4.DH.20 | Pb2Sb2O6O |
| ⓘ | Hydroxycalcioroméite | 4.DH.20 | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| ⓘ | 'Cuproroméite' | 4.DH.20 | Cu2Sb2(O,OH)7 |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Leadhillite | 5.BF.40 | Pb4(CO3)2(SO4)(OH)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite ? | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Duftite | 8.BH.35 | PbCu(AsO4)(OH) |
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Mottramite | 8.BH.40 | PbCu(VO4)(OH) |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| ⓘ | Phosphohedyphane | 8.BN.05 | Ca2Pb3(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Dioptase | 9.CJ.30 | CuSiO3 · H2O |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite var. Fuchsite | 9.EC.15 | K(Al,Cr)3Si3O10(OH)2 |
| ⓘ | 9.EC.15 | KAl2(AlSi3O10)(OH)2 | |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'Antimony Ochre' | - | |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Manganese Oxides var. Manganese Dendrites' | - | |
| ⓘ | '' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Dioptase | CuSiO3 · H2O |
| H | ⓘ Duftite | PbCu(AsO4)(OH) |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| H | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Mottramite | PbCu(VO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Cuproroméite | Cu2Sb2(O,OH)7 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bindheimite | Pb2Sb2O6O |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Dioptase | CuSiO3 · H2O |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Duftite | PbCu(AsO4)(OH) |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| O | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
| O | ⓘ Mottramite | PbCu(VO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Cuproroméite | Cu2Sb2(O,OH)7 |
| O | ⓘ Perite | PbBiClO2 |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Quartz var. Blue Quartz | SiO2 |
| O | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Al | Aluminium | |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Dioptase | CuSiO3 · H2O |
| Si | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| Si | ⓘ Quartz var. Blue Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Friedrichite | Cu5Pb5Bi7S18 |
| S | ⓘ Galena | PbS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| S | ⓘ Nordströmite | CuPb3Bi7(Se4S10) |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Cl | Chlorine | |
| Cl | ⓘ Chlorargyrite | AgCl |
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Cl | ⓘ Perite | PbBiClO2 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Ti | Titanium | |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Mottramite | PbCu(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Muscovite var. Fuchsite | K(Al,Cr)3Si3O10(OH)2 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Dioptase | CuSiO3 · H2O |
| Cu | ⓘ Duftite | PbCu(AsO4)(OH) |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Friedrichite | Cu5Pb5Bi7S18 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Mottramite | PbCu(VO4)(OH) |
| Cu | ⓘ Nordströmite | CuPb3Bi7(Se4S10) |
| Cu | ⓘ Cuproroméite | Cu2Sb2(O,OH)7 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| As | Arsenic | |
| As | ⓘ Duftite | PbCu(AsO4)(OH) |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Se | Selenium | |
| Se | ⓘ Nordströmite | CuPb3Bi7(Se4S10) |
| Mo | Molybdenum | |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Chlorargyrite | AgCl |
| Ag | ⓘ Iodargyrite | AgI |
| Ag | ⓘ Native Silver | Ag |
| Ag | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Sb | Antimony | |
| Sb | ⓘ Bindheimite | Pb2Sb2O6O |
| Sb | ⓘ Hydroxycalcioroméite | (Ca,Sb3+)2(Sb5+,Ti)2O6(OH) |
| Sb | ⓘ Cuproroméite | Cu2Sb2(O,OH)7 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| I | Iodine | |
| I | ⓘ Iodargyrite | AgI |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Bindheimite | Pb2Sb2O6O |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Duftite | PbCu(AsO4)(OH) |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Friedrichite | Cu5Pb5Bi7S18 |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Leadhillite | Pb4(CO3)2(SO4)(OH)2 |
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
| Pb | ⓘ Mottramite | PbCu(VO4)(OH) |
| Pb | ⓘ Nordströmite | CuPb3Bi7(Se4S10) |
| Pb | ⓘ Perite | PbBiClO2 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ Galena var. Silver-bearing Galena | PbS with Ag |
| Pb | ⓘ Phosphohedyphane | Ca2Pb3(PO4)3Cl |
| Bi | Bismuth | |
| Bi | ⓘ Friedrichite | Cu5Pb5Bi7S18 |
| Bi | ⓘ Nordströmite | CuPb3Bi7(Se4S10) |
| Bi | ⓘ Perite | PbBiClO2 |
Localities in this Region
- Arizona
- Cochise County
- Yellowstone Mining District
- Cochise County
Other Regions, Features and Areas containing this locality
North AmericaContinent
- Sonoran DesertDesert
North America PlateTectonic Plate
- Basin and Range BasinsBasin
- Mazatzal DomainDomain
- Southern Basin and RangeWide Rift
USA
- Arizona
- Cochise County
- Yellowstone Mining DistrictMining District
- Cochise County
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Unnamed Pb-Cu-Ag-Au-Zn-W prospect, Tres Alamos Wash, Johnny Lyon Hills, Yellowstone Mining District, Cochise County, Arizona, USA