Svartliden Gold Mine (Svartliden), Lycksele, Västerbotten County, Swedeni
| Regional Level Types | |
|---|---|
| Svartliden Gold Mine (Svartliden) | Mine (Inactive) |
| Lycksele | Municipality |
| Västerbotten County | County |
| Sweden | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
64° 46' 38'' North , 17° 39' 57'' East
Latitude & Longitude (decimal):
Type:
Mine (Inactive) - last checked 2024
Köppen climate type:
Other/historical names associated with this locality:
Svartliden prospect
Other Languages:
Swedish:
Svartlidengruvan, Lycksele kommun, Västerbottens län, Sverige
Epigenetic deposit of massive sulphides with well-defined silica development in greenstone-hosted shear zones.
The Svartliden Gold Mine was brought into production in March 2005 and has produced 230,363 ounces of gold in total as at 30 June 2010. Mining was completed in late 2013.
Mining at Svartliden commenced as an open pit operation in 2004, with underground operations starting in 2011. Open-pit and underground mining were carried out in tandem until the completion of open-pit mining in April 2013. Underground mining was completed by the end of 2013.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Actinolite Formula: ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Anorthite Formula: Ca(Al2Si2O8) |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Description: Found as a microscopic phase |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O |
| ⓘ Arsenopyrite Formula: FeAsS References: |
| ⓘ Calcite Formula: CaCO3 Description: Found as crystals |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ 'Chlorite Group' Description: Found as a microscopic phase |
| ⓘ Diopside Formula: CaMgSi2O6 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) Description: Found as a microscopic phase |
| ⓘ Fayalite Formula: Fe2+2(SiO4) |
| ⓘ Galena Formula: PbS |
| ⓘ Gersdorffite Formula: NiAsS Description: Found as a microscopic phase |
| ⓘ Glaucodot Formula: (Co0.50Fe0.50)AsS Description: Found as a microscopic phase |
| ⓘ Graphite Formula: C |
| ⓘ Grunerite Formula: ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ Hercynite Formula: Fe2+Al2O4 Description: Found as a microscopic phase |
| ⓘ 'Hornblende Root Name Group' Formula: ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ Ilmenite Formula: Fe2+TiO3 Description: Found as a microscopic phase |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Native Gold Formula: Au References: |
| ⓘ Nickeline Formula: NiAs Description: Found as a microscopic phase |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 Description: Found as a microscopic phase |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS Description: Crystals up to 2 cm large. |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Scheelite Formula: Ca(WO4) Description: Crystals up to 5 mm |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Titanite Formula: CaTi(SiO4)O Description: Found as a microscopic phase |
| ⓘ Vesuvianite Formula: Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Graphite | 1.CB.05a | C |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Nickeline | 2.CC.05 | NiAs |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Glaucodot | 2.EB.10c | (Co0.50Fe0.50)AsS |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Gersdorffite | 2.EB.25 | NiAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Hercynite | 4.BB.05 | Fe2+Al2O4 |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 9 - Silicates | |||
| ⓘ | Fayalite | 9.AC.05 | Fe2+2(SiO4) |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Vesuvianite | 9.BG.35 | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Diopside | 9.DA.15 | CaMgSi2O6 |
| ⓘ | Grunerite | 9.DE.05 | ◻{Fe2+2}{Fe2+5}(Si8O22)(OH)2 |
| ⓘ | Actinolite | 9.DE.10 | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Anorthite | 9.FA.35 | Ca(Al2Si2O8) |
| Unclassified | |||
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Hornblende Root Name Group' | - | ◻Ca2(Z2+4Z3+)(AlSi7O22)(OH,F,Cl)2 |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| H | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| H | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Graphite | C |
| O | Oxygen | |
| O | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| O | ⓘ Anorthite | Ca(Al2Si2O8) |
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Diopside | CaMgSi2O6 |
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| O | ⓘ Fayalite | Fe22+(SiO4) |
| O | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| O | ⓘ Hercynite | Fe2+Al2O4 |
| O | ⓘ Ilmenite | Fe2+TiO3 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Titanite | CaTi(SiO4)O |
| O | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| O | ⓘ Wollastonite | Ca3(Si3O9) |
| O | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Mg | ⓘ Diopside | CaMgSi2O6 |
| Mg | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | Aluminium | |
| Al | ⓘ Anorthite | Ca(Al2Si2O8) |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Al | ⓘ Hercynite | Fe2+Al2O4 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Al | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Si | Silicon | |
| Si | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Si | ⓘ Anorthite | Ca(Al2Si2O8) |
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Diopside | CaMgSi2O6 |
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Si | ⓘ Fayalite | Fe22+(SiO4) |
| Si | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Titanite | CaTi(SiO4)O |
| Si | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
| Si | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| P | Phosphorus | |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Gersdorffite | NiAsS |
| S | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| Cl | Chlorine | |
| Cl | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ca | Calcium | |
| Ca | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Ca | ⓘ Anorthite | Ca(Al2Si2O8) |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Diopside | CaMgSi2O6 |
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Titanite | CaTi(SiO4)O |
| Ca | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
| Ca | ⓘ Hornblende Root Name Group | ◻Ca2(Z42+Z3+)(AlSi7O22)(OH,F,Cl)2 |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
| Ti | ⓘ Titanite | CaTi(SiO4)O |
| Fe | Iron | |
| Fe | ⓘ Actinolite | ◻Ca2(Mg4.5-2.5Fe0.5-2.5)Si8O22(OH)2 |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| Fe | ⓘ Fayalite | Fe22+(SiO4) |
| Fe | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Fe | ⓘ Grunerite | ◻{Fe22+}{Fe52+}(Si8O22)(OH)2 |
| Fe | ⓘ Hercynite | Fe2+Al2O4 |
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Vesuvianite | Ca19Fe3+Al4(Al6Mg2)(◻4)◻[Si2O7]4[(SiO4)10]O(OH)9 |
| Co | Cobalt | |
| Co | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| Ni | Nickel | |
| Ni | ⓘ Gersdorffite | NiAsS |
| Ni | ⓘ Nickeline | NiAs |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Gersdorffite | NiAsS |
| As | ⓘ Glaucodot | (Co0.50Fe0.50)AsS |
| As | ⓘ Löllingite | FeAs2 |
| As | ⓘ Nickeline | NiAs |
| W | Tungsten | |
| W | ⓘ Scheelite | Ca(WO4) |
| Au | Gold | |
| Au | ⓘ Native Gold | Au |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Baltic Shield
- Central Finland Arc ComplexVolcanic Arc
EuropeContinent
ScandinaviaRegion
Sweden
- ⭔Lappland ProvinceProvince
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.

Svartliden Gold Mine, Lycksele, Västerbotten County, Sweden