Long Hill, Leominster, Worcester County, Massachusetts, USAi
| Regional Level Types | |
|---|---|
| Long Hill | Hill |
| Leominster | City |
| Worcester County | County |
| Massachusetts | State |
| USA | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
42° 30' 23'' North , 71° 46' 56'' West
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Nearest Settlements:
| Place | Population | Distance |
|---|---|---|
| Leominster | 41,569 (2017) | 2.8km |
| Sterling | 7,384 (2017) | 7.8km |
| Fitchburg | 40,545 (2017) | 8.7km |
| Princeton | 3,412 (2017) | 10.1km |
| South Lancaster | 1,894 (2017) | 10.4km |
Nearest Clubs:
Local clubs are the best way to get access to collecting localities
Local clubs are the best way to get access to collecting localities
| Club | Location | Distance |
|---|---|---|
| Worcester Mineral Club | Worcester, Massachusetts | 27km |
| Nashoba Valley Mineralogical Society | Westford, Massachusetts | 29km |
Spodumene-bearing pegmatites are exposed on Long Hill, part of a 2.5 mile and 1000 foot wide belt extending south into Sterling.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsDetailed Mineral List:
| ⓘ Albite Formula: Na(AlSi3O8) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 References: |
| ⓘ Amblygonite ? Formula: LiAl(PO4)F Description: Probably montebrasite. |
| ⓘ Arsenopyrite Formula: FeAsS |
| ⓘ Autunite Formula: Ca(UO2)2(PO4)2 · 10-12H2O |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Montebrasite Formula: LiAl(PO4)(OH) References: |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Habit: flakes up to 1 inch diameter |
| ⓘ Pollucite Formula: (Cs,Na)2(Al2Si4O12) · 2H2O Habit: irregular masses to 1 inch in diameter Description: Pollucite was first found in Massachusetts in 1937 by Roscoe J. Whitney of Leominster (Gonyer, 1937). |
| ⓘ Purpurite ? Formula: Mn3+(PO4) |
| ⓘ Pyrite Formula: FeS2 |
| ⓘ Quartz Formula: SiO2 |
| ⓘ Quartz var. Milky Quartz Formula: SiO2 |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) Description: Black schorl is associated with non-spodumene pegmatites only. |
| ⓘ Spodumene Formula: LiAlSi2O6 Habit: "Rectangular plates" 1 to 2 inches long average in outcrops, up to 6 inches. Larger in boulders (primarily at Rocky Hill, Sterling). (Billings & Wolfe, 1944) Colour: white to buff-colored |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) Description: Occurs in schist "country rock" surrounding pegmatites. References: |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ 'Tourmaline' Formula: AD3G6 (T6O18)(BO3)3X3Z Habit: crystals to 3 inches long Colour: green to blue Description: Blue and green crystals are associated with spodumene pegmatites. Black crystals (schorl) are associated with non-spodumene pegmatites on Long Hill. |
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 2 - Sulphides and Sulfosalts | |||
|---|---|---|---|
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| Group 4 - Oxides and Hydroxides | |||
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Milky Quartz | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Purpurite ? | 8.AB.10 | Mn3+(PO4) |
| ⓘ | Amblygonite ? | 8.BB.05 | LiAl(PO4)F |
| ⓘ | Montebrasite | 8.BB.05 | LiAl(PO4)(OH) |
| ⓘ | Autunite | 8.EB.05 | Ca(UO2)2(PO4)2 · 10-12H2O |
| Group 9 - Silicates | |||
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene | 9.DA.30 | LiAlSi2O6 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Tourmaline' | - | AD3G6 (T6O18)(BO3)3X3Z |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| H | ⓘ Montebrasite | LiAl(PO4)(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Li | Lithium | |
| Li | ⓘ Amblygonite | LiAl(PO4)F |
| Li | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| B | Boron | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Amblygonite | LiAl(PO4)F |
| O | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Montebrasite | LiAl(PO4)(OH) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Purpurite | Mn3+(PO4) |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| O | ⓘ Tourmaline | AD3G6 (T6O18)(BO3)3X3Z |
| O | ⓘ Quartz var. Milky Quartz | SiO2 |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| F | Fluorine | |
| F | ⓘ Amblygonite | LiAl(PO4)F |
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Amblygonite | LiAl(PO4)F |
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Montebrasite | LiAl(PO4)(OH) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
| Si | ⓘ Quartz var. Milky Quartz | SiO2 |
| P | Phosphorus | |
| P | ⓘ Amblygonite | LiAl(PO4)F |
| P | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| P | ⓘ Montebrasite | LiAl(PO4)(OH) |
| P | ⓘ Purpurite | Mn3+(PO4) |
| S | Sulfur | |
| S | ⓘ Arsenopyrite | FeAsS |
| S | ⓘ Pyrite | FeS2 |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
| Mn | Manganese | |
| Mn | ⓘ Purpurite | Mn3+(PO4) |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | Iron | |
| Fe | ⓘ Arsenopyrite | FeAsS |
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
| Fe | ⓘ Pyrite | FeS2 |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| As | Arsenic | |
| As | ⓘ Arsenopyrite | FeAsS |
| Nb | Niobium | |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| U | Uranium | |
| U | ⓘ Autunite | Ca(UO2)2(PO4)2 · 10-12H2O |
Other Regions, Features and Areas containing this locality
North AmericaContinent
North America PlateTectonic Plate
- Ganderia DomainDomain
- GranderiaPassive Margin
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.



Long Hill, Leominster, Worcester County, Massachusetts, USA