Aldeia de São Francisco de Assis, Covilhã, Castelo Branco, Portugali
| Regional Level Types | |
|---|---|
| Aldeia de São Francisco de Assis | Civil Parish |
| Covilhã | Municipality |
| Castelo Branco | District |
| Portugal | Country |
This page is currently not sponsored. Click here to sponsor this page.
Neighbouring regions:
Type:
Largest Settlements:
| Place | Population |
|---|---|
| Barroca Grande | 600 (2018) |
Other Languages:
French:
Aldeia de São Francisco de Assis, Covilhã, Castelo Branco, Portugal
German:
Aldeia de São Francisco de Assis, Covilhã, Distrikt Castelo Branco, Portugal
Portuguese:
Aldeia de São Francisco de Assis, Covilhã, Castelo Branco, Portugal
Russian:
Алдейя-де-Сан-Франсишку-де-Ассиш, Ковильян, Каштелу-Бранку, Португалия
Spanish:
Aldeia de São Francisco de Assis, Covilhã, Distrito de Castelo Branco, Portugal
Asturian:
Aldeia de São Francisco de Assis, Covilhã
Cebuano:
Aldeia de São Francisco de Assis, Covilhã , Distrito de Castelo Branco
Dutch:
Aldeia de São Francisco de Assis, Covilhã, Castelo Branco, Portugal
Kazakh (Cyrillic Script):
Алдейя-де-Сан-Франсишку-де-Ассиш
Minnan / Hokkien-Taiwanese:
Aldeia de São Francisco de Assis, Covilhã, Castelo Branco Koān
Ukrainian:
Алдейя-де-Сан-Франсішку-де-Ассіш, Ковілян, Каштелу-Бранку, Португалія
Aldeia de São Francisco de Assis is a Portuguese parish in the municipality of Covilhã, with an area of 16.08 km².
Previously known as Bodelhão, it was a village attached to the parish of Barroca in the municipality of Fundão, until 1895 and was attached to the extinct parish of Ourondo until 1901.
From 1864 to 1890 it was attached to the parish of Barroca, in the municipality of Fundão. It was annexed to the parish of Ourondo, in the municipality of Covilhã, by decree of September 7, 1895, appearing in these conditions in the 1900 census. It was detached by decree of July 19, 1901, becoming an independent parish with the name of Bodelhão. By decree nº 15,868, of August 15, 1928, it was renamed Aldeia de S. Francisco de Assis.
The parish is also made up of the attached villages of Barroca Grande and Parada.
* Couto Mineiro da Panasqueira
** Couto Mineiro do Vale da Ermida
Previously known as Bodelhão, it was a village attached to the parish of Barroca in the municipality of Fundão, until 1895 and was attached to the extinct parish of Ourondo until 1901.
From 1864 to 1890 it was attached to the parish of Barroca, in the municipality of Fundão. It was annexed to the parish of Ourondo, in the municipality of Covilhã, by decree of September 7, 1895, appearing in these conditions in the 1900 census. It was detached by decree of July 19, 1901, becoming an independent parish with the name of Bodelhão. By decree nº 15,868, of August 15, 1928, it was renamed Aldeia de S. Francisco de Assis.
The parish is also made up of the attached villages of Barroca Grande and Parada.
Registered mining concessions (up to 1962) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
|
* Couto Mineiro da Panasqueira
** Couto Mineiro do Vale da Ermida
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities33 valid minerals.
Detailed Mineral List:
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Calcite Formula: CaCO3 References: |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Chalcopyrite Formula: CuFeS2 References: |
| ⓘ Covellite Formula: CuS |
| ⓘ Cubanite Formula: CuFe2S3 |
| ⓘ Dolomite Formula: CaMg(CO3)2 |
| ⓘ Ferberite Formula: FeWO4 |
| ✪ Fluorapatite Formula: Ca5(PO4)3F References: |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ 'Freibergite Subgroup' Formula: (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ Galena Formula: PbS |
| ⓘ Isokite Formula: CaMg(PO4)F |
| ⓘ Löllingite Formula: FeAs2 |
| ⓘ Marcasite Formula: FeS2 |
| ⓘ Matildite Formula: AgBiS2 |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Panasqueiraite Formula: CaMg(PO4)(OH) |
| ⓘ Pavonite Formula: AgBi3S5 |
| ⓘ Pentlandite Formula: (NixFey)Σ9S8 |
| ⓘ Pyrargyrite Formula: Ag3SbS3 |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Pyrrhotite Formula: Fe1-xS |
| ⓘ Quartz Formula: SiO2 References: |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Sphalerite Formula: ZnS References: |
| ⓘ Stannite Formula: Cu2FeSnS4 |
| ⓘ Stephanite Formula: Ag5SbS4 |
| ⓘ Stibnite Formula: Sb2S3 |
| ⓘ 'Tetrahedrite Subgroup' Formula: Cu6(Cu4C2+2)Sb4S12S |
| ⓘ Thadeuite Formula: Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pentlandite | 2.BB.15 | (NixFey)Σ9S8 |
| ⓘ | Covellite | 2.CA.05a | CuS |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Stannite | 2.CB.15a | Cu2FeSnS4 |
| ⓘ | Cubanite | 2.CB.55a | CuFe2S3 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Stibnite | 2.DB.05 | Sb2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Marcasite | 2.EB.10a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Pyrargyrite | 2.GA.05 | Ag3SbS3 |
| ⓘ | 'Freibergite Subgroup' | 2.GB.05 | (Ag6,[Ag6]4+)(Cu4 C2+2)Sb4S12S0-1 |
| ⓘ | 'Tetrahedrite Subgroup' | 2.GB.05 | Cu6(Cu4C2+2)Sb4S12S |
| ⓘ | Stephanite | 2.GB.10 | Ag5SbS4 |
| ⓘ | Pavonite | 2.JA.05a | AgBi3S5 |
| ⓘ | Matildite | 2.JA.20 | AgBiS2 |
| Group 3 - Halides | |||
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Dolomite | 5.AB.10 | CaMg(CO3)2 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Thadeuite | 8.BH.05 | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| ⓘ | Isokite | 8.BH.10 | CaMg(PO4)F |
| ⓘ | Panasqueiraite | 8.BH.10 | CaMg(PO4)(OH) |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| Group 9 - Silicates | |||
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Panasqueiraite | CaMg(PO4)(OH) |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Calcite | CaCO3 |
| C | ⓘ Dolomite | CaMg(CO3)2 |
| C | ⓘ Siderite | FeCO3 |
| O | Oxygen | |
| O | ⓘ Calcite | CaCO3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Dolomite | CaMg(CO3)2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Isokite | CaMg(PO4)F |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Panasqueiraite | CaMg(PO4)(OH) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Siderite | FeCO3 |
| O | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| F | ⓘ Fluorite | CaF2 |
| F | ⓘ Isokite | CaMg(PO4)F |
| F | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Mg | Magnesium | |
| Mg | ⓘ Dolomite | CaMg(CO3)2 |
| Mg | ⓘ Isokite | CaMg(PO4)F |
| Mg | ⓘ Panasqueiraite | CaMg(PO4)(OH) |
| Mg | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| Al | Aluminium | |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Isokite | CaMg(PO4)F |
| P | ⓘ Panasqueiraite | CaMg(PO4)(OH) |
| P | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Covellite | CuS |
| S | ⓘ Cubanite | CuFe2S3 |
| S | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| S | ⓘ Galena | PbS |
| S | ⓘ Marcasite | FeS2 |
| S | ⓘ Matildite | AgBiS2 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Pavonite | AgBi3S5 |
| S | ⓘ Pentlandite | (NixFey)Σ9S8 |
| S | ⓘ Pyrargyrite | Ag3SbS3 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Pyrrhotite | Fe1-xS |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Stannite | Cu2FeSnS4 |
| S | ⓘ Stephanite | Ag5SbS4 |
| S | ⓘ Stibnite | Sb2S3 |
| S | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| K | Potassium | |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Calcite | CaCO3 |
| Ca | ⓘ Dolomite | CaMg(CO3)2 |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Ca | ⓘ Fluorite | CaF2 |
| Ca | ⓘ Isokite | CaMg(PO4)F |
| Ca | ⓘ Panasqueiraite | CaMg(PO4)(OH) |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ca | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Cubanite | CuFe2S3 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Löllingite | FeAs2 |
| Fe | ⓘ Marcasite | FeS2 |
| Fe | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Pyrrhotite | Fe1-xS |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Siderite | FeCO3 |
| Fe | ⓘ Stannite | Cu2FeSnS4 |
| Fe | ⓘ Thadeuite | Ca(Mg,Fe2+)3(PO4)2(OH,F)2 |
| Ni | Nickel | |
| Ni | ⓘ Pentlandite | (NixFey)Σ9S8 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Cu | ⓘ Covellite | CuS |
| Cu | ⓘ Cubanite | CuFe2S3 |
| Cu | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Cu | ⓘ Stannite | Cu2FeSnS4 |
| Cu | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| As | ⓘ Löllingite | FeAs2 |
| Mo | Molybdenum | |
| Mo | ⓘ Molybdenite | MoS2 |
| Ag | Silver | |
| Ag | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Ag | ⓘ Matildite | AgBiS2 |
| Ag | ⓘ Pavonite | AgBi3S5 |
| Ag | ⓘ Pyrargyrite | Ag3SbS3 |
| Ag | ⓘ Stephanite | Ag5SbS4 |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Sn | ⓘ Stannite | Cu2FeSnS4 |
| Sb | Antimony | |
| Sb | ⓘ Freibergite Subgroup | (Ag6,[Ag6]4+)(Cu4 C22+)Sb4S12S0-1 |
| Sb | ⓘ Pyrargyrite | Ag3SbS3 |
| Sb | ⓘ Stephanite | Ag5SbS4 |
| Sb | ⓘ Stibnite | Sb2S3 |
| Sb | ⓘ Tetrahedrite Subgroup | Cu6(Cu4C22+)Sb4S12S |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Scheelite | Ca(WO4) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Bi | Bismuth | |
| Bi | ⓘ Matildite | AgBiS2 |
| Bi | ⓘ Pavonite | AgBi3S5 |
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
| Wikipedia: | https://pt.wikipedia.org/wiki/Aldeia_de_S%C3%A3o_Francisco_de_Assis |
|---|---|
| Wikidata ID: | Q1024266 |
| GeoNames ID: | 8014270 |
Localities in this Region
- Castelo Branco
- Covilhã
- Aldeia de São Francisco de Assis
- Covilhã
- Castelo Branco
Other Regions, Features and Areas that Intersect
Eurasian PlateTectonic Plate
- Iberian MassifOrogenic Belt
EuropeContinent
Iberian PeninsulaPeninsula
Portugal
- Panasqueira MinesGroup of Mines
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
Aldeia de São Francisco de Assis, Covilhã, Castelo Branco, Portugal