Tsilaizina pegmatite, Sahanivotry Manandona, Antsirabe II District, Vakinankaratra, Madagascari
| Regional Level Types | |
|---|---|
| Tsilaizina pegmatite | Pegmatite |
| Sahanivotry Manandona | Commune |
| Antsirabe II District | Rural District |
| Vakinankaratra | Region |
| Madagascar | Country |
Tsilaizina pegmatite, Sahatany Pegmatite Field (Mt Ibity area), Madagascar
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
20° 10' 22'' South , 47° 0' 43'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Antsirabe | 186,253 (2018) | 34.2km |
| Soanindrariny | 21,000 (2018) | 38.1km |
| Fandriana | 31,437 (2018) | 39.3km |
| Betafo | 29,785 (2018) | 41.4km |
| Ambositra | 30,353 (2018) | 46.5km |
Other/historical names associated with this locality:
Tsilaisina pegmatite
Other Languages:
Malagasy:
Pegmatitan'i Tsilaizina, Kaominin'i Sahanivotry Manandona, Distrikan' Antsirabe II, Vakinankaratra, Madagasikara
A complex type LCT pegmatite, known for large tabular crystals of pink beryl, a yellow Mn-rich variety of tourmaline called "tsilaisite". It is situated south of the quartzite Ibity Massif (Mt. Ibity), on the northern side of Mt. Tsilaizina, in the Sahatany Pegmatite Field south of the town Antsirabe in the main highland of Madagascar. The pegmatite is hosted by Proterozoic metapelites.
Rakotoarison (1964) nr. 58 (Map-coordinates: X= 659.125 Y= 459.950).
Note:
Minerals originating from Antandrokomby (especially londonite-rhodizite and small crystals of pigeonblood-red elbaite-schorl etc) have been sold at markets in Sahanivotry and Antsirabe (especially in the 1990s) as coming (erronously) from Tsiliazina.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded at this locality.Mineral List
25 valid minerals. 1 erroneous literature entry.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Anatase Formula: TiO2 |
| ⓘ 'Apatite' Formula: Ca5(PO4)3(Cl/F/OH) Habit: "cristaux hexagonaux basés " (A.Lacroix (1922) Colour: white |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Beryl Formula: Be3Al2(Si6O18) |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ Bismite Formula: Bi2O3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Columbite-(Mn) Formula: Mn2+Nb2O6 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Elbaite Formula: Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) Description: Yellow tourmaline has been found to be elbaite with a tendency toward Ca-enrichment. Most are OH-dominant, with fluorine ranging from 0.275 to 0.551 apfu F (Fig. 8). They are low-Fe, very high-Mn elbaite (Simmons et al 2011) References: Simmons, William B., Falster, Alexander U., Laurs, Brendan M. (2011) A survey of Mn-rich yellow tourmaline from worldwide localities and implications for the petrogenesis of granitic pegmatites, in Tourmaline: An ideal indicator of its host environment. The Canadian Mineralogist, 49 (1) 301-319 doi:10.3749/canmin.49.1.301 |
| ⓘ Euxenite-(Y) ? Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ 'Lepidolite' |
| ⓘ Liddicoatite Formula: Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) Colour: green Description: Determined from a green zone inside a pink elbaite (Ranorosoa 1986) |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi Habit: massive chunks |
| ⓘ 'Psilomelane' |
| ⓘ Pucherite Formula: Bi(VO4) |
| ⓘ 'Pyrochlore Supergroup' Formula: A2-mD2X6-wZ1-n References: |
| ⓘ Quartz Formula: SiO2 Habit: massive Colour: greyish |
| ⓘ Quartz var. Amethyst Formula: SiO2 |
| ⓘ Quartz var. Smoky Quartz Formula: SiO2 |
| ⓘ Formula: (K,Cs)Al4Be4(B,Be)12O28 Description: Erronousløy reported by Lefevre & Laurent (1998). At the time of their investigation at lot of material from Antandrokomby were offered ast the markets in Madagascar ass coming from Tsilaizina. However, the correct locality is Antandrokomby (Knut Edvard Larsen data 1997) |
| ⓘ Rutile Formula: TiO2 |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 References: |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ 'Tourmaline' Formula: AD3G6(T6O18)(BO3)3X3Z |
| ⓘ Xenotime-(Y) Formula: Y(PO4) |
| ⓘ Zircon Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Bismite | 4.CB.60 | Bi2O3 |
| ⓘ | Quartz var. Amethyst | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Rutile var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | 4.DB.05 | TiO2 | |
| ⓘ | Columbite-(Mn) | 4.DB.35 | Mn2+Nb2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Euxenite-(Y) ? | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 6 - Borates | |||
| ⓘ | Rhodizite ? | 6.GC.05 | (K,Cs)Al4Be4(B,Be)12O28 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Pucherite | 8.AD.40 | Bi(VO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| Group 9 - Silicates | |||
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Beryl | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Liddicoatite | 9.CK.05 | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| Unclassified | |||
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Lepidolite' | - | |
| ⓘ | 'Psilomelane' | - | |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Pyrochlore Supergroup' | - | A2-mD2X6-wZ1-n |
| ⓘ | 'Apatite' | - | Ca5(PO4)3(Cl/F/OH) |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| B | Boron | |
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Quartz var. Amethyst | SiO2 |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| O | ⓘ Bismite | Bi2O3 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hematite | Fe2O3 |
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| O | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pucherite | Bi(VO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| O | ⓘ Rutile | TiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Xenotime-(Y) | Y(PO4) |
| O | ⓘ Zircon | Zr(SiO4) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| F | Fluorine | |
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| F | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Mg | Magnesium | |
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Quartz var. Amethyst | SiO2 |
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Si | ⓘ Zircon | Zr(SiO4) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| P | Phosphorus | |
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
| P | ⓘ Xenotime-(Y) | Y(PO4) |
| P | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| Cl | Chlorine | |
| Cl | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| K | Potassium | |
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| K | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| Ca | Calcium | |
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ca | ⓘ Liddicoatite | Ca(Li2Al)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Ca | ⓘ Apatite | Ca5(PO4)3(Cl/F/OH) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Ti | ⓘ Rutile | TiO2 |
| V | Vanadium | |
| V | ⓘ Pucherite | Bi(VO4) |
| Mn | Manganese | |
| Mn | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
| Fe | Iron | |
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Hematite | Fe2O3 |
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Y | Yttrium | |
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
| Zr | Zirconium | |
| Zr | ⓘ Zircon | Zr(SiO4) |
| Nb | Niobium | |
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
| Nb | ⓘ Columbite-(Mn) | Mn2+Nb2O6 |
| Cs | Caesium | |
| Cs | ⓘ Rhodizite | (K,Cs)Al4Be4(B,Be)12O28 |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ce | Cerium | |
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
| Ta | Tantalum | |
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| Bi | Bismuth | |
| Bi | ⓘ Bismite | Bi2O3 |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Pucherite | Bi(VO4) |
| Th | Thorium | |
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| U | Uranium | |
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
Other Regions, Features and Areas containing this locality
AfricaContinent
African Plate
- Antenanarivo BlockOrogenic Belt
Madagascar
- Ankaratra Volcanic RangeVolcanic Range
- ⭔Antananarivo ProvinceProvince
- Sahatany Pegmatite Field (Mt Ibity area)Pegmatite Field
Somali PlateTectonic Plate
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
References
Dabren, Albert (1906) Sur quelques pierres précieuses de Madagascar [Rubellite et Triphane]. Bulletin de l'Académie Malgache, 4. 132-137with a note of a find of yellow tourmaline from Tsilaizina
Duparc, Louis, Wunder, M., Sabot, R. (1910) Les Minéraux des Pegmatites des environs d'Antsirabé a Madagascar. Mémoires de la Société de Physique et d'Histoire Naturelle de Geneve Vol. 36 (3)
Lacroix, Alfred (1922) Minéralogie de Madagascar, Tome I. Géologie-Minéralogie descriptive. Augustin Challamel. 624 pp.
Lacroix, Alfred (1922) Minéralogie de Madagascar- Tome II - Minéralogie appliqueé lithologie. A. Challamel. 694 pp. pp.327-328
Simmons, William B., Falster, Alexander U., Laurs, Brendan M. (2011) A survey of Mn-rich yellow tourmaline from worldwide localities and implications for the petrogenesis of granitic pegmatites, in Tourmaline: An ideal indicator of its host environment. The Canadian Mineralogist, 49 (1) 301-319 doi:10.3749/canmin.49.1.301with analysis of a yellow elbaite from Tsiliazina






Tsilaizina pegmatite, Sahanivotry Manandona, Antsirabe II District, Vakinankaratra, Madagascar