Vico Quarries, Vico Canavese, Valchiusa, Metropolitan City of Turin, Piedmont, Italyi
| Regional Level Types | |
|---|---|
| Vico Quarries | Group of Quarries |
| Vico Canavese | Commune (Former) |
| Valchiusa | Commune |
| Metropolitan City of Turin | Metropolitan City |
| Piedmont | Region |
| Italy | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 29' 47'' North , 7° 47' 20'' East
Latitude & Longitude (decimal):
Type:
Group of Quarries
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Vico Canavese | 430 (2014) | 0.9km |
| Brosso | 410 (2014) | 1.2km |
| Drusacco | 200 (2014) | 1.7km |
| Calea | 411 (2014) | 2.6km |
| Lessolo | 1,443 (2014) | 3.0km |
Name(s) in local language(s):
Cave di Vico, Vico Canavese, Val Chiusella, Canavese, Torino, Piemonte, Italia
Diorite quarries.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Andradite Formula: Ca3Fe3+2(SiO4)3 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ 'Chabazite' |
| ⓘ Clinochlore Formula: Mg5Al(AlSi3O10)(OH)8 |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Edenite Formula: NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ Forsterite Formula: Mg2SiO4 |
| ⓘ Hedenbergite Formula: CaFe2+Si2O6 |
| ⓘ Orthoclase Formula: K(AlSi3O8) |
| ⓘ Prehnite Formula: Ca2Al2Si3O10(OH)2 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 Colour: smoky |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 References: |
| ⓘ 'Scapolite' |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: Franco Luca Bonino's collectionIdentified by Franco Luca Bonino: Visual Identification |
| ⓘ Spinel Formula: MgAl2O4 |
| ⓘ Titanite Formula: CaTi(SiO4)O Colour: orange |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Spinel | 4.BB.05 | MgAl2O4 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Forsterite | 9.AC.05 | Mg2SiO4 |
| ⓘ | Andradite | 9.AD.25 | Ca3Fe3+2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Hedenbergite | 9.DA.15 | CaFe2+Si2O6 |
| ⓘ | Edenite | 9.DE.15 | NaCa2Mg5(Si7Al)O22(OH)2 |
| ⓘ | Prehnite | 9.DP.20 | Ca2Al2Si3O10(OH)2 |
| ⓘ | Clinochlore | 9.EC.55 | Mg5Al(AlSi3O10)(OH)8 |
| ⓘ | Orthoclase | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Chabazite' | - | |
| ⓘ | 'Scapolite' | - | |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| H | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Forsterite | Mg2SiO4 |
| O | ⓘ Hedenbergite | CaFe2+Si2O6 |
| O | ⓘ Orthoclase | K(AlSi3O8) |
| O | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spinel | MgAl2O4 |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| F | Fluorine | |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Mg | ⓘ Forsterite | Mg2SiO4 |
| Mg | ⓘ Spinel | MgAl2O4 |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Al | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Orthoclase | K(AlSi3O8) |
| Al | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spinel | MgAl2O4 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Si | ⓘ Clinochlore | Mg5Al(AlSi3O10)(OH)8 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Forsterite | Mg2SiO4 |
| Si | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Si | ⓘ Orthoclase | K(AlSi3O8) |
| Si | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Pyrite | FeS2 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Orthoclase | K(AlSi3O8) |
| Ca | Calcium | |
| Ca | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Edenite | NaCa2Mg5(Si7Al)O22(OH)2 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Ca | ⓘ Prehnite | Ca2Al2Si3O10(OH)2 |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Andradite | Ca3Fe23+(SiO4)3 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Hedenbergite | CaFe2+Si2O6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- AlpsAccretionary Complex
EuropeContinent
- The AlpsMountain Range
Italy
- Piedmont
- Metropolitan City of Turin
- ⭔CanaveseDistrict
- Chiusella ValleyValley
- Metropolitan City of Turin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Vico Quarries, Vico Canavese, Valchiusa, Metropolitan City of Turin, Piedmont, Italy