Ilsington, Teignbridge, Devon, England, UKi
| Regional Level Types | |
|---|---|
| Ilsington | Civil Parish |
| Teignbridge | District |
| Devon | County |
| England | Constituent Country |
| UK | Country |
This page is currently not sponsored. Click here to sponsor this page.
Type:
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities25 valid minerals. 1 erroneous literature entry.
Detailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3A |
| ⓘ Aragonite Formula: CaCO3 References: |
| ⓘ Axinite-(Fe) Formula: Ca2Fe2+Al2BSi4O15OH |
| ⓘ Calcite Formula: CaCO3 |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cerussite Formula: PbCO3 Colour: pale brown / grey Description: microcrystals in a small cavity. References: |
| ⓘ Datolite Formula: CaB(SiO4)(OH) |
| ⓘ Dolomite Formula: CaMg(CO3)2 References: |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Gypsum Formula: CaSO4 · 2H2O References: |
| ⓘ Hastingsite Formula: NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 References: |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 References: |
| ⓘ Formula: CaFe3+Fe2+2(Si2O7)O(OH) Locality: Smallacombe Cutting, Ilsington, Teignbridge, Devon, England, UK - erroneously reported Description: A.W.G. Kingsbury specimen |
| ⓘ Johannsenite Formula: CaMn2+Si2O6 References: |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Native Bismuth Formula: Bi References: |
| ⓘ Native Sulphur Formula: S8 References: |
| ⓘ Nontronite Formula: Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O Description: as "gramenite". |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Quartz var. Haytorite Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) References: |
| ⓘ Siderite Formula: FeCO3 Description: Light yellow to brown cleavages to many cms small cavity's are lined with elongated triangular cross section micro-crystals. |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Tremolite Formula: ◻Ca2Mg5(Si8O22)(OH)2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Haytorite | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| ⓘ | Aragonite | 5.AB.15 | CaCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| Group 9 - Silicates | |||
| ⓘ | Datolite | 9.AJ.20 | CaB(SiO4)(OH) |
| ⓘ | Axinite-(Fe) | 9.BD.20 | Ca2Fe2+Al2BSi4O15OH |
| ⓘ | Ilvaite ? | 9.BE.07 | CaFe3+Fe2+2(Si2O7)O(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Johannsenite | 9.DA.15 | CaMn2+Si2O6 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Tremolite | 9.DE.10 | ◻Ca2Mg5(Si8O22)(OH)2 |
| ⓘ | Hastingsite | 9.DE.15 | NaCa2(Fe2+4Fe3+)(Si6Al2)O22(OH)2 |
| ⓘ | Nontronite | 9.EC.40 | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Unclassified | |||
| ⓘ | 'Apatite' | - | Ca5(PO4)3A |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Datolite | CaB(SiO4)(OH) |
| H | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Gypsum | CaSO4 · 2H2O |
| H | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| H | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| H | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| B | Boron | |
| B | ⓘ Datolite | CaB(SiO4)(OH) |
| B | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Aragonite | CaCO3 |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Cerussite | PbCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Aragonite | CaCO3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Cerussite | PbCO3 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Datolite | CaB(SiO4)(OH) |
| O | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Gypsum | CaSO4 · 2H2O |
| O | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| O | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| O | ⓘ Johannsenite | CaMn2+Si2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| O | ⓘ Quartz var. Haytorite | SiO2 |
| O | ⓘ Apatite | Ca5(PO4)3A |
| Na | Sodium | |
| Na | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Na | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Al | Aluminium | |
| Al | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Al | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Al | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Datolite | CaB(SiO4)(OH) |
| Si | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Si | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Si | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Si | ⓘ Johannsenite | CaMn2+Si2O6 |
| Si | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Si | ⓘ Quartz var. Haytorite | SiO2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3A |
| S | Sulfur | |
| S | ⓘ Galena | PbS |
| S | ⓘ Gypsum | CaSO4 · 2H2O |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Aragonite | CaCO3 |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Datolite | CaB(SiO4)(OH) |
| Ca | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
| Ca | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Ca | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Ca | ⓘ Johannsenite | CaMn2+Si2O6 |
| Ca | ⓘ Tremolite | ◻Ca2Mg5(Si8O22)(OH)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3A |
| Mn | Manganese | |
| Mn | ⓘ Johannsenite | CaMn2+Si2O6 |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Axinite-(Fe) | Ca2Fe2+Al2BSi4O15OH |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hastingsite | NaCa2(Fe42+Fe3+)(Si6Al2)O22(OH)2 |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Ilvaite | CaFe3+Fe22+(Si2O7)O(OH) |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Nontronite | Na0.3Fe2((Si,Al)4O10)(OH)2 · nH2O |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Zn | Zinc | |
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
| Zn | ⓘ Sphalerite | ZnS |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Pb | Lead | |
| Pb | ⓘ Cerussite | PbCO3 |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Localities in this Region
- England
- Devon
- Teignbridge
- Devon
- England
- Devon
- Teignbridge
- Devon
Other Regions, Features and Areas that Intersect
British and Irish IslesGroup of Islands
Eurasian PlateTectonic Plate
- Rheno-Hercynian BeltOrogenic Belt
EuropeContinent
UK
- England
- Cornubian mining districtMining District
- Devon
- Dartmoor National ParkNational Park
- Dartmouth and Teign Valley Mining DistrictMining District
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Silverbrook Mine, Ilsington, Teignbridge, Devon, England, UK