Chacewater, Cornwall, England, UKi
| Regional Level Types | |
|---|---|
| Chacewater | Civil Parish |
| Cornwall | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Chacewater | 1,226 (2017) |
Other Languages:
Cornish:
Chacewater, Kernow, Pow Sows, Ruwvaneth Unys
French:
Chacewater, Cornouailles, Angleterre, Royaume-Uni
German:
Chacewater, Cornwall, England, Vereinigtes Königreich
Italian:
Chacewater, Cornovaglia, Inghilterra, Regno Unito
Russian:
Чосвотер, Корнуолл, Англия, Великобритания
Spanish:
Chacewater, Cornualles, Inglaterra, Reino Unido
Arabic:
تشكوتر, كورنوال, إنجلترا, المملكة المتحدة
Basque:
Chacewater, Kornualles, Ingalaterra, Erresuma Batua
Bengali:
চাছেওয়াটার, কর্নওয়াল, ইংল্যান্ড, যুক্তরাজ্য
Cebuano:
Chacewater , Cornwall, Inglatera, Hiniusang Gingharian
Dutch:
Chacewater, Cornwall, Engeland, Verenigd Koninkrijk
Farsi/Persian:
چیسواتر, کورنوال, انگلستان, بریتانیا
Gujarati:
ચેસવોટર, કોર્નવોલ, ઈંગ્લેન્ડ, યુનાઇટેડ કિંગડમ
Japanese:
チャスウォーター, コーンウォール, イングランド, イギリス
Kannada:
ಚಕ್ವಾಟರ್, ಕಾರ್ನ್ವಾಲ್, ಇಂಗ್ಲೆಂಡ್, ಯುನೈಟೆಡ್ ಕಿಂಗ್ಡಂ
Korean:
체스워터, 콘월주, 잉글랜드, 영국
Lithuanian:
Čeisvoteris, Kornvalis, Anglija, Jungtinė Karalystė
Polish:
Chacewater, Kornwalia, Anglia, Wielka Brytania
Portuguese:
Chacewater, Cornualha, Inglaterra, Reino Unido
Swedish:
Chacewater, Cornwall, England, Storbritannien
Tamil:
சேஸ்வாட்டர், கோர்ன்வால், இங்கிலாந்து, ஐக்கிய இராச்சியம்
Telugu:
చాస్వాటర్, కార్న్వాల్, ఇంగ్లాండు, యునైటెడ్ కింగ్డమ్
Urdu:
چاکیواتیر, کورنوال, انگلستان, مملکت متحدہ
Welsh:
Chacewater, Cernyw, Lloegr, Y Deyrnas Unedig
Parish centred on the village of Chacewater.
Surrounded by Kenwyn CP, Gwennap CP, St Day CP, Redruth CP and St Agnes CP.
The village at the heart of Chacewater parish.
Surrounded by Kenwyn CP, Gwennap CP, St Day CP, Redruth CP and St Agnes CP.
The village at the heart of Chacewater parish.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities27 valid minerals.
Detailed Mineral List:
| ⓘ Anatase Formula: TiO2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A Description: Accessory mineral in country rock adjacent to the lodes. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 8 localities in this region. |
| ⓘ Bornite Formula: Cu5FeS4 Locality: Wheal Unity Wood (Tolgullow United Mine; West Poldice Mine), Chacewater, Cornwall, England, UK References: Griffiths, Dave (2023) Personal Communication (3).Identified by Dave Griffiths: Visual Identification |
| ⓘ Cassiterite Formula: SnO2 Localities: Reported from at least 15 localities in this region. |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Reported from at least 13 localities in this region. |
| ⓘ 'Chlorite Group' |
| ⓘ Cobaltite Formula: CoAsS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Galena Formula: PbS Localities: Reported from at least 8 localities in this region. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 References: |
| ⓘ 'Limonite' |
| ⓘ Marcasite Formula: FeS2 References: |
| ⓘ 'Mica Group' Locality: Wheal Unity Wood (Tolgullow United Mine; West Poldice Mine), Chacewater, Cornwall, England, UK References: Foster, Dale (n.d.) Personal communication.Identified by Dale Foster: Visual Identification |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Gold ? Formula: Au |
| ⓘ Native Sulphur ? Formula: S8 Description: Collins (1892) marks the occurrence as questionable. References: |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Quartz Formula: SiO2 Localities: Reported from at least 10 localities in this region. |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Locality: Wheal Unity Wood (Tolgullow United Mine; West Poldice Mine), Chacewater, Cornwall, England, UK References: |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Skutterudite Formula: CoAs3 |
| ⓘ Sphalerite Formula: ZnS Localities: Reported from at least 10 localities in this region. |
| ⓘ Tenorite Formula: CuO |
| ⓘ Titanite Formula: CaTiO(SiO4) Description: Accessory mineral in country rock adjacent to the lodes. |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ 'Wolframite Group' Localities: Hallenbeagle Mine, Chacewater, Cornwall, England, UK Great Wheal Busy (Chacewater Mine), Chacewater, Cornwall, England, UK Nangiles Mine (Wheal Nangiles), Chacewater, Cornwall, England, UK Wheal Unity Wood (Tolgullow United Mine; West Poldice Mine), Chacewater, Cornwall, England, UK Killifreth Mine, Chacewater, Cornwall, England, UK |
| ⓘ Zircon Formula: Zr(SiO4) Description: Accessory mineral in country rock adjacent to the lodes. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold ? | 1.AA.05 | Au |
| ⓘ | Native Sulphur ? | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Cobaltite | 2.EB.25 | CoAsS |
| ⓘ | Skutterudite | 2.EC.05 | CoAs3 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | 'Wolframite Group' | 4.DB.30 va | |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Titanite | 9.AG.15 | CaTiO(SiO4) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| Unclassified | |||
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Limonite' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Mica Group' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Titanite | CaTiO(SiO4) |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Apatite | Ca5(PO4)3A |
| F | Fluorine | |
| F | ⓘ Fluorite | CaF2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTiO(SiO4) |
| Si | ⓘ Zircon | Zr(SiO4) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cobaltite | CoAsS |
| S | ⓘ Galena | PbS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Titanite | CaTiO(SiO4) |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTiO(SiO4) |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| Fe | ⓘ Siderite | FeCO3 |
| Co | Cobalt | |
| Co | ⓘ Cobaltite | CoAsS |
| Co | ⓘ Skutterudite | CoAs3 |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Tenorite | CuO |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Cobaltite | CoAsS |
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
| As | ⓘ Skutterudite | CoAs3 |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://en.wikipedia.org/wiki/Chacewater |
|---|---|
| Wikidata ID: | Q2073348 |
| GeoNames ID: | 7293067 |
Localities in this Region
- England
- Cornwall
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornubian mining districtMining District
- Cornwall
- Camborne-Redruth and St Day Mining DistrictMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Wheal Unity Wood, Chacewater, Cornwall, England, UK