Parun pegmatite field, Nuristan, Afghanistani
| Regional Level Types | |
|---|---|
| Parun pegmatite field | Pegmatite Field |
| Nuristan | Province |
| Afghanistan | Country |
This page is currently not sponsored. Click here to sponsor this page.
Latitude & Longitude (WGS84):
35° 25' 14'' North , 70° 55' 23'' East
Latitude & Longitude (decimal):
Type:
Köppen climate type:
Other/historical names associated with this locality:
Paroon; Parown
Li-Ta-Nb-Sn-Cs-Rb-rich pegmatite veins and dykes, hosted in a variety of lithologies. The field is about 65 km long in N-S direction. Individual dykes are up to 2 km long, but gem pegmatites are much smaller, usually up to 60 m long and up to 8 m thick.
The field is named after the Parun District, but also extends into Wayghal District.
The GPS coordinates are centered on Parun village.
The field is named after the Parun District, but also extends into Wayghal District.
The GPS coordinates are centered on Parun village.
Select Mineral List Type
Standard Detailed Gallery Strunz Chemical ElementsCommodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities14 valid minerals.
Rock Types Recorded
Rock list contains entries from the region specified including sub-localities
Select Rock List Type
Alphabetical List Tree DiagramDetailed Mineral List:
Gallery:
List of minerals arranged by Strunz 10th Edition classification
| Group 4 - Oxides and Hydroxides | |||
|---|---|---|---|
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rose Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Smoky Quartz | 4.DA.05 | SiO2 |
| ⓘ | var. Rock Crystal | 4.DA.05 | SiO2 |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| Group 8 - Phosphates, Arsenates and Vanadates | |||
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Pyromorphite | 8.BN.05 | Pb5(PO4)3Cl |
| Group 9 - Silicates | |||
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Beryl var. Aquamarine | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | 9.CJ.05 | Be3Al2(Si6O18) | |
| ⓘ | var. Morganite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | var. Goshenite | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Pezzottaite-(Cs) | 9.CJ.60 | Cs(Be2Li)Al2(Si6O18) |
| ⓘ | Elbaite | 9.CK.05 | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Spodumene var. Kunzite | 9.DA.30 | LiAlSi2O6 |
| ⓘ | 9.DA.30 | LiAlSi2O6 | |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Microcline | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Pollucite | 9.GB.05 | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Unclassified | |||
| ⓘ | 'Tourmaline var. Indicolite' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Tantalite' | - | (Mn,Fe)(Ta,Nb)2O6 |
| ⓘ | 'Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Childrenite-Eosphorite Series' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Tourmaline var. Watermelon Tourmaline' | - | AD3G6(T6O18)(BO3)3X3Z |
List of minerals for each chemical element
| H | Hydrogen | |
|---|---|---|
| H | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| H | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| H | ⓘ Childrenite-Eosphorite Series | |
| Li | Lithium | |
| Li | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Li | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Li | ⓘ Spodumene | LiAlSi2O6 |
| Li | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Be | Beryllium | |
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Be | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Be | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| B | Boron | |
| B | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline var. Indicolite | |
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| B | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | Oxygen | |
| O | ⓘ Albite | Na(AlSi3O8) |
| O | ⓘ Beryl | Be3Al2(Si6O18) |
| O | ⓘ Cassiterite | SnO2 |
| O | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
| O | ⓘ Tourmaline var. Indicolite | |
| O | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| O | ⓘ Microcline | K(AlSi3O8) |
| O | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| O | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| O | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| O | ⓘ Quartz | SiO2 |
| O | ⓘ Quartz var. Rose Quartz | SiO2 |
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| O | ⓘ Quartz var. Smoky Quartz | SiO2 |
| O | ⓘ Spodumene | LiAlSi2O6 |
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| O | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| O | ⓘ Tourmaline | AD3G6(T6O18)(BO3)3X3Z |
| O | ⓘ Quartz var. Rock Crystal | SiO2 |
| O | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| O | ⓘ Childrenite-Eosphorite Series | |
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
| O | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| F | Fluorine | |
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
| Na | Sodium | |
| Na | ⓘ Albite | Na(AlSi3O8) |
| Na | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | Aluminium | |
| Al | ⓘ Albite | Na(AlSi3O8) |
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
| Al | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Al | ⓘ Microcline | K(AlSi3O8) |
| Al | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Al | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Al | ⓘ Spodumene | LiAlSi2O6 |
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Al | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Al | ⓘ Childrenite-Eosphorite Series | |
| Al | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Si | Silicon | |
| Si | ⓘ Albite | Na(AlSi3O8) |
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
| Si | ⓘ Elbaite | Na(Li1.5Al1.5)Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Spodumene var. Kunzite | LiAlSi2O6 |
| Si | ⓘ Microcline | K(AlSi3O8) |
| Si | ⓘ Beryl var. Morganite | Be3Al2(Si6O18) |
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Si | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Si | ⓘ Quartz | SiO2 |
| Si | ⓘ Quartz var. Rose Quartz | SiO2 |
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Si | ⓘ Quartz var. Smoky Quartz | SiO2 |
| Si | ⓘ Spodumene | LiAlSi2O6 |
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Si | ⓘ Quartz var. Rock Crystal | SiO2 |
| Si | ⓘ Beryl var. Goshenite | Be3Al2(Si6O18) |
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
| Si | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| P | Phosphorus | |
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
| P | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| P | ⓘ Childrenite-Eosphorite Series | |
| Cl | Chlorine | |
| Cl | ⓘ Pyromorphite | Pb5(PO4)3Cl |
| K | Potassium | |
| K | ⓘ Microcline | K(AlSi3O8) |
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
| Ca | Calcium | |
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
| Mn | Manganese | |
| Mn | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Mn | ⓘ Childrenite-Eosphorite Series | |
| Fe | Iron | |
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
| Fe | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Fe | ⓘ Childrenite-Eosphorite Series | |
| Nb | Niobium | |
| Nb | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
| Sn | Tin | |
| Sn | ⓘ Cassiterite | SnO2 |
| Cs | Caesium | |
| Cs | ⓘ Pollucite | (Cs,Na)2(Al2Si4O12) · 2H2O |
| Cs | ⓘ Pezzottaite-(Cs) | Cs(Be2Li)Al2(Si6O18) |
| Ta | Tantalum | |
| Ta | ⓘ Tantalite | (Mn,Fe)(Ta,Nb)2O6 |
| Pb | Lead | |
| Pb | ⓘ Pyromorphite | Pb5(PO4)3Cl |
Localities in this Region
- Nuristan
Other Regions, Features and Areas containing this locality
AsiaContinent
- Hindukush Himalayan RegionGroup of Mountain Ranges
Eurasian PlateTectonic Plate
- Lhasa
- Karakoram ProvinceVolcanic Arc
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary.





Parun pegmatite field, Nuristan, Afghanistan