La Grange Mine, Meymac, Ussel, Corrèze, Nouvelle-Aquitaine, Francei
| Regional Level Types | |
|---|---|
| La Grange Mine | Mine |
| Meymac | Commune |
| Ussel | Arrondissement |
| Corrèze | Department |
| Nouvelle-Aquitaine | Region |
| France | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
45° 31' 57'' North , 2° 10' 59'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Meymac | 3,048 (2016) | 3.0km |
| La Feuillade | 724 (2018) | 4.0km |
| Ambrugeat | 224 (2016) | 5.1km |
| Saint-Angel | 596 (2016) | 5.3km |
| Combressol | 306 (2016) | 5.6km |
Other/historical names associated with this locality:
Limousin
Name(s) in local language(s):
La mine de La Grange, Meymac, Corrèze, Limousin, France
No description has been added for this locality. Can you add one?
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Anatase Formula: TiO2 |
| ⓘ Baryte Formula: BaSO4 |
| ⓘ Bismuthinite Formula: Bi2S3 |
| ⓘ Bismutite Formula: (BiO)2CO3 |
| ⓘ Cannonite Formula: Bi2(SO4)O(OH)2 |
| ⓘ Chalcopyrite Formula: CuFeS2 |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Ferrimolybdite Formula: Fe2(MoO4)3 · nH2O |
| ⓘ Galena Formula: PbS |
| ⓘ Goethite Formula: Fe3+O(OH) References: |
| ⓘ Hübnerite Formula: MnWO4 |
| ⓘ Hydrokenoelsmoreite Formula: ◻2W2O6(H2O) |
| ⓘ Hydrokenoelsmoreite var. Ferritungstite Formula: ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ Hydrotungstite Formula: WO3 · 2H2O |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Koragoite Formula: (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| ⓘ Meymacite Formula: WO3 · 2H2O |
| ⓘ Molybdenite Formula: MoS2 |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 |
| ⓘ Native Bismuth Formula: Bi |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Natrojarosite Formula: NaFe3(SO4)2(OH)6 |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Opal var. Opal-AN Formula: SiO2 · nH2O |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Chalcedony Formula: SiO2 |
| ⓘ Raspite Formula: Pb(WO4) |
| ⓘ Russellite Formula: Bi2WO6 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Sphalerite Formula: ZnS |
| ⓘ Wulfenite Formula: Pb(MoO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements | |||
|---|---|---|---|
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts | |||
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Bismuthinite | 2.DB.05 | Bi2S3 |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | Quartz var. Chalcedony | 4.DA.05 | SiO2 |
| ⓘ | 4.DA.05 | SiO2 | |
| ⓘ | Opal var. Opal-AN | 4.DA.10 | SiO2 · nH2O |
| ⓘ | 4.DA.10 | SiO2 · nH2O | |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Hübnerite | 4.DB.30 | MnWO4 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Koragoite | 4.DE.10 | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| ⓘ | Raspite | 4.DG.20 | Pb(WO4) |
| ⓘ | Hydrokenoelsmoreite var. Ferritungstite | 4.DH.15 | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| ⓘ | 4.DH.15 | ◻2W2O6(H2O) | |
| ⓘ | Meymacite | 4.FJ.05 | WO3 · 2H2O |
| ⓘ | Hydrotungstite | 4.FJ.15 | WO3 · 2H2O |
| Group 5 - Nitrates and Carbonates | |||
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates | |||
| ⓘ | Baryte | 7.AD.35 | BaSO4 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Natrojarosite | 7.BC.10 | NaFe3(SO4)2(OH)6 |
| ⓘ | Cannonite | 7.BD.35 | Bi2(SO4)O(OH)2 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| ⓘ | Ferrimolybdite | 7.GB.30 | Fe2(MoO4)3 · nH2O |
| Group 9 - Silicates | |||
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| H | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| H | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| H | ⓘ Goethite | Fe3+O(OH) |
| H | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| H | ⓘ Hydrotungstite | WO3 · 2H2O |
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| H | ⓘ Meymacite | WO3 · 2H2O |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| H | ⓘ Opal | SiO2 · nH2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| C | Carbon | |
| C | ⓘ Bismutite | (BiO)2CO3 |
| O | Oxygen | |
| O | ⓘ Anatase | TiO2 |
| O | ⓘ Baryte | BaSO4 |
| O | ⓘ Bismutite | (BiO)2CO3 |
| O | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| O | ⓘ Quartz var. Chalcedony | SiO2 |
| O | ⓘ Ferberite | FeWO4 |
| O | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| O | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| O | ⓘ Goethite | Fe3+O(OH) |
| O | ⓘ Hübnerite | MnWO4 |
| O | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| O | ⓘ Hydrotungstite | WO3 · 2H2O |
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| O | ⓘ Meymacite | WO3 · 2H2O |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| O | ⓘ Opal | SiO2 · nH2O |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Raspite | Pb(WO4) |
| O | ⓘ Russellite | Bi2WO6 |
| O | ⓘ Scheelite | Ca(WO4) |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Wulfenite | Pb(MoO4) |
| O | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| O | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Na | Sodium | |
| Na | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | Silicon | |
| Si | ⓘ Quartz var. Chalcedony | SiO2 |
| Si | ⓘ Opal var. Opal-AN | SiO2 · nH2O |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Opal | SiO2 · nH2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| S | Sulfur | |
| S | ⓘ Baryte | BaSO4 |
| S | ⓘ Bismuthinite | Bi2S3 |
| S | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| S | ⓘ Chalcopyrite | CuFeS2 |
| S | ⓘ Galena | PbS |
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| S | ⓘ Molybdenite | MoS2 |
| S | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| S | ⓘ Pyrite | FeS2 |
| S | ⓘ Sphalerite | ZnS |
| S | ⓘ Native Sulphur | S8 |
| K | Potassium | |
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Scheelite | Ca(WO4) |
| Ti | Titanium | |
| Ti | ⓘ Anatase | TiO2 |
| Ti | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| Mn | Manganese | |
| Mn | ⓘ Hübnerite | MnWO4 |
| Mn | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| Fe | Iron | |
| Fe | ⓘ Chalcopyrite | CuFeS2 |
| Fe | ⓘ Ferberite | FeWO4 |
| Fe | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Fe | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| Fe | ⓘ Goethite | Fe3+O(OH) |
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
| Fe | ⓘ Natrojarosite | NaFe3(SO4)2(OH)6 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| Cu | Copper | |
| Cu | ⓘ Chalcopyrite | CuFeS2 |
| Zn | Zinc | |
| Zn | ⓘ Sphalerite | ZnS |
| Nb | Niobium | |
| Nb | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| Mo | Molybdenum | |
| Mo | ⓘ Ferrimolybdite | Fe2(MoO4)3 · nH2O |
| Mo | ⓘ Molybdenite | MoS2 |
| Mo | ⓘ Wulfenite | Pb(MoO4) |
| Ba | Barium | |
| Ba | ⓘ Baryte | BaSO4 |
| Ta | Tantalum | |
| Ta | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| W | Tungsten | |
| W | ⓘ Ferberite | FeWO4 |
| W | ⓘ Hydrokenoelsmoreite var. Ferritungstite | ◻2(W,Fe3+)2(O,OH)6(H2O) |
| W | ⓘ Hübnerite | MnWO4 |
| W | ⓘ Hydrotungstite | WO3 · 2H2O |
| W | ⓘ Meymacite | WO3 · 2H2O |
| W | ⓘ Raspite | Pb(WO4) |
| W | ⓘ Russellite | Bi2WO6 |
| W | ⓘ Scheelite | Ca(WO4) |
| W | ⓘ Koragoite | (Mn2+,Fe3+)3(Nb,Ta,Ti)2(Nb,Mn)2(W,Ta)2O20 |
| W | ⓘ Hydrokenoelsmoreite | ◻2W2O6(H2O) |
| Pb | Lead | |
| Pb | ⓘ Galena | PbS |
| Pb | ⓘ Raspite | Pb(WO4) |
| Pb | ⓘ Wulfenite | Pb(MoO4) |
| Bi | Bismuth | |
| Bi | ⓘ Native Bismuth | Bi |
| Bi | ⓘ Bismuthinite | Bi2S3 |
| Bi | ⓘ Bismutite | (BiO)2CO3 |
| Bi | ⓘ Cannonite | Bi2(SO4)O(OH)2 |
| Bi | ⓘ Russellite | Bi2WO6 |
Other Regions, Features and Areas containing this locality
Eurasian PlateTectonic Plate
- Moldanubian BeltOrogenic Belt
EuropeContinent
France
- Massif CentralHighland Region
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.
La Grange Mine, Meymac, Ussel, Corrèze, Nouvelle-Aquitaine, France