Lodi No. 4 Mine (Lodi No. 4 claim), Adams Peak, Last Chance Mining District, Plumas County, California, USAi
| Regional Level Types | |
|---|---|
| Lodi No. 4 Mine (Lodi No. 4 claim) | Mine |
| Adams Peak | Peak |
| Last Chance Mining District | Mining District |
| Plumas County | County |
| California | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
39° 54' 26'' North , 120° 7' 13'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Chilcoot-Vinton | 454 (2011) | 11.3km |
| Doyle | 678 (2011) | 13.5km |
| Beckwourth | 432 (2017) | 24.1km |
| Patton Village | 702 (2011) | 26.1km |
| Herlong | 298 (2011) | 26.3km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Comstock Gold Prospectors | Reno, Nevada | 49km |
| Reno Gem and Mineral Society | Reno, Nevada | 49km |
A Ag-Cu-Mo-Bi-W-Sb mine located in sec. 19, T24N, R17E (MDM), 2.9 km (1.8 miles) WNW of Adams Peak (coordinates of record), SE of Galeppick Creek, on the W slope of the Diamond Mountains, E of Frenchman Lake and the Little Last Chance Valley, SE of Last Chance Spring, on National Forest land.
NOTES:
- This locality is not listed in the USGS MRDS database.
- Part of the Lodi 4 mine is located on a parcel of private land within the national forest.
Mineralization is quartz dikes in granite related to either hydrothermal phase of magmatic sequence or pneumatolytic origin.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Acanthite Formula: Ag2S |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Bismutoferrite Formula: Fe3+2Bi(SiO4)2(OH) |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Chalcanthite Formula: CuSO4 · 5H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Chrysocolla Formula: Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ Cinnabar Formula: HgS |
| ⓘ Clinobisvanite Formula: Bi(VO4) |
| ⓘ Covellite Formula: CuS |
| ⓘ Cuprite Formula: Cu2O |
| ⓘ Digenite Formula: Cu9S5 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Hessite Formula: Ag2Te |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Koechlinite Formula: Bi2MoO6 |
| ⓘ Lindgrenite Formula: Cu3(MoO4)2(OH)2 Description: Occurs as masses and small crystals in quartz. |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Metatorbernite Formula: Cu(UO2)2(PO4)2 · 8H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Molybdite Formula: MoO3 |
| ⓘ Namibite Formula: Cu(BiO)2(VO4)(OH) References: Frost, Ray L., Henry, Dermot A., Weier, Matt L., Martens, Wayde (2006) Raman spectroscopy of three polymorphs of BiVO4: clinobisvanite, dreyerite and pucherite, with comparisons to (VO4)3-bearing minerals: namibite, pottsite and schumacherite. Journal of Raman Spectroscopy, 37 (7). 722-732 doi:10.1002/jrs.1499 |
| ⓘ Native Copper Formula: Cu |
| ⓘ Native Gold Formula: Au |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ Posnjakite Formula: Cu4(SO4)(OH)6 · H2O |
| ⓘ Powellite Formula: Ca(MoO4) |
| ⓘ Pseudomalachite Formula: Cu5(PO4)2(OH)4 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ 'Roméite Group' Formula: A2(Sb5+)2O6Z |
| ⓘ 'Roméite Group var. Bismutostibiconite' Formula: Bi(Sb5+,Fe3+)2O7 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schumacherite Formula: Bi3(VO4)2O(OH) |
| ⓘ Stibiconite Formula: Sb3+Sb5+2O6(OH) |
| ⓘ Stromeyerite Formula: AgCuS |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Tungstite Formula: WO3 · H2O Description: Occurs as a yellow powder coating Scheelite. |
| ⓘ Witherite Formula: BaCO3 |
| ⓘ Wittichenite Formula: Cu3BiS3 |
| ⓘ Wulfenite Formula: Pb(MoO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Copper | 1.AA.05 | Cu |
| ⓘ | Native Gold | 1.AA.05 | Au |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Digenite | 2.BA.10 | Cu9S5 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Acanthite | 2.BA.35 | Ag2S |
| ⓘ | Stromeyerite | 2.BA.40 | AgCuS |
| ⓘ | Hessite | 2.BA.60 | Ag2Te |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Cinnabar | 2.CD.15a | HgS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Wittichenite | 2.GA.20 | Cu3BiS3 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Cuprite | 4.AA.10 | Cu2O |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Koechlinite | 4.DE.15 | Bi2MoO6 |
| ⓘ | 'Roméite Group var. Bismutostibiconite' | 4.DH. | Bi(Sb5+,Fe3+)2O7 |
| ⓘ | '' | 4.DH. | A2(Sb5+)2O6Z |
| ⓘ | Stibiconite | 4.DH.20 | Sb3+Sb5+2O6(OH) |
| ⓘ | Molybdite | 4.E0.10 | MoO3 |
| ⓘ | Tungstite | 4.FJ.10 | WO3 · H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Witherite | 5.AB.15 | BaCO3 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Chalcanthite | 7.CB.20 | CuSO4 · 5H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Posnjakite | 7.DD.10 | Cu4(SO4)(OH)6 · H2O |
| ⓘ | Powellite | 7.GA.05 | Ca(MoO4) |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Lindgrenite | 7.GB.05 | Cu3(MoO4)2(OH)2 |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Clinobisvanite | 8.AD.65 | Bi(VO4) |
| ⓘ | Namibite | 8.BB.50 | Cu(BiO)2(VO4)(OH) |
| ⓘ | Pseudomalachite | 8.BD.05 | Cu5(PO4)2(OH)4 |
| ⓘ | Schumacherite | 8.BO.10 | Bi3(VO4)2O(OH) |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Metatorbernite | 8.EB.10 | Cu(UO2)2(PO4)2 · 8H2O |
| Group 9 - Silicates | |||
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Chrysocolla | 9.ED.20 | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| ⓘ | Bismutoferrite | 9.ED.25 | Fe3+2Bi(SiO4)2(OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| H | ⓘ Chalcanthite | CuSO4 · 5H2O |
| H | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
| H | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| H | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| H | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| H | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| H | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| H | ⓘ Tungstite | WO3 · H2O |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
| C | ⓘ Witherite | BaCO3 |
| O | Oxygen | |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Roméite Group var. Bismutostibiconite | Bi(Sb5+,Fe3+)2O7 |
| O | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| O | ⓘ Chalcanthite | CuSO4 · 5H2O |
| O | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| O | ⓘ Clinobisvanite | Bi(VO4) |
| O | ⓘ Cuprite | Cu2O |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Koechlinite | Bi2MoO6 |
| O | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
| O | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| O | ⓘ Molybdite | MoO3 |
| O | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| O | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| O | ⓘ Powellite | Ca(MoO4) |
| O | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| O | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| O | ⓘ Tungstite | WO3 · H2O |
| O | ⓘ Witherite | BaCO3 |
| O | ⓘ Wulfenite | Pb(MoO4) |
| Na | Sodium | |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Si | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| P | Phosphorus | |
| P | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| P | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| S | Sulfur | |
| S | ⓘ Acanthite | Ag2S |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bornite | Cu5FeS4 |
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Chalcanthite | CuSO4 · 5H2O |
| S | ⓘ Chalcocite | Cu2S |
| S | ⓘ Cinnabar | HgS |
| S | ⓘ Covellite | CuS |
| S | ⓘ Digenite | Cu9S5 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Idaite | Cu5FeS6 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| S | ⓘ Stromeyerite | AgCuS |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| S | ⓘ Wittichenite | Cu3BiS3 |
| K | Potassium | |
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Ca | Calcium | |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Powellite | Ca(MoO4) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| V | Vanadium | |
| V | ⓘ Clinobisvanite | Bi(VO4) |
| V | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| V | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| Fe | Iron | |
| Fe | ⓘ Roméite Group var. Bismutostibiconite | Bi(Sb5+,Fe3+)2O7 |
| Fe | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Fe | ⓘ Bornite | Cu5FeS4 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Idaite | Cu5FeS6 |
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Cu | Copper | |
| Cu | ⓘ Bornite | Cu5FeS4 |
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Chalcanthite | CuSO4 · 5H2O |
| Cu | ⓘ Chalcocite | Cu2S |
| Cu | ⓘ Chrysocolla | Cu2-xAlx(H2-xSi2O5)(OH)4 · nH2O, x < 1 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cuprite | Cu2O |
| Cu | ⓘ Native Copper | Cu |
| Cu | ⓘ Digenite | Cu9S5 |
| Cu | ⓘ Idaite | Cu5FeS6 |
| Cu | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
| Cu | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
| Cu | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Cu | ⓘ Posnjakite | Cu4(SO4)(OH)6 · H2O |
| Cu | ⓘ Pseudomalachite | Cu5(PO4)2(OH)4 |
| Cu | ⓘ Stromeyerite | AgCuS |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Cu | ⓘ Wittichenite | Cu3BiS3 |
| As | Arsenic | |
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Koechlinite | Bi2MoO6 |
| Mo | ⓘ Lindgrenite | Cu3(MoO4)2(OH)2 |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Molybdite | MoO3 |
| Mo | ⓘ Powellite | Ca(MoO4) |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ag | Silver | |
| Ag | ⓘ Acanthite | Ag2S |
| Ag | ⓘ Hessite | Ag2Te |
| Ag | ⓘ Stromeyerite | AgCuS |
| Sb | Antimony | |
| Sb | ⓘ Roméite Group var. Bismutostibiconite | Bi(Sb5+,Fe3+)2O7 |
| Sb | ⓘ Roméite Group | A2(Sb5+)2O6Z |
| Sb | ⓘ Stibiconite | Sb3+Sb25+O6(OH) |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Te | Tellurium | |
| Te | ⓘ Hessite | Ag2Te |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ba | ⓘ Witherite | BaCO3 |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Tungstite | WO3 · H2O |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Hg | Mercury | |
| Hg | ⓘ Cinnabar | HgS |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Roméite Group var. Bismutostibiconite | Bi(Sb5+,Fe3+)2O7 |
| Bi | ⓘ Bismutoferrite | Fe23+Bi(SiO4)2(OH) |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Clinobisvanite | Bi(VO4) |
| Bi | ⓘ Koechlinite | Bi2MoO6 |
| Bi | ⓘ Namibite | Cu(BiO)2(VO4)(OH) |
| Bi | ⓘ Schumacherite | Bi3(VO4)2O(OH) |
| Bi | ⓘ Wittichenite | Cu3BiS3 |
| U | Uranium | |
| U | ⓘ Metatorbernite | Cu(UO2)2(PO4)2 · 8H2O |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Northern Basin and RangeWide Rift
- Shoofly-Olds Ferry DomainDomain
USA
- California
- Diamond MountainsMountain Range
- Sierra NevadaMountain Range
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Dunning, G. E., Cooper, J. F. (2005) Mineralogy of the Spring Creek area, Last Chance mining district, Plumas County, California. Axis, 1 (1). 1-30
Frost, Ray L., Henry, Dermot A., Weier, Matt L., Martens, Wayde (2006) Raman spectroscopy of three polymorphs of BiVO4: clinobisvanite, dreyerite and pucherite, with comparisons to (VO4)3-bearing minerals: namibite, pottsite and schumacherite. Journal of Raman Spectroscopy, 37 (7). 722-732 doi:10.1002/jrs.1499





Lodi No. 4 Mine, Adams Peak, Last Chance Mining District, Plumas County, California, USA