Chah Khouni Mine, Anarak District, Nain County, Isfahan Province, Irani
| Regional Level Types | |
|---|---|
| Chah Khouni Mine | Mine (Abandoned) |
| Anarak District | District |
| Nain County | County |
| Isfahan Province | Province |
| Iran | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
33° 26' 21'' North , 54° 11' 57'' East
Latitude & Longitude (decimal):
Type:
Mine (Abandoned) - last checked 2023
Köppen climate type:
Other/historical names associated with this locality:
Chah Khoni Mine; Tschah Khuni Mine; El Khun Mine
The Chah Khouni mine, about 50 kilometres east-northeast of Anarak is characterized by polymetallic gold mineralization. The mine was co-operated in late 1936-37 by the Persian Pahlavi dynasty and the German Reich and lasted till mid-September 1941 when German engineers and technicians were forced to leave Iran just before the Anglo-Soviet invasion. Mining resumed after World War II, following the re-establishment of diplomatic relations in October 1953. Operations finally ceased by the early 1960s due to low ore grade.
The host rock is a tectonized dolomitic marble of the Anarak metamorphites. The oxidized zone is represented by dolomitized breccia with remnants of minerals like chalcopyrite, galena, pyrite, sphalerite, and magnetite. The ore deposits are confined to two groups of fractures, those with a northwest strike that dip to the northeast and those with a northeast strike that dip towards the southeast. The mineralized patches of the fault zones have been worked out by prospectors. These minor workings are narrow cuts, oriented along the fractures with an extension up to five meters. In a few places, these workings have extended as a chain, up to forty meters. In the eastern part, in the schist unit, a grayish black dolomitic horizon of 2 kilometers long and 300 meters width occurs. It narrows gradually and eventually wedges out. Larger scale mining was done in the central part of the Chah-Khouni deposit through an adit with a shaft, several pits and numerous other mining excavations.
Note on the mineral list: Bariand and Poullen (1980) suggest that the type locality of iranite is probably not the Sebarz mine as given in Bariand and Herpin (1963), but the Chah Khouni mine.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
37 valid minerals.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Anglesite Formula: PbSO4 References: |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Aurichalcite ? Formula: (Zn,Cu)5(CO3)2(OH)6 References: |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Boleite Formula: KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cerussite Formula: PbCO3 References: |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 References: |
| ⓘ Cotunnite Formula: PbCl2 |
| ⓘ Covellite Formula: CuS |
| ⓘ Descloizite Formula: PbZn(VO4)(OH) References: |
| ⓘ Diaboleite Formula: Pb2CuCl2(OH)4 |
| ⓘ Fornacite Formula: Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ Galena Formula: PbS |
| ⓘ Hemihedrite Formula: Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ Hemimorphite Formula: Zn4Si2O7(OH)2 · H2O References: |
| ⓘ Herbertsmithite Formula: Cu3Zn(OH)6Cl2 References: |
| ⓘ Hetaerolite Formula: ZnMn2O4 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Iranite Formula: Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Murdochite Formula: Cu12Pb2O15Cl2 References: |
| ⓘ Native Gold Formula: Au |
| ⓘ Phoenicochroite Formula: Pb2(CrO4)O |
| ⓘ Phosgenite Formula: Pb2CO3Cl2 References: |
| ⓘ Plattnerite Formula: PbO2 |
| ⓘ Pseudoboleite Formula: Pb31Cu24Cl62(OH)48 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Rosasite Formula: (Cu,Zn)2(CO3)(OH)2 |
| ⓘ Smithsonite Formula: ZnCO3 |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tenorite Formula: CuO |
| ⓘ 'UM1970-15-O:Pb' Formula: Pb9O16 |
| ⓘ Vanadinite Formula: Pb5(VO4)3Cl References: |
| ⓘ Willemite Formula: Zn2SiO4 |
| ⓘ Wulfenite Formula: Pb(MoO4) References: |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 3 - Halides | |||
| ⓘ | Cotunnite | 3.AB.85 | PbCl2 |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Herbertsmithite | 3.DA.10c | Cu3Zn(OH)6Cl2 |
| ⓘ | Diaboleite | 3.DB.05 | Pb2CuCl2(OH)4 |
| ⓘ | Pseudoboleite | 3.DB.10 | Pb31Cu24Cl62(OH)48 |
| ⓘ | Boleite | 3.DB.15 | KPb26Ag9Cu24(OH)48Cl62 |
| ⓘ | Murdochite | 3.DB.45 | Cu12Pb2O15Cl2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Tenorite | 4.AB.10 | CuO |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hetaerolite | 4.BB.10 | ZnMn2O4 |
| ⓘ | Plattnerite | 4.DB.05 | PbO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Smithsonite | 5.AB.05 | ZnCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Rosasite | 5.BA.10 | (Cu,Zn)2(CO3)(OH)2 |
| ⓘ | Aurichalcite ? | 5.BA.15 | (Zn,Cu)5(CO3)2(OH)6 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Phosgenite | 5.BE.20 | Pb2CO3Cl2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Phoenicochroite | 7.FB.05 | Pb2(CrO4)O |
| ⓘ | Fornacite | 7.FC.10 | Pb2Cu(CrO4)(AsO4)(OH) |
| ⓘ | Hemihedrite | 7.FC.15 | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Iranite | 7.FC.15 | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Descloizite | 8.BH.40 | PbZn(VO4)(OH) |
| ⓘ | Vanadinite | 8.BN.05 | Pb5(VO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Willemite | 9.AA.05 | Zn2SiO4 |
| ⓘ | Hemimorphite | 9.BD.10 | Zn4Si2O7(OH)2 · H2O |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Unclassified | |||
| ⓘ | 'UM1970-15-O:Pb' | - | Pb9O16 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Atacamite | Cu2(OH)3Cl |
| H | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| H | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Descloizite | PbZn(VO4)(OH) |
| H | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| H | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| H | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| H | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| H | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| C | Carbon | |
| C | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Phosgenite | Pb2CO3Cl2 |
| C | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| C | ⓘ Smithsonite | ZnCO3 |
| O | Oxygen | |
| O | ⓘ Anglesite | PbSO4 |
| O | ⓘ Atacamite | Cu2(OH)3Cl |
| O | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| O | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Descloizite | PbZn(VO4)(OH) |
| O | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| O | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| O | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| O | ⓘ Hetaerolite | ZnMn2O4 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| O | ⓘ Phoenicochroite | Pb2(CrO4)O |
| O | ⓘ Phosgenite | Pb2CO3Cl2 |
| O | ⓘ Plattnerite | PbO2 |
| O | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| O | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| O | ⓘ Smithsonite | ZnCO3 |
| O | ⓘ Tenorite | CuO |
| O | ⓘ Vanadinite | Pb5(VO4)3Cl |
| O | ⓘ Willemite | Zn2SiO4 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| O | ⓘ UM1970-15-O:Pb | Pb9O16 |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | Silicon | |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Si | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Si | ⓘ Willemite | Zn2SiO4 |
| S | Sulfur | |
| S | ⓘ Anglesite | PbSO4 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Galena | PbS |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| Cl | Chlorine | |
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
| Cl | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cl | ⓘ Cotunnite | PbCl2 |
| Cl | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cl | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cl | ⓘ Phosgenite | Pb2CO3Cl2 |
| Cl | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cl | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cl | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| K | Potassium | |
| K | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| V | Vanadium | |
| V | ⓘ Descloizite | PbZn(VO4)(OH) |
| V | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Cr | Chromium | |
| Cr | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cr | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cr | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Mn | Manganese | |
| Mn | ⓘ Hetaerolite | ZnMn2O4 |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pyrite | FeS2 |
| Cu | Copper | |
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
| Cu | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
| Cu | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Cu | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Cu | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Cu | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Cu | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Cu | ⓘ Tenorite | CuO |
| Cu | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| Zn | Zinc | |
| Zn | ⓘ Aurichalcite | (Zn,Cu)5(CO3)2(OH)6 |
| Zn | ⓘ Descloizite | PbZn(VO4)(OH) |
| Zn | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Zn | ⓘ Hemimorphite | Zn4Si2O7(OH)2 · H2O |
| Zn | ⓘ Hetaerolite | ZnMn2O4 |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Rosasite | (Cu,Zn)2(CO3)(OH)2 |
| Zn | ⓘ Smithsonite | ZnCO3 |
| Zn | ⓘ Sphalerite | ZnS |
| Zn | ⓘ Willemite | Zn2SiO4 |
| Zn | ⓘ Herbertsmithite | Cu3Zn(OH)6Cl2 |
| As | Arsenic | |
| As | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Mo | Molybdenum | |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Anglesite | PbSO4 |
| Pb | ⓘ Boleite | KPb26Ag9Cu24(OH)48Cl62 |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Cotunnite | PbCl2 |
| Pb | ⓘ Descloizite | PbZn(VO4)(OH) |
| Pb | ⓘ Diaboleite | Pb2CuCl2(OH)4 |
| Pb | ⓘ Fornacite | Pb2Cu(CrO4)(AsO4)(OH) |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Hemihedrite | Pb10Zn(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Iranite | Pb10Cu(CrO4)6(SiO4)2(OH)2 |
| Pb | ⓘ Murdochite | Cu12Pb2O15Cl2 |
| Pb | ⓘ Phoenicochroite | Pb2(CrO4)O |
| Pb | ⓘ Phosgenite | Pb2CO3Cl2 |
| Pb | ⓘ Plattnerite | PbO2 |
| Pb | ⓘ Pseudoboleite | Pb31Cu24Cl62(OH)48 |
| Pb | ⓘ Vanadinite | Pb5(VO4)3Cl |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Pb | ⓘ UM1970-15-O:Pb | Pb9O16 |
Other Regions, Features and Areas containing this locality
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Bariand, Pierre (1963) Contribution à la minéralogie de l'Iran. Bulletin de Minéralogie, 86 (1) 17-64 doi:10.3406/bulmi.1963.5609
Bariand, Pierre, Herpin, Paulette (1963) Une nouvelle espèce minérale : l'iranite, chromate hydraté de plomb. Bulletin de Minéralogie, 86 (2) 133-135 doi:10.3406/bulmi.1963.5633
Adib, D., Ottemann, J. (1970) Some new lead oxide minerals and murdochite from T. Khuni Mine, Anarak, Iran. Mineralium Deposita, 5 (1) 86-93 doi:10.1007/bf00207007
Bariand, Pierre, Poullen, J. F. (1980) Rare Chromates from Seh-Changi, Iran. The Mineralogical Record, 11 (5) Tucson. 293-297
Braithwaite, R. S. W., Mereiter, K., Paar, W. H., Clark, A. M. (2004) Herbertsmithite, Cu3Zn(OH)6Cl2, a new species, and the definition of paratacamite. Mineralogical Magazine, 68 (3) 527-539 doi:10.1180/0026461046830204
Yang, Hexiong, Sano, Jennifer L., Eichler, Carla, Downs, Robert T., Costin, Gelu (2007) Iranite, CuPb10(CrO4)6(SiO4)2(OH)2, isomorphous with hemihedrite. Acta Crystallographica Section C Crystal Structure Communications, 63 (12) 122-124 doi:10.1107/s0108270107053449
Chah Khouni Mine, Anarak District, Nain County, Isfahan Province, Iran